- Tổng quan
- Nội dung
- VB gốc
- Tiếng Anh
- Hiệu lực
- VB liên quan
- Lược đồ
-
Nội dung hợp nhất
Tính năng này chỉ có tại LuatVietnam.vn. Nội dung hợp nhất tổng hợp lại tất cả các quy định còn hiệu lực của văn bản gốc và các văn bản sửa đổi, bổ sung, đính chính... trên một trang. Việc hợp nhất văn bản gốc và những văn bản, Thông tư, Nghị định hướng dẫn khác không làm thay đổi thứ tự điều khoản, nội dung.
Khách hàng chỉ cần xem Nội dung hợp nhất là có thể nắm bắt toàn bộ quy định hiện hành đang áp dụng, cho dù văn bản gốc đã qua nhiều lần chỉnh sửa, bổ sung.
- Tải về
Nghị định 26/2011/NĐ-CP sửa hướng dẫn Luật Hóa chất
| Cơ quan ban hành: | Chính phủ |
Số công báo:
Số công báo là mã số ấn phẩm được đăng chính thức trên ấn phẩm thông tin của Nhà nước. Mã số này do Chính phủ thống nhất quản lý.
|
Đã biết
|
| Số hiệu: | 26/2011/NĐ-CP | Ngày đăng công báo: |
Đã biết
|
| Loại văn bản: | Nghị định | Người ký: | Nguyễn Tấn Dũng |
|
Ngày ban hành:
Ngày ban hành là ngày, tháng, năm văn bản được thông qua hoặc ký ban hành.
|
08/04/2011 |
Ngày hết hiệu lực:
Ngày hết hiệu lực là ngày, tháng, năm văn bản chính thức không còn hiệu lực (áp dụng).
|
Đã biết
|
|
Áp dụng:
Ngày áp dụng là ngày, tháng, năm văn bản chính thức có hiệu lực (áp dụng).
|
Đã biết
|
Tình trạng hiệu lực:
Cho biết trạng thái hiệu lực của văn bản đang tra cứu: Chưa áp dụng, Còn hiệu lực, Hết hiệu lực, Hết hiệu lực 1 phần; Đã sửa đổi, Đính chính hay Không còn phù hợp,...
|
Đã biết
|
| Lĩnh vực: | Chính sách |
TÓM TẮT NGHỊ ĐỊNH 26/2011/NĐ-CP
Ngày 08/04/2011, Chính phủ ban hành Nghị định số 26/2011/NĐ-CP sửa đổi, bổ sung một số điều của Nghị định số 108/2008/NĐ-CP ngày 7/10/2008 quy định chi tiết và hướng dẫn thi hành một số điều của Luật Hóa chất.
Theo đó, Nghị định sửa đổi, bổ sung một số quy định về điều kiện sản xuất và kinh doanh hóa chất. Ngoài Giám đốc hoặc Phó Giám đốc như quy định tại Nghị định 108/2008/NĐ-CP của cơ sở sản xuất hóa chất phải có bằng đại học các ngành hóa chất thì quy định mới bổ sung thêm đối với cán bộ phụ trách hoạt động sản xuất cũng phải có bằng đại học trở lên về chuyên ngành hóa chất.
Ngoài ra, Nghị định còn bổ sung một số quy định mới về điều kiện đối với cơ sở sản xuất hóa chất như: Người lao động trực tiếp tiếp xúc với hóa chất của cơ sở sản xuất phải được đào tạo, huấn luyện về kỹ thuật an toàn hóa chất; Cơ sở vật chất - kỹ thuật trong cơ sở sản xuất hóa chất phải đáp ứng yêu cầu theo quy định tại Điều 12 của Luật Hóa chất; Có biện pháp phòng ngừa, ứng phó sự cố hóa chất được cơ quan có thẩm quyền xác nhận hoặc Kế hoạch phòng ngừa, ứng phó sự cố hóa chất được cơ quan có thẩm quyền phê duyệt.
Trong điều kiện kinh doanh hóa chất, người phụ trách về an toàn hóa chất của cơ sở kinh doanh phải có trình độ trung cấp trở lên về ngành hóa chất; Người trực tiếp tiếp xúc với hóa chất của cơ sở kinh doanh phải được đào tạo, huấn luyện kỹ thuật về an toàn hóa chất… Đây là những quy định mới được bổ sung mà Nghị định 108/2008/NĐ-CP chưa quy định.
Nghị định mới cũng quy định rõ, các cơ sở sản xuất kinh doanh, cất giữ, bảo quản, sử dụng hóa chất nguy hiểm đang tồn tại, nếu chưa thiết lập khoảng cách an toàn thì phải có lộ trình xác định khoảng cách an toàn và báo cáo việc thực hiện lộ trình với Bộ quản lý ngành, lĩnh vực và UBND cấp tỉnh. Việc thiết lập khoảng cách an toàn phải hoàn thành trước ngày 30/12/2012 (quy định tại Nghị định 108/2008/NĐ-CP là 31/12/2010).
Nghị định có hiệu lực thi hành kể từ ngày 01/06/2011 và thay thế Nghị định số 68/2005/NĐ-CP ngày 20/05/2005 của Chính phủ.
Văn bản này được thay thế bởi 113/2017/NĐ-CP
Xem chi tiết Nghị định 26/2011/NĐ-CP có hiệu lực kể từ ngày 01/06/2011
Tải Nghị định 26/2011/NĐ-CP
|
CHÍNH PHỦ Số: 26/2011/NĐ-CP |
CỘNG HÒA XÃ HỘI CHỦ NGHĨA VIỆT NAM Hà Nội, ngày 08 tháng 04 năm 2011 |
NGHỊ ĐỊNH
SỬA ĐỔI, BỔ SUNG MỘT SỐ ĐIỀU CỦA NGHỊ ĐỊNH SỐ 108/2008/NĐ-CP NGÀY 07 THÁNG 10 NĂM 2008 CỦA CHÍNH PHỦ QUY ĐỊNH CHI TIẾT VÀ HƯỚNG DẪN THI HÀNH MỘT SỐ ĐIỀU CỦA LUẬT HÓA CHẤT
------------------------
CHÍNH PHỦ
Căn cứ Luật Tổ chức Chính phủ ngày 25 tháng 12 năm 2001;
Căn cứ Luật Hóa chất ngày 21 tháng 11 năm 2007;
Xét đề nghị của Bộ trưởng Bộ Công thương và Bộ trưởng Bộ Y tế,
NGHỊ ĐỊNH:
Điều 1. Sửa đổi, bổ sung một số điều của Nghị định số 108/2008/NĐ-CP ngày 07 tháng 10 năm 2008 của Chính phủ quy định chi tiết và hướng dẫn thi hành một số điều của Luật Hóa chất như sau:
1. Sửa đổi, bổ sung tên Điều, khoản 1, điểm b, bổ sung điểm d Điều 4
“Điều 4. Danh mục hóa chất sản xuất, kinh doanh có điều kiện; Danh mục hóa chất hạn chế sản xuất, kinh doanh; Danh mục hóa chất cấm và Danh mục hóa chất độc
1. Ban hành kèm theo Nghị định này các danh mục hóa chất theo quy định tại Điều 14, Điều 15, Điều 19 và Điều 23 của Luật Hóa chất, bao gồm:
b) Danh mục hóa chất hạn chế sản xuất, kinh doanh được sửa đổi, bổ sung (Phụ lục II);
d) Danh mục hóa chất độc phải xây dựng Phiếu kiểm soát mua, bán hóa chất độc (Phụ lục VI).”
2. Sửa đổi, bổ sung Điều 5
“Điều 5. Danh mục hóa chất nguy hiểm phải xây dựng Biện pháp; Kế hoạch phòng ngừa, ứng phó sự cố hóa chất và thiết lập khoảng cách an toàn.
1. Ban hành kèm theo Nghị định này:
a) Danh mục hóa chất nguy hiểm tổ chức, cá nhân sản xuất, kinh doanh, cất giữ, bảo quản, sử dụng hóa chất phải xây dựng Kế hoạch phòng ngừa, ứng phó sự cố hóa chất theo quy định tại Điều 38 của Luật Hóa chất và thiết lập khoảng cách an toàn được sửa đổi, bổ sung (Phụ lục IV);
b) Danh mục hóa chất nguy hiểm mà tổ chức, cá nhân sản xuất, kinh doanh, cất giữ, bảo quản, sử dụng hóa chất phải xây dựng Biện pháp phòng ngừa, ứng phó sự cố hóa chất (Phụ lục VII).
2. Theo yêu cầu quản lý trong từng thời kỳ, Bộ Công thương chủ trì, phối hợp với các Bộ quản lý ngành, lĩnh vực xem xét, trình Chính phủ sửa đổi, bổ sung Danh mục hóa chất quy định tại khoản 1 Điều này.”
3. Bổ sung khoản 1 Điều 6
“Điều 6. Danh mục hóa chất phải khai báo
1. Ban hành kèm theo Nghị định này Danh mục hóa chất phải khai báo được sửa đổi, bổ sung (Phụ lục V).”
4. Sửa đổi, bổ sung Điều 7
“Điều 7. Điều kiện sản xuất, kinh doanh hóa chất thuộc Danh mục hóa chất sản xuất, kinh doanh có điều kiện trong ngành công nghiệp
1. Điều kiện sản xuất hóa chất
a) Giám đốc hoặc Phó Giám đốc kỹ thuật hoặc cán bộ kỹ thuật phụ trách hoạt động sản xuất hóa chất của cơ sở sản xuất hóa chất phải có bằng đại học trở lên về chuyên ngành hóa chất;
b) Cán bộ chuyên trách quản lý an toàn hóa chất được đào tạo hoặc huấn luyện về kỹ thuật an toàn hóa chất;
c) Người lao động trực tiếp tiếp xúc với hóa chất của cơ sở sản xuất phải được đào tạo, huấn luyện về kỹ thuật an toàn hóa chất;
d) Cơ sở vật chất – kỹ thuật trong cơ sở sản xuất hóa chất phải đáp ứng yêu cầu theo quy định tại Điều 12 của Luật Hóa chất;
đ) Có trang thiết bị phù hợp hoặc hợp đồng liên kết với đơn vị có đủ năng lực được cơ quan có thẩm quyền thừa nhận để kiểm tra hàm lượng và các thành phần hóa chất;
e) Có Biện pháp phòng ngừa, ứng phó sự cố hóa chất được cơ quan có thẩm quyền xác nhận hoặc Kế hoạch phòng ngừa, ứng phó sự cố hóa chất được cơ quan có thẩm quyền phê duyệt;
g) Có trang thiết bị an toàn phòng, chống cháy nổ theo quy định của Luật Phòng cháy và chữa cháy; có trang thiết bị kiểm soát, thu gom và xử lý chất thải nguy hại hoặc có hợp đồng vận chuyển, xử lý, tiêu hủy chất thải nguy hại theo quy định của Luật Bảo vệ môi trường.
2. Điều kiện kinh doanh hóa chất
a) Người phụ trách về an toàn hóa chất của cơ sở kinh doanh hóa chất phải có trình độ trung cấp trở lên về chuyên ngành hóa chất;
b) Người trực tiếp tiếp xúc với hóa chất của cơ sở kinh doanh phải được đào tạo, huấn luyện về kỹ thuật an toàn hóa chất;
c) Cơ sở vật chất – kỹ thuật trong cơ sở kinh doanh hóa chất phải đáp ứng yêu cầu theo quy định tại Điều 12 của Luật Hóa chất;
d) Có Biện pháp phòng ngừa, ứng phó sự cố hóa chất được cơ quan có thẩm quyền xác nhận hoặc Kế hoạch phòng ngừa, ứng phó sự cố hóa chất được cơ quan có thẩm quyền phê duyệt;
đ) Có trang thiết bị an toàn phòng, chống cháy nổ theo quy định của Luật Phòng cháy và chữa cháy; có trang thiết bị kiểm soát, thu gom và xử lý chất thải nguy hại hoặc có hợp đồng vận chuyển, xử lý, tiêu hủy chất thải nguy hại theo quy định của Luật Bảo vệ môi trường.”
5. Bổ sung Điều 7a sau Điều 7
“Điều 7a. Đào tạo, huấn luyện về kỹ thuật an toàn hóa chất
1. Tổ chức, cá nhân hoạt động hóa chất phải có trách nhiệm trong việc cử lãnh đạo, người quản lý, người lao động trong cơ sở tham gia các khóa đào tạo, huấn luyện về kỹ thuật an toàn hóa chất.
2. Đối tượng được đào tạo, huấn luyện về kỹ thuật an toàn hóa chất gồm: lãnh đạo, người quản lý các bộ phận liên quan trực tiếp đến hoạt động hóa chất; người trực tiếp sản xuất, kinh doanh, vận chuyển, cất giữ, bảo quản, sử dụng hóa chất.
3. Nội dung đào tạo, huấn luyện về kỹ thuật an toàn hóa chất trong hoạt động hóa chất phải phù hợp với vị trí công tác và chủng loại hóa chất, gồm:
a) Đối với lãnh đạo, người quản lý các bộ phận liên quan trực tiếp đến hoạt động hóa chất được đào tạo, huấn luyện kiến thức pháp luật về quản lý hoạt động hóa chất; kiến thức pháp luật liên quan đến phòng cháy, chữa cháy; quy định về khoảng cách an toàn; thực hiện Biện pháp, Kế hoạch phòng ngừa, ứng phó sự cố hóa chất;
b) Đối với người trực tiếp sản xuất, kinh doanh, vận chuyển, cất giữ, bảo quản, sử dụng hóa chất được đào tạo, huấn luyện các nội dung về an toàn trong sản xuất, kinh doanh, sử dụng, bảo quản và vận chuyển hóa chất quy định tại tiêu chuẩn, quy chuẩn và các văn bản quy phạm pháp luật hiện hành;
c) Bộ quản lý ngành, lĩnh vực quy định cụ thể chương trình, nội dung đào tạo, huấn luyện về kỹ thuật an toàn hóa chất trong hoạt động hóa chất cho các đối tượng quy định tại khoản 2 Điều này.
4. Sau khi được đào tạo, huấn luyện về kỹ thuật an toàn hóa chất, người đạt yêu cầu được cấp Giấy chứng nhận.
5. Bộ quản lý ngành, lĩnh vực hướng dẫn và ủy quyền cho cơ quan chuyên môn thuộc Ủy ban nhân dân cấp tỉnh tổ chức các lớp đào tạo, huấn luyện về kỹ thuật an toàn hóa chất theo đúng nội dung, chương trình quy định tại khoản 3 Điều này và cấp Giấy chứng nhận đào tạo, huấn luyện về kỹ thuật an toàn hóa chất cho tổ chức, cá nhân hoạt động hóa chất trên địa bàn quản lý.
6. Trước ngày 31 tháng 12 hàng năm, cơ quan cấp Giấy chứng nhận quy định tại khoản 5 Điều này có trách nhiệm báo cáo Bộ quản lý ngành, lĩnh vực; trước ngày 15 tháng 01 hàng năm, Bộ quản lý ngành, lĩnh vực gửi Bộ Công thương tình hình hoạt động đào tạo, huấn luyện về kỹ thuật an toàn hóa chất thuộc phạm vi quản lý.
7. Bộ quản lý ngành, lĩnh vực thực hiện kiểm tra hoạt động đào tạo, huấn luyện về kỹ thuật an toàn hóa chất của cơ quan cấp Giấy chứng nhận thuộc phạm vi quản lý.”
6. Bổ sung Điều 7b sau Điều 7
“Điều 7b. Hồ sơ, thủ tục, cơ quan xác nhận Biện pháp phòng ngừa, ứng phó sự cố hóa chất
1. Tổ chức, cá nhân sản xuất, kinh doanh, cất giữ, bảo quản, sử dụng hóa chất nguy hiểm phải xây dựng Biện pháp phòng ngừa, ứng phó sự cố hóa chất theo quy định tại khoản 2, khoản 3 Điều 36 Luật Hóa chất.
2. Hồ sơ đề nghị xác nhận Biện pháp phòng ngừa, ứng phó sự cố hóa chất, bao gồm:
a) Đơn đề nghị của tổ chức, cá nhân sản xuất, kinh doanh, cất giữ, bảo quản, sử dụng hóa chất nguy hiểm;
b) Biện pháp phòng ngừa, ứng phó sự cố hóa chất;
c) Các tài liệu kèm theo (nếu có).
3. Cơ quan có thẩm quyền xác nhận Biện pháp phòng ngừa, ứng phó sự cố hóa chất có trách nhiệm kiểm tra thực tế cơ sở sản xuất, kinh doanh, cất giữ, bảo quản, sử dụng hóa chất nguy hiểm trước khi cấp giấy chứng nhận. Thời hạn xác nhận Biện pháp phòng ngừa, ứng phó sự cố hóa chất không quá 20 (hai mươi) ngày làm việc, kể từ ngày nhận đủ hồ sơ hợp lệ theo quy định tại khoản 2 Điều này.
4. Tổ chức, cá nhân đề nghị xác nhận Biện pháp phòng ngừa, ứng phó sự cố hóa chất phải nộp phí theo quy định của pháp luật.
5. Bộ quản lý ngành, lĩnh vực có trách nhiệm:
a) Chủ trì, phối hợp với các cơ quan quản lý nhà nước về phòng cháy, chữa cháy, cơ quan quản lý nhà nước có liên quan tổ chức việc xác nhận Biện pháp phòng ngừa, ứng phó sự cố hóa chất;
b) Tổ chức kiểm tra định kỳ hoặc đột xuất việc quản lý và thực hiện Biện pháp phòng ngừa, ứng phó sự cố hóa chất thuộc phạm vi quản lý;
c) Quy định cụ thể các yêu cầu về nội dung, về tổ chức cấp Giấy xác nhận Biện pháp phòng ngừa, ứng phó sự cố hóa chất.”
7. Bổ sung Điều 7c sau Điều 7
“Điều 7c. Đăng ký sử dụng hóa chất
1. Tổ chức, cá nhân sử dụng hóa chất theo quy định tại Chương V và Điều 63, Điều 64 Luật Hóa chất phải thực hiện việc đăng ký sử dụng hóa chất.
2. Bộ quản lý ngành, lĩnh vực quy định cụ thể việc đăng ký sử dụng hóa chất trong phạm vi quản lý của mình; thực hiện kiểm tra theo định kỳ hoặc đột xuất việc tổ chức, đăng ký sử dụng hóa chất.”
8. Sửa đổi, bổ sung Điều 8
“Điều 8. Điều kiện sản xuất, kinh doanh hóa chất sản xuất, kinh doanh có điều kiện trong ngành y tế
1. Điều kiện sản xuất, kinh doanh hóa chất trong lĩnh vực dược
Cơ sở sản xuất, kinh doanh hóa chất sử dụng trong lĩnh vực dược phải có người quản lý chuyên môn, cơ sở vật chất, kỹ thuật và nhân sự theo quy định của Luật Dược và Nghị định số 79/2006/NĐ-CP ngày 09 tháng 8 năm 2006 của Chính phủ quy định chi tiết thi hành một số điều của Luật Dược.
2. Điều kiện sản xuất hóa chất, chế phẩm diệt côn trùng, diệt khuẩn dùng trong gia dụng và y tế
Cơ sở sản xuất hóa chất, chế phẩm diệt côn trùng, diệt khuẩn dùng trong gia dụng và y tế phải có đủ các điều kiện sau:
a) Người trực tiếp điều hành hoạt động sản xuất có trình độ đại học trở lên về chuyên ngành hóa chất;
b) Cơ sở vật chất – kỹ thuật trong cơ sở sản xuất phải đáp ứng yêu cầu theo quy định tại Điều 12 của Luật Hóa chất;
c) Có đủ trang thiết bị kiểm tra chất lượng hoặc hợp đồng liên kết với đơn vị có đủ năng lực kiểm tra chất lượng để kiểm tra chất lượng hàng hóa;
d) Có biện pháp quản lý về phòng, chống cháy nổ, sự cố hóa chất, xử lý chất thải và bảo vệ môi trường theo quy định của pháp luật.
3. Điều kiện kinh doanh hóa chất, chế phẩm diệt côn trùng, diệt khuẩn dùng trong gia dụng và y tế
Cơ sở kinh doanh hóa chất, chế phẩm diệt côn trùng, diệt khuẩn dùng trong gia dụng và y tế phải có đủ các điều kiện sau:
a) Người phụ trách về an toàn hóa chất có trình độ trung học trở lên về chuyên ngành hóa chất, trừ trường hợp kinh doanh các chế phẩm diệt côn trùng, diệt khuẩn thông dụng bao gồm: hương xua muỗi, bình xịt diệt côn trùng, kem xua côn trùng, tấm hóa chất xua muỗi dùng điện, dung dịch xua muỗi dùng điện, màn tẩm hóa chất diệt muỗi và bả diệt gián, ruồi;
b) Cơ sở vật chất – kỹ thuật trong cơ sở kinh doanh phải đáp ứng yêu cầu theo quy định tại Điều 12 của Luật Hóa chất;
c) Có biện pháp quản lý về phòng chống cháy nổ, sự cố hóa chất, xử lý chất thải và bảo vệ môi trường theo quy định của pháp luật.
4. Điều kiện sản xuất hóa chất sử dụng trong trang thiết bị y tế
Cơ sở sản xuất hóa chất sử dụng trong trang thiết bị y tế phải có đủ các điều kiện theo quy định tại khoản 2 Điều này.
5. Điều kiện kinh doanh hóa chất sử dụng trong trang thiết bị y tế
Cơ sở kinh doanh hóa chất sử dụng trong trang thiết bị y tế phải đáp ứng các điều kiện kinh doanh trang thiết bị y tế theo quy định của pháp luật.”
9. Bổ sung tên Điều 12
“Điều 12. Điều kiện sản xuất, kinh doanh hóa chất thuộc Danh mục hóa chất hạn chế sản xuất, kinh doanh”
10. Sửa đổi, bổ sung Điều 13
“Điều 13. Trách nhiệm thực hiện thiết lập khoảng cách an toàn
1. Các dự án đầu tư sản xuất, kinh doanh, cất giữ, bảo quản, sử dụng hóa chất nguy hiểm thuộc Danh mục quy định tại Phụ lục IV Nghị định này khi đầu tư mới phải thiết lập khoảng cách an toàn từ khu vực sản xuất, kinh doanh, cất giữ, bảo quản, sử dụng hóa chất nguy hiểm tới các điểm dân cư, công trình công cộng, di tích lịch sử, văn hóa, danh lam thắng cảnh, khu dự trữ thiên nhiên, vườn quốc gia, khu dự trữ sinh quyển, khu bảo tồn loài – sinh cảnh, khu bảo tồn biển, nguồn nước sinh hoat theo quy định tại Nghị định này và phải tuân thủ quy chuẩn kỹ thuật về khoảng cách an toàn.
2. Bộ Công thương chủ trì, phối hợp với các Bộ quản lý ngành, lĩnh vực và Ủy ban nhân dân cấp tỉnh tổ chức kiểm tra, đánh giá hiện trạng khu vực cần duy trì khoảng cách an toàn của các cơ sở sản xuất, kinh doanh, cất giữ, bảo quản, sử dụng hóa chất nguy hiểm đang tồn tại có các điều kiện về khoảng cách an toàn chưa đảm bảo theo quy định tại Nghị định này.
Trường hợp các cơ sở sản xuất, kinh doanh, cất giữ, bảo quản, sử dụng hóa chất nguy hiểm đang tồn tại, nếu chưa thiết lập khoảng cách an toàn thì phải có lộ trình xác định khoảng cách an toàn và báo cáo việc thực hiện lộ trình với Bộ quản lý ngành, lĩnh vực và Ủy ban nhân dân cấp tỉnh. Việc thiết lập khoảng cách an toàn phải hoàn thành trước ngày 30 tháng 12 năm 2012.”
11. Sửa đổi, bổ sung Điều 18
“Điều 18. Thủ tục khai báo hóa chất
1. Đối với các tổ chức, cá nhân sản xuất hóa chất
a) Sở Công thương các tỉnh, thành phố trực thuộc Trung ương tiếp nhận hồ sơ khai báo đối với các tổ chức, cá nhân sản xuất hóa chất thuộc Danh mục hóa chất phải khai báo trên địa bàn quản lý;
b) Tổ chức, cá nhân khai báo hóa chất lập 01 (một) bộ hồ sơ gồm các tài liệu: Bản khai báo hóa chất; Phiếu an toàn hóa chất tiếng Việt theo mẫu do Bộ Công Thương quy định đối với hóa chất là hóa chất nguy hiểm.
Trường hợp hóa chất đã được khai báo trước đó tại Sở Công thương thì tổ chức, cá nhân sản xuất hóa chất nguy hiểm không phải nộp lại Phiếu an toàn hóa chất khi thành phần hóa chất không thay đổi;
c) Tổ chức, cá nhân sản xuất hóa chất thuộc Danh mục hóa chất phải khai báo có trách nhiệm khai báo hóa chất sản xuất trong một năm bằng văn bản đến Sở Công thương trước ngày 31 tháng 01 hàng năm;
d) Thời hạn xác nhận khai báo hóa chất của Sở Công thương là 05 (năm) ngày làm việc, kể từ ngày nhận đủ hồ sơ hợp lệ quy định tại điểm b khoản 1 Điều này.
2. Đối với các tổ chức, cá nhân nhập khẩu hóa chất
a) Bộ Công thương tiếp nhận hồ sơ khai báo của các tổ chức, cá nhân nhập khẩu hóa chất thuộc Danh mục hóa chất phải khai báo;
b) Tổ chức, cá nhân khai báo lập 01 (một) bộ hồ sơ gồm các tài liệu: Bản khai báo hóa chất; Hóa đơn mua bán hóa chất; các giấy tờ khác (nếu có). Đối với hóa chất là hóa chất nguy hiểm thuộc Danh mục hóa chất phải khai báo tại Phụ lục V kèm theo Nghị định này, hồ sơ khai báo phải kèm theo Phiếu an toàn hóa chất tiếng Việt theo mẫu do Bộ Công thương quy định và bản tiếng Anh trong trường hợp cần đối chiếu, so sánh.
Trường hợp hóa chất đã được khai báo trước đó tại Bộ Công thương thì tổ chức, cá nhân nhập khẩu hóa chất nguy hiểm không phải nộp lại Phiếu an toàn hóa chất khi thành phần hóa chất không thay đổi. Quy định này không áp dụng đối với tổ chức, cá nhân khai báo hóa chất nhập khẩu qua mạng điện tử;
c) Trước khi thông quan hóa chất, tổ chức, cá nhân nhập khẩu hóa chất có trách nhiệm thực hiện việc khai báo hóa chất với Bộ Công thương;
d) Thời hạn xác nhận khai báo hóa chất nhập khẩu của Bộ Công thương là 07 (bảy) ngày làm việc, kể từ ngày nhận đủ hồ sơ hợp lệ quy định tại điểm b khoản 2 Điều này.
3. Bộ Công thương quy định cụ thể mẫu Bản khai báo hóa chất, mẫu Giấy xác nhận khai báo hóa chất và quy định khai báo hóa chất nhập khẩu, báo cáo hóa chất qua mạng điện tử.
4. Các trường hợp miễn trừ khai báo
Hóa chất được sản xuất, nhập khẩu một lần phục vụ an ninh, quốc phòng, ứng phó các sự cố thiên tai, dịch bệnh khẩn cấp.
5. Lệ phí khai báo hóa chất
Tổ chức, cá nhân khai báo hóa chất sản xuất, khai báo hóa chất nhập khẩu phải nộp lệ phí khai báo theo quy định của pháp luật.”
12. Bổ sung Điều 18a sau Điều 18
“Điều 18a. Xác nhận Phiếu an toàn hóa chất đối với hóa chất xuất khẩu
Tổ chức, cá nhân trước khi xuất khẩu hóa chất phải ghi đầy đủ thông tin của hóa chất theo yêu cầu trong Phiếu an toàn hóa chất và phải được Bộ Công thương đánh giá, xác nhận vào Phiếu an toàn hóa chất.”
13. Sửa đổi khoản 2 Điều 20
“2. Bộ Công thương chủ trì, phối hợp các Bộ quản lý ngành, lĩnh vực và địa phương xây dựng Đề án Cơ sở dữ liệu hóa chất quốc gia, Danh mục hóa chất quốc gia trình Thủ tướng Chính phủ xem xét, phê duyệt.”
14. Sửa đổi khoản 2 Điều 22 như sau:
“2. Nghị định này thay thế Nghị định 68/2005/NĐ-CP ngày 20 tháng 5 năm 2005 của Chính phủ về an toàn hóa chất.”
Điều 2. Hiệu lực thi hành
Nghị định này có hiệu lực thi hành kể từ ngày 01 tháng 6 năm 2011.
Điều 3. Trách nhiệm thi hành
Các Bộ trưởng, Thủ trưởng cơ quan ngang Bộ, Thủ trưởng cơ quan thuộc Chính phủ, Chủ tịch Ủy ban nhân dân tỉnh, thành phố trực thuộc Trung ương và các tổ chức, cá nhân liên quan chịu trách nhiệm thi hành Nghị định này./.
|
Nơi nhận: |
TM. CHÍNH PHỦ |
PHỤ LỤC II
DANH MỤC HÓA CHẤT HẠN CHẾ SẢN XUẤT, KINH DOANH ĐƯỢC SỬA ĐỔI, BỔ SUNG
(Ban hành kèm theo Nghị định số 26/2011/NĐ-CP ngày 08 tháng 4 năm 2011 của Chính phủ)
|
STT |
Tên hóa chất theo tiếng Việt |
Tên hóa chất theo tiếng Anh |
Số CAS |
Công thức hóa học |
Bộ quản lý chuyên ngành |
|
1 |
2 |
3 |
4 |
5 |
6 |
|
1 |
Amiton: O,O-Dietyl S-[2-dietylamino)etyl] phosphorothiolat và các muối alkyl hóa hoặc proton hóa tương ứng |
Phosphorothioic acid,S-[2-(diethylamino)ethyl] O,O-diethyl ester |
78-53-5 |
C10H24NO3PS |
Bộ Công thương |
|
2 |
1,1,3,3,3-Pentaflo-2-(triflorometyl)-1-propen |
1-Propene,1,1,3,3,3-pentafluoro-2-(trifluoromethyl)- |
382-21-8 |
C4F8 |
|
|
3 |
3-Quinuclidinyl benzilat |
3-Quinuclidyl benzilate |
6581-06-2 |
C21H23NO3 |
|
|
4 |
Các hóa chất, trừ các chất đã được liệt kê tại Bảng 1, chứa 1 nguyên tử phospho liên kết với một nhóm metyl, etyl hoặc propyl (mạch thẳng hoặc nhánh) nhưng không liên kết thêm với các nguyên tử các bon khác Ví dụ: Metanphosphonyl diclorua; |
|
|
|
|
|
5 |
Dimetyl metylphotphonat Ngoại trừ Fonofos: O-Etyl S-phenyl etylphotphonothiolothionat |
Dimethyl methylphosphonate |
756-79-6 |
C3H9O3P |
|
|
6 |
Các hợp chất N,N-Dialkyl (Me, Et, n-Pr hoặc i-Pr) photphoramidic dihalit |
|
|
|
|
|
7 |
Các hợp chất Dialkyl (Me, Et, n-Pr hoặc i-Pr) N,N-dialkyl (Me, Et, n-Pr hoặc i-Pr)-photphoramidat |
|
|
|
|
|
8 |
Asen Triclorua |
Arsenous trichloride |
7784-34-1 |
AsCl3 |
|
|
9 |
Axit 2,2-Diphenyl-2-hydroxy axetic |
2-Hyroxy-2,2-diphenyl acetic acid |
76-93-7 |
C14H12O3 |
|
|
10 |
3-Quinuclidinol |
3-Quinuclidinol |
1619-34-7 |
C7H13NO |
|
|
11 |
Các hợp chất N,N-Dialkyl (Me, Et, n-Pr hoặc i-Pr) aminoetyl-2-clorit và các muối proton hóa tương ứng |
|
|
|
|
|
12 |
Các hợp chất N,N-Dialkyl (Me, Et, n-Pr hoặc i-Pr) aminoetyl-2-ol và các muối proton hóa tương ứng ngoại trừ: |
|
|
|
|
|
13 |
N,N-Dimetylaminoetanol và các muối proton hóa chất tương ứng |
N,N-Dimethylethanolamine |
108-01-0 |
C4H11NO |
|
|
14 |
N,N-Dietylaminoetanol và các muối hóa chất tương ứng |
Diethylmonoethanolamine |
100-37-8 |
C6H15NO |
|
|
15 |
Các hợp chất N,N-Dialkyl (Me, Et, n-Pr hoặc i-Pr) aminoetan-2-thiol và các muối proton hóa tương ứng |
|
|
|
|
|
16 |
2,2'-Dihydroxydiethyl sulfua |
Bis(b-hydroxyethyl) sulfide |
111-48-8 |
C4H10O2S |
|
|
17 |
3,3-Dimetyl 2-butanol |
2-Butanol,3,3-dimethyl- |
464-07-3 |
C6H14O |
|
|
18 |
Carbonyl diclorua |
Carbonic dichloride |
75-44-5 |
CCl2O |
|
|
19 |
Xyanogen Clorua |
Cyanogen chloride |
506-77-4 |
(CN)Cl |
|
|
20 |
Axit xyanic |
Hydrogen cyanide |
74-90-8 |
HCN |
|
|
21 |
Triclo nitro metan |
Methane,trichloronitro- |
76-06-2 |
CCl3NO2 |
|
|
22 |
Photpho oxyclorua |
Phosphorus oxychloride |
10025-87-3 |
POCl3 |
|
|
23 |
Photpho triclorua |
Phosphoroustrichloride |
7719-12-2 |
PCl3 |
|
|
24 |
Photpho pentaclorua |
Phosphoruschloride |
10026-13-8 |
PCl5 |
|
|
25 |
Trimetyl photphit |
Trimethyl phosphite |
121-45-9 |
C3H9O3P |
|
|
26 |
Trietyl photphit |
Triethyl phosphite |
122-52-1 |
C6H15O3P |
|
|
27 |
Dimetyl photphit |
Dimethyl phosphite |
868-85-9 |
C2H7O3P |
|
|
28 |
Dietyl photphit |
Diethyl phosphite |
762-04-9 |
C4H11O3P |
|
|
29 |
Lưu huỳnh monoclorua |
Sulfur monochloride |
10025-67-9 |
S2Cl2 |
|
|
30 |
Lưu huỳnh diclorua |
Sulfur dichloride |
10545-99-0 |
SCl2 |
|
|
31 |
Thionyl clorua |
Thionyl chloride |
7719-09-7 |
SOCl2 |
|
|
32 |
Etyl dietanol amin |
Ethyldiethanolamine |
139-87-7 |
C6H15O2N |
|
|
33 |
Dietanol metyl amin |
Methyliminodiethanol |
105-59-9 |
C5H13O2N |
|
|
34 |
Trietanol amin |
Triethanolamin |
102-71-6 |
C6H15O3N |
|
|
35 |
Các hợp chất của Nikel dạng bột có thể phát tán rộng trong không khí (nikel monoxit, nikel dioxit, nikel sulphit, trinikel, disulphit, dinikel trioxit) |
|
|
|
|
|
36 |
Etylenimin |
Ethylenimine |
151-56-4 |
C2H5N |
|
|
37 |
Flo |
Fluorine |
7782-41-4 |
F2 |
|
|
38 |
Formaldehit (Nồng độ ≥ 90%) |
Formaldehyde (Conc. > 90%) |
50-00-0 |
CH2O |
|
|
39 |
Etylen oxit |
Ethylene oxide |
75-21-8 |
C2H4O |
|
|
40 |
4,4-Metylen bis (2-cloanilin) |
4,4’-Methylenebis (2-chloroaniline) |
101-14-4 |
C13H12Cl2N2 |
|
|
41 |
Metyl isoxyanat |
Methyl isocyanate |
624-83-9 |
C2H3NO |
|
|
42 |
Photpho trihydrua (photphin) |
Phosphorus trihydride (phosphine) |
7803-51-2 |
PH3 |
|
|
43 |
4-biphenyl amin |
4-Aminobiphenyl |
92-67-1 |
C12H11N |
|
|
44 |
Benzo triclorua |
Benzotrichloride |
98-07-7 |
C7H5Cl3 |
|
|
45 |
Benzidin |
Benzidine |
92-87-5 |
C12H12N2 |
|
|
46 |
Bis(clo metyl) ete |
Bis(chloromethyl)ether |
542-88-1 |
C2H4Cl2O |
|
|
47 |
1,2-dibrom etan |
1,2-dibromoethane (ethylene dibromide) |
106-93-4 |
C2H4Br2 |
|
|
48 |
Dietyl sulphat |
Dietyl sulfate |
64-67-5 |
C4H10O4S |
|
|
49 |
Dimetyl sulphat |
Dimethyl sulfate |
77-78-1 |
C2H6O4S |
|
|
50 |
Dimetylamin Carbonyl clorua |
Dimethylcarbamoyl chloride |
79-44-7 |
C3H6CINO |
|
|
51 |
1,2-Dibrom-3-clo propan |
1,2-Dibrom-3-chlorpropan |
96-12-8 |
C3H5Br2Cl |
|
|
52 |
1,2-Dimetyl hydrazin |
1,2-Dimetylhydrazine |
540-73-8 |
C2H8N2 |
|
|
53 |
Dimetylnitro amin |
Dimethylnitrosamine |
62-75-9 |
C2H6N2O |
|
|
54 |
Hexametyl photpho amit |
Hexamethylphosphoroamide |
680-31-9 |
C6H18N3OP |
|
|
55 |
Hydrazin |
Hydrazine |
302-01-2 |
N2H4 |
|
|
56 |
2-naphtyl amin |
2-naphthylamine |
91-59-8 |
C10H9N |
|
|
57 |
4-Nitrobiphenyl |
4-Nitrobiphenyl |
92-93-3 |
C12H9NO2 |
|
|
58 |
Axit 1-Propanesulfonic |
1,3-Propane sultone |
1120-71-4 |
C3H6O3S |
|
|
59 |
Hydro selenua |
Hydrogen selenide |
7783-07-5 |
H2Se |
|
|
60 |
Niken tetraCarbonyl |
Nickel tetraCarbonyle |
13463-39-3 |
Ni(CO)4 |
|
|
61 |
Oxy diflorua |
Oxygen difluoride |
7783-41-7 |
F2O |
|
|
62 |
Pentaboran |
Pentaborane |
19624-22-7 |
B5H9 |
|
|
63 |
Selen hexaflorua |
Selenium hexafluoride |
7783-79-1 |
SeF6 |
|
|
64 |
Stibin hydrua |
Stibine (antimony hydril) |
7803-52-3 |
H3Sb |
|
|
65 |
Telu Hexaflorua |
Tellurium hexafluoride |
7783-80-4 |
TeF6 |
|
|
66 |
Thủy ngân Sulfua |
Mercury sulfide |
1344-48-5 |
HgS |
|
|
67 |
Asen |
Arsenic (Grey arsenic) Asen |
7440-38-2 |
As |
|
|
68 |
Thủy ngân |
Mercury |
7439-97-6 |
Hg |
|
|
69 |
Axit Asenic |
Arsenic acid |
7774-41-6 |
H3AsO4.1/2 H2O |
|
|
70 |
Axit asenic và các muối |
Arsenic (V) acid and/or salts |
7778-39-4 |
H3AsO4 |
|
|
71 |
Axit Metaasenic |
Metaarsenic Acid |
10102-53-1 |
HAsO3 |
|
|
72 |
Axit Pyroasenat |
Pyroarsenic acid |
13453-15-1 |
H4As2O7 |
|
|
73 |
Asen trioxit |
Arsenic trioxide |
1327-53-3 |
As2O3 |
|
|
74 |
Asen pentoxit |
Diarsenic pentaoxide |
1303-28-2 |
As2O5 |
|
|
75 |
Asen triflorua |
Arsenous trifluoride |
7784-35-2 |
AsF3 |
|
|
76 |
Asen tribromua |
Arsenous tribromide |
7784-33-0 |
AsBr3 |
|
|
77 |
Asen triiođua |
Arseniciodide |
7784-45-4 |
AsI3 |
|
|
78 |
Cacbon disulfua |
Carbon disulfide |
75-15-0 |
CS2 |
|
|
79 |
Chì (II) oxit |
Lead (II) oxide (Lead monoxide) |
1317-36-8 |
PbO |
|
|
80 |
Chì tetraoxit |
TriLead tetraoxide |
1314-41-6 |
Pb3O4 |
|
|
81 |
Chì florua |
Lead Fluoride |
7783-46-2 |
PbF2 |
|
|
82 |
Chì (IV) florua |
Lead(IV) fluoride; Plumbane, tetrafluoro- |
7783-59-7 |
PbF4 |
|
|
83 |
Cadimi florua |
Cadmiumfluoride |
7790-79-6 |
CdF2 |
|
|
84 |
Chì tetraflo borat |
Lead tetrafluoroborate |
13814-96-5 |
Pb(BF4)2 |
|
|
85 |
Cadimi tetrafloborat |
|
14486-19-2 |
Cd(BF4)2 |
|
|
86 |
Natri xyanua |
Sodium cyanide |
143-33-9 |
NaCN |
|
|
87 |
Kali xyanua |
Potassium cyanide |
151-50-8 |
KCN |
|
|
88 |
Đồng (II) xyanua |
Copper dicyanide |
14763-77-0 |
Cu(CN)2 |
|
|
89 |
Kẽm xyanua |
Zinc cyanide |
557-21-1 |
Zn(CN)2 |
|
|
90 |
Đồng (I) xyanua |
Copper cyanide |
544-92-3 |
Cu(CN) |
|
|
91 |
Canxi xyanua |
Calcium cyanide |
592-01-8 |
Ca(CN)2 |
|
|
92 |
Niken (II) xyanua |
Nickel dicyanide |
557-19-7 |
Ni(CN)2 |
|
|
93 |
Bari xyanua |
Barium cyanide |
542-62-1 |
Ba(CN)2 |
|
|
94 |
Cadimi xyanua |
Cadmium cyanide |
542-83-6 |
Cd(CN)2 |
|
|
95 |
Chì (II) xyanua |
Lead dicyanide |
592-05-2 |
Pb(CN)2 |
|
|
96 |
Coban (II) xyanua |
Cobalt dicyanide |
542-84-7 |
Co(CN)2 |
|
|
97 |
Coban (III) xyanua |
Cobalt tricyanide |
14965-99-2 |
Co(CN)3 |
|
|
98 |
Di kali niken tetraxyanua |
Dipotassium nickel tetracyanide |
14220-17-8 |
K2Ni(CN)4 |
|
|
99 |
Natri đồng (I) xyanua |
Sodium copper(I) cyanide |
14264-31-4 |
Na2Cu(CN)3 |
|
|
100 |
Kali đồng (I) xyanua |
Potassium copper(I) cyanide |
13682-73-0 |
K2Cu(CN)3 |
|
|
101 |
Muối chì metasilicat |
Lead monosilicate |
10099-76-0 |
PbSiO3 |
|
|
102 |
Natri metaasenit |
Sodium meta-arsennite |
7784-46-5 |
NaAsO2 |
|
|
103 |
Kali metaasenit |
Potassium meta-arsennite |
10124-50-2 |
KAsO2 |
|
|
104 |
Canxi asenit |
Tricalcium diarsenite |
27152-57-4 |
Ca3(AsO3)2 |
|
|
105 |
Stronti metaasenit |
Strontium arsenite |
91724-16-2 |
Sr(AsO3)2 |
|
|
106 |
Bari asenit |
Barium arsenite |
125687-68-5 |
Ba3(AsO3)2 |
|
|
107 |
Sắt asenit |
Ferric arsenite |
63989-69-5 |
FeAsO3 |
|
|
108 |
Đồng hydroasenit |
Copper arsenite |
10290-12-7 |
CuHAsO3 |
|
|
109 |
Kẽm asenit |
Zinc arsenite |
10326-24-6 |
Zn(HAsO3)2 |
|
|
110 |
Chì asenit |
Lead arsenite |
10031-13-7 |
Pb(AsO2)2 |
|
|
111 |
Diamoni hydroasenat |
Diammonium arsenate |
7784-44-3 |
(NH4)2HAsO4 |
|
|
112 |
Tri natri asenat |
Trisodium arserate |
7631-89-2 |
Na3AsO4 |
|
|
113 |
Di natri hydoasenat |
Disodium hydrogen arsenate |
7778-43-0 |
Na2HAsO4 |
|
|
114 |
Natri dihydroasenat |
Sodium dihydrogen arsenate |
10103-60-3 |
NaH2AsO4 |
|
|
115 |
Kali dihydroasenat |
Potassium arsenate |
7784-41-0 |
KH2AsO4 |
|
|
116 |
Magie asenat |
Magnesium arsenate |
10103-50-1 |
Mg3(AsO4)2 |
|
|
117 |
Canxi asenat |
Calcium arsenate |
7778-44-1 |
Ca3(AsO4)2 |
|
|
118 |
Bari asenat |
Tribarium diarsenate |
13477-04-8 |
Ba3(AsO4)2 |
|
|
119 |
Sắt (III) asenat |
Ferric arsenate |
10102-49-5 |
FeAsO4 |
|
|
120 |
Sắt (II) asenat |
Ferrous arsenate |
10102-50-8 |
Fe3(AsO4)2 |
|
|
121 |
Đồng (I) dihydro asenat |
Copper dihydrogen arsenate |
10103-61-4 |
Cu(H2AsO4) |
|
|
122 |
Đồng (II) hydroasenat |
Copper hydrogen arsenate |
29871-13-4 |
Cu2(HAsO4) |
|
|
123 |
Đồng (I) asenat |
Tricopper arsenate |
7778-41-8 |
Cu3AsO4 |
|
|
124 |
Đồng (II) asenat |
Tricopper diarsenate |
13478-34-7 |
Cu3(AsO4)2 |
|
|
125 |
Kẽm asenat |
Zinc arsenate |
1303-39-5 |
Zn3(AsO4)2 |
|
|
126 |
Chì diasenat |
Trilead diarsenate |
3687-31-8 |
Pb3(AsO4)2 |
|
|
127 |
Stinbi asenat |
Antimony arsenate |
28980-47-4 |
SbAsO4 |
|
|
128 |
Natri asenit |
Sodium metaarsenate |
15120-17-9 |
NaAsO3 |
|
|
129 |
Chì selenua |
Lead selenide |
12069-00-0 |
PbSe |
|
|
130 |
Cadimi selenua |
Cadmium selenide |
1306-24-7 |
CdSe |
|
|
131 |
Cadmi tellurua |
Cadmium telluride |
1306-25-8 |
CdTe |
|
|
132 |
Bạc xyanua |
Silver cyanide |
506-64-9 |
AgCN |
|
|
133 |
Bạc kali xyanua |
Silver potassium cyanide |
506-61-6 |
AgK(CN)2 |
|
|
134 |
Bạc asenit |
Trisilver arsenate |
7784-08-9 |
Ag3AsO3 |
|
|
135 |
Bạc asenat |
Trisilver arsenate |
13510-44-6 |
Ag3AsO4 |
|
|
136 |
Vàng xyanua |
Gold cyanide |
506-65-0 |
AuCN |
|
|
137 |
Kali vàng (I) dixyanua |
Gold Potassium Dicyanide |
13967-50-5 |
KAu(CN)2 |
|
|
138 |
Kali vàng (III) tetraxyanua |
Gold Potassium cation tetracyanide |
14263-59-3 |
KAu(CN)4 |
|
|
139 |
Tetra kali vàng (I) pentaxyanua |
Tetra Potassium Gold (+1) cation pentaxyanide |
68133-87-9 |
K4AuC5N5 |
|
|
140 |
Asen trihydrua |
Arsenic trihydride (arsine) |
7784-42-1 |
AsH3 |
|
|
141 |
Xyanogen |
Cyanogen (Oxalonitrile) |
460-19-5 |
C2N2 |
|
|
142 |
Iốt xyanua |
Cyanogen iodide |
506-78-5 |
ICN |
|
|
143 |
Brôm xyanua |
Cyanogen bromide |
506-68-3 |
BrCN |
|
|
144 |
Diclo metan |
Dichloromethane |
75-09-2 |
CH2Cl2 |
|
|
145 |
Triclo metan |
Chloroform |
67-66-3 |
CHCl3 |
|
|
146 |
1,1,2 Triclo Etan |
1,1,2-trichloroethene |
79-01-6 |
C2HCl3 |
|
|
147 |
Tetraclo etylen |
Tetrachloroethene |
127-18-4 |
C2Cl4 |
|
|
148 |
1,1-diclo etylen |
1,1-dichloroethylene |
75-35-4 |
C2H2Cl2 |
|
|
149 |
Hexaclo cyclohexan |
1,2,3,4,5,6-Hexachlorocyclohexane |
608-73-1 |
C6H6Cl6 |
|
|
150 |
Dodecaclo pentaxyclodecan |
Dodecachloropentacyclodecane |
2385-85-5 |
C10Cl12 |
|
|
151 |
DDT |
DDT |
50-29-3 |
C14H9Cl5 |
|
|
152 |
Hexaclo benzen |
Hexachlorobenzene |
118-74-1 |
C6Cl6 |
|
|
153 |
Pentaclo phenol |
Pentachlorophenol |
87-86-5 |
C6HCl5O |
|
|
154 |
p-Nitrophenol |
4-Nitrophenol |
100-02-7 |
C6H5NO3 |
|
|
155 |
Axetaldehit |
Acetadehyde |
75-07-0 |
C2H4O |
|
|
156 |
Acrolein |
2-Propenal |
107-02-8 |
C3H4O |
|
|
157 |
Chì axetat |
Lead acetate trihydrate |
6080-56-4 |
Pb(OAc)2.3H2O |
|
|
158 |
Phenylamin |
Phenylamine |
62-53-3 |
C6H7N |
|
|
159 |
2-naphtylamin |
2-Naphthalenamine |
91-59-8 |
C10H9N |
|
|
160 |
2,4-diamino toluen |
2,4-Diaminotoluene |
95-80-7 |
C7H10N2 |
|
|
161 |
3,3’-Diclo benzidin |
3,3’-Dichlorobenzidine |
91-94-1 |
C12H10Cl2N2 |
|
|
162 |
4,4’-Di amino di phenyl metan |
4,4’-Methylenedianiline |
101-77-9 |
C13H14N2 |
|
|
163 |
2- Propen amit |
2-Propenamide |
79-06-1 |
C3H5NO |
|
|
164 |
2- Propene nitrit |
2-Propenenitrile |
107-13-1 |
C3H3N |
|
|
165 |
Demeton –O |
Demeton – O |
298-03-3 |
C8H19O3PS2 |
|
|
166 |
Demeton |
Demeton |
8065-48-3 |
C8H19O3PS2 |
|
|
167 |
Tetrametyl chì |
Tetramethyllead |
75-74-1 |
C4H12Pb |
|
|
168 |
Tetraetyl chì |
Tetraethyllead |
78-00-2 |
C8H20Pb |
|
|
169 |
Axit 4 – (Dimetylamino) azobenzene – 4’ – arsonic |
4-Dimethylaminoazobenzene arsonic acid |
622-68-4 |
C14H16AsN3O3 |
|
|
170 |
Dimetyl hydro asinic |
Dimethylarsinic acid |
75-60-5 |
C2H7AsO2 |
|
|
171 |
Natri dimetyl asinat |
Sodium dimethylarsinate |
124-65-2 |
C2H7AsO2Na |
|
|
172 |
Phenyl dicloasinat |
Phenyl dichlorasine |
696-28-6 |
C6H5AsCl2 |
|
|
173 |
Natri amino phenylasonat |
Sodium aminophenol arsonate |
127-85-5 |
C6H8As |
|
|
174 |
Xyhexatin |
Cyhexatin |
13121-70-5 |
C18H34OSn |
|
|
175 |
Tributyltin laurat |
Tributyltin laurate |
3090-36-6 |
C24H50O2Sn |
|
|
176 |
Tributyltin axetat |
Tributyltin acetate |
56-36-0 |
C14H30O2Sn |
|
|
177 |
Tri ethyltin sulphat |
Triethyltin sulfate |
57-52-3 |
C12H30O4SSn2 |
|
|
178 |
Di butyltin oxit |
Dibultyltin oxide |
818-08-6 |
C8H18OSn |
|
|
179 |
Trietyltin axetat |
Triethyltin acetate |
1907-13-7 |
C8H18O2Sn |
|
|
180 |
Tetra etyltin |
Tetraethyltin |
597-64-8 |
C8H20Sn |
|
|
181 |
Trimetystannyl axetat |
Trimethyltin acetate |
1118-14-5 |
C5H12O2Sn |
|
|
182 |
Tri phenyltin hydroxit |
Triphenyltin hydroxide |
76-87-9 |
C18H16OSn |
|
|
183 |
Đồng axetoasenit |
Cupric acetoarsenite |
12002-03-8 |
C2H3O4AsCu |
|
|
184 |
Di phenylamin Clo asin |
Diphenylaminechlorasine |
578-94-9 |
C12H9AsCIN |
|
|
185 |
Axit Nitrophenol asonic |
Nitrophenolarsonic acid |
121-19-7 |
C6H6AsNO6 |
|
|
186 |
Etyl diclo asin |
Ethyldichlorasine |
598-14-1 |
C2H5AsCl2 |
|
|
187 |
Clo diphenyl asin |
Chlorodiphenylarsine |
712-48-1 |
C12H10AsCl |
|
|
188 |
Axit Metylasonic |
Methylarsonic acid |
124-58-3 |
CH5AsO3 |
|
|
189 |
Axit Propylasonic |
Propylarsonic acid |
107-34-6 |
C3H9AsO3 |
|
|
190 |
Axit phenyl Asonic |
Benzenearsonic acid |
98-05-5 |
C6H7AsO3 |
|
|
191 |
Axit 2-nitrophenyl Asonic |
2-nitrophenyl arsonic acid |
5410-29-7 |
C6H6AsNO5 |
|
|
192 |
Axit 3-nitro-4-hydroxyphenyl Asonic |
3-nitro-4-hydroxybenzene arsonic acid |
121-19-7 |
C6H6AsNO6 |
|
|
193 |
Axit 4-nitrophenyl Asonic |
4-nitrobenzene arsonic acid |
98-72-6 |
C6H6AsNO5 |
|
|
194 |
Axit 2-Aminophenylasonic |
2-Aminobenzene arsonic acid |
2045-00-3 |
C6H8AsNO3 |
|
|
195 |
Axit 4-Aminophenylasonic |
4-Aminobenzene arsonic acid |
98-50-0 |
C6H8AsNO3 |
|
|
196 |
1,4 Dietylen dioxit |
1,4-Dioxane |
123-91-1 |
C4H8O2 |
|
|
197 |
Các hợp chất thủy ngân |
|
|
|
|
|
198 |
Các hợp chất amiăng: |
|
|
|
|
|
|
Actinolit |
|
77536-66-4 |
|
|
|
|
Anthophillit |
|
77536-66-5 |
|
|
|
|
Amosit |
|
12172-73-5 |
|
|
|
|
Crocidolit |
|
12001-28-4 |
|
|
|
|
Tremolit |
|
77536-68-6 |
|
|
|
199 |
Các chất Polybrom biphenyl (PBBs): |
|
|
|
|
|
|
Hexabrom biphenyl |
1,1’-Biphenyl, hexabromo- |
36355-01-8 |
C12H4Br6 |
|
|
|
Octabrom biphenyl |
Octabromobiphenyl |
27858-07-7 |
C12H2Br8 |
|
|
|
Decabrom biphenyl |
Decabromobiphenyl |
13654-09-6 |
C12Br10 |
|
|
200 |
Polychlorinated terphenyls (PCTs) |
Polychlorinated terphenyls (PCTs) |
61788-33-8 |
C18H14-nCln |
|
|
201 |
Tri (2,3 dibrom propyl) phosphat |
Tris(2,3-dibromopropyl) phosphate |
126-72-7 |
C9H15Br6O4P |
|
|
202 |
Chì tetraetyl (TEL) |
Tetraethyllead |
78-00-2 |
C8H20Pb |
|
|
203 |
Chì tetrametyl (TML) |
Tetramethyllead |
75-74-1 |
C4H12Pb |
|
|
204 |
Aldrin |
Aldrin |
309-00-2 |
C12H8Cl6 |
Bộ Nông nghiệp và Phát triển nông thôn |
|
205 |
Clorindan |
Chlorindan |
57-74-9 |
C10H6Cl8 |
|
|
206 |
Dieldrin |
Dieldrin |
60-57-1 |
C12H8Cl6O |
|
|
207 |
Endrin |
Endrin |
72-20-8 |
C12H8Cl6O |
|
|
208 |
Heptacloran |
Heptachlorane |
76-44-8 |
C10H5Cl7 |
|
|
209 |
Hexaclo benzen |
Hexalorobenzen |
118-74-1 |
C6Cl6 |
|
|
210 |
Mirex |
Mirex |
2385-85-5 |
C10Cl12 |
|
|
211 |
Toxaphen |
Toxaphene |
8001-35-2 |
|
|
|
212 |
Polyclo biphenyls (PCBs) |
Polychlorinatedbiphenyls (PCBs) |
1336-36-3 |
C12H10-NCln |
Bộ Tài nguyên và Môi trường |
PHỤ LỤC IV
DANH MỤC HÓA CHẤT NGUY HIỂM PHẢI XÂY DỰNG KẾ HOẠCH PHÒNG NGỪA, ỨNG PHÓ SỰ CỐ HÓA CHẤT VÀ THIẾT LẬP KHOẢNG CÁCH AN TOÀN
(Ban hành kèm theo Nghị định số 26/2011/NĐ-CP ngày 08 tháng 4 năm 2011 của Chính phủ)
|
STT |
Tên hóa chất theo tiếng Việt |
Tên hóa chất theo tiếng Anh |
Công thức hóa học |
Mã số CAS |
Ngưỡng khối lượng hóa chất tồn trữ lớn nhất tại một thời điểm trong cơ sở sản xuất, kinh doanh (kg) |
|
1 |
1,2,3,7,8,9-Hexaclo dibenzo-p-dioxin |
1,2,3,7,8,9-Hexachlorodibenzo-p-dioxin |
C12H2Cl6O2 |
19408-74-3 |
100 |
|
2 |
1,2-Dibrom etan |
1,2-Dibromoethane (ethylene dibromide) |
C2H4Br2 |
106-93-4 |
50000 |
|
3 |
1,3,5-Triamino-2,4,6-trinitro benzen |
1,3,5-Triamino-2,4,6-trinitrobenzene |
C6H6N6O6 |
3058-38-6 |
50000 |
|
4 |
1,3-Butadien |
1,3-Butadiene |
C4H6 |
106-99-0 |
4540 |
|
5 |
1,3-Pentadien |
1,3-Pentadiene |
C5H8 |
504-60-9 |
4540 |
|
6 |
1,3-Propan sulton |
1,3-Propanesultone |
C3H6O3S |
1120-71-4 |
1 |
|
7 |
1,1-Bis(tert-butylperoxy) xyclohexan (>80%) |
1,1-Bis(tert-butylperoxy) xyclohexan (>80%) |
C14H28O4 |
3006-86-8 |
5000 |
|
8 |
1-Buten |
1-Butene |
C4H8 |
106-98-9 |
4540 |
|
9 |
1-Clo propylen |
1-Chlopropylene (1-Propene, 1-chloro-) |
C3H5Cl |
590-21-6 |
4540 |
|
10 |
1-Guanyl-4-nitrosaminoguanyl-1-tetrazen |
1-guanyl-4-nitrosaminoguanyl-1-tetrazene |
C2H8N10O |
109-27-3 |
10000 |
|
11 |
1-Penten |
1-Pentene |
C5H10 |
109-67-1 |
4540 |
|
12 |
1-Propen-2-clo-1,3-diol diaxetat |
1-propen-2-chloro-1,3-diol-diacetate |
C7H9ClO4 |
10118-77-6 |
10 |
|
13 |
2,2’,4,4’,6,6’-Hexanitro stilben |
2,2’,4,4’,6,6’-hexanitrostilbene |
C14H6N6O12 |
20062-22-0 |
50000 |
|
14 |
2,2-Dimetyl propan |
2,2-Dimethylpropane (Propane, 2,2-dimethyl-) |
C5H12 |
463-82-1 |
4540 |
|
15 |
2,3,7,8-Tetraclo dibenzo-p-dioxin |
2,3,7,8-tetrachlorodibenzo-p-dioxin |
C12H4Cl4O2 |
1746-01-6 |
1 |
|
16 |
2,4,6-Trinitroanisol |
2,4,6-trinitroanisole |
C7H5N3O7 |
606-35-9 |
50000 |
|
17 |
2,4,6-Trinitrophenetol |
2,4,6-trinitrophenetole |
C8H7N3O7 |
4732-14-3 |
50000 |
|
18 |
2,4,6-Trinitrophenol |
2,4,6-Trinitrophenol (picric acid) |
C6H3N3O7 |
88-89-1 |
50000 |
|
19 |
2,4,6-Trinitroresorcinol |
2,4,6-Trinitroresorcinol (styphnic acid) |
C6H3N3O8 |
82-71-3 |
50000 |
|
20 |
2,4,6-trinitrotoluen |
2,4,6-trinitrotoluene |
C7H5N3O6 |
118-96-7 |
50000 |
|
21 |
2,2-Dihydroperoxypropan (>30%) |
2,2 Dihydroperoxypropane (>30%) |
C3H8O4 |
2614-76-8 |
5000 |
|
22 |
2,2-Bis(tert-butylperoxy) butan (>70%) |
2,2-Bis(tert-butylperoxy) butane (>70%) |
C12H26O4 |
2167-23-9 |
5000 |
|
23 |
2-Buten |
2-Butene |
C4H8 |
107-01-7 |
4540 |
|
24 |
cis-2-Buten |
2-Butene-cis |
C4H8 |
590-18-1 |
4540 |
|
25 |
trans-2-Buten |
2-Butene-trans (2-Butene, (E)) |
C4H8 |
624-64-6 |
4540 |
|
26 |
2-xyano-2-propanol |
2-cyanopropan-2-ol (acetone cyanohydrin) |
C4H7NO |
75-86-5 |
200000 |
|
27 |
2-Clo propylen |
2-Chloropropylene (1-Propene, 2-chloro-) |
C3H5Cl |
557-98-2 |
4540 |
|
28 |
2-Methyl 1-buten |
2-Methyl-1-butene |
C5H10 |
563-46-2 |
4540 |
|
29 |
2-Methyl 1-propen |
2-Methylpropene (1-Propene, 2-methyl-) |
C4H8 |
115-11-7 |
4540 |
|
30 |
2-naphtylamin |
2-naphtylamine |
C10H9N |
91-59-8 |
1 |
|
31 |
(E)-2-Penten |
2-Pentene, (E)- |
C5H10 |
646-04-8 |
4540 |
|
32 |
(Z)-2-Penten |
2-Pentene, (Z)- |
C5H10 |
627-20-3 |
4540 |
|
33 |
3,3,6,6,9,9-Hexametyl-1,2,4,5-tetroxacyclononat (>75%) |
3.3.6.6.9.9-Hexamethyl-1.2.4.5-tetroxacyclononate (>75%) |
C11H22O4 |
22397-33-7 |
5000 |
|
34 |
3-Methyl 1-buten |
3-Methyl -1-butene |
C5H10 |
563-45-1 |
4540 |
|
35 |
4-(clo formyl) morpholin |
4-(chloroformyl) morpholine |
C5H8ClNO2 |
15159-40-7 |
1 |
|
36 |
4,4-Metylen bis (2-clo anilin) và/hoặc muối của nó ở dạng bột |
4,4’-Methylenebis (2-chloroaniline) and/or salts, in powder form |
C13H12Cl2N2 |
101-14-4 |
10 |
|
37 |
4-Aminodiphenyl |
4-Aminodiphenyl |
C12H11N |
92-67-1 |
1 |
|
38 |
Axit 4-flo butyric |
4-fluorobutyric acid |
C4H7FO2 |
462-23-7 |
1 |
|
39 |
Amit của axit 4-flo butyric |
4-fluorobutyric acid, amides |
|
|
1 |
|
40 |
Este của axit 4-flo butyric |
4-fluorobutyric acid, esters |
|
|
1 |
|
41 |
Muối của axit 4-flo butyric |
4-fluorobutyric acid, salts |
|
|
1 |
|
42 |
Axit 4-flo crotonic |
4-fluorocrotonic acid |
C4H5FO2 |
37759-72-1 |
1 |
|
43 |
Amit của axit 4-flo crotonic |
4-fluorocrotonic acid, amides |
|
|
1 |
|
44 |
Este của axit 4-flo crotonic |
4-fluorocrotonic acid, esters |
|
|
1 |
|
45 |
Muối của axit 4-flo crotonic |
4-fluorocrotonic acid, salts |
|
|
1 |
|
46 |
Axetaldehit |
Acetaldehyde |
C2H4O |
75-07-0 |
4540 |
|
47 |
Axetylen |
Acetylene |
C2H2 |
74-86-2 |
5000 |
|
48 |
Acrolein |
Acrolein (2-Propenal) |
C3H4O |
107-02-8 |
2270 |
|
49 |
Acrylonitril |
Acrylonitrile |
C3H3N |
107-13-1 |
20000 |
|
50 |
Acryloyl clorua |
Acryloyl chloride (2-Propenoyl chloride) |
C3H3ClO |
814-68-6 |
2270 |
|
51 |
Aldicarb |
Aldicarb |
C7H14N2O2S |
116-06-3 |
100 |
|
52 |
Rượu allyl (2-Propen-1-ol) |
Allyl alcohol (2-Propen-1-ol) |
C3H6O |
107-18-6 |
6810 |
|
53 |
Allylamin (2-Propen-1-amine) |
Allylamine (2-Propen-1-amine) |
C3H7N |
107-11-9 |
4540 |
|
54 |
Amiton |
Amiton (VG) |
C10H24NO3PS |
78-53-5 |
1 |
|
55 |
Amoniac |
Ammonia (anhydrous) |
NH3 |
7664-41-7 |
4540 |
|
56 |
Amoni nitrat (trên 98%) |
Ammonium nitrate |
NH4NO3 |
6484-52-2 |
50.000 |
|
57 |
Anabasin (Pyridin,3-(2S)-2-piperidinyl) |
Anabasine, (Pyridine,3-(2S)-2-piperidinyl-) |
C10H14N2 |
494-52-0 |
100 |
|
58 |
Asen pentoxit |
Arsenic pentoxide |
As2O5 |
1303-28-2 |
1000 |
|
59 |
Axit asenic và hoặc các muối asenat |
Arsenic (V) acid and/or salts |
H3AsO4 |
7778-39-4 |
100 |
|
60 |
Asen hydrua |
Arsen trihydride (arsine) |
AsH3 |
7784-42-1 |
200 |
|
61 |
Asen trioxit |
Arsenic trioxide |
As2O3 |
1327-53-3 |
100 |
|
62 |
Axit asenơ và các muối asenit |
Arsenious (III) acid and/or salts |
HAsO2 |
13768-07-5 |
100 |
|
63 |
Asen triclorua |
Arsenous tricloride |
AsCl3 |
7784-34-1 |
6810 |
|
64 |
Azinphos-etyl |
azinphos-ethyl |
C12H16N3O3PS2 |
2642-71-9 |
100 |
|
65 |
Azinphos-metyl |
azinphos-methyl |
C10H12N3O3PS2 |
86-50-0 |
100 |
|
66 |
Bari azit |
Barium azide |
Ba(N3)2 |
18810-58-7 |
50000 |
|
67 |
Bery (dạng bột và các hợp chất) |
Beryllium (powders, compounds) |
Be |
7440-41-7 |
10 |
|
68 |
Bis (2,4,6-trinitrophenyl)amin |
bis(2,4,6-trinitrophenyl)amine |
C12H5N7O12 |
131-73-7 |
50000 |
|
69 |
Bis(2-clo etyl) sulfua |
bis(2-chloroethyl) sulphide |
C4H8Cl2S |
505-60-2 |
1 |
|
70 |
Bis(clo metyl) ete |
bis(chloromethyl)ether |
C2H4Cl2O |
542-88-1 |
1 |
|
71 |
Boron triclorua |
Boron trichloride (Borane, trichloro-) |
BCl3 |
10294-34-5 |
2270 |
|
72 |
Boron triflorua |
Boron trifluoride (Borane, trifluoro-) |
BF3 |
20654-88-0 |
2270 |
|
73 |
Hỗn hợp boron triflorua và metyl ete (1:1) |
Boron trifluoride compound with methyl ether (1:1) (Boron, trifluoro (oxybis (metane)-, T-4- |
C2H6BF3O |
353-42-4 |
6810 |
|
74 |
Brôm |
Bromine |
Br2 |
7726-95-6 |
20000 |
|
75 |
Metyl bromua |
Bromomethane (methyl bromide) |
CH3Br |
74-83-9 |
200000 |
|
76 |
Brom triflo etylen |
Bromotrifluorethylene (Ethene, bromotrifluoro-) |
C2BrF3 |
598-73-2 |
4540 |
|
77 |
Butan |
Butane |
C4H10 |
106-97-8 |
4540 |
|
78 |
Buten |
Butene |
C4H8 |
25167-67-3 |
4540 |
|
79 |
Carbofuran |
Carbofuran |
C12H15NO3 |
1563-66-2 |
100 |
|
80 |
Carbon disulfua |
Carbon disulfide |
CS2 |
75-15-0 |
9080 |
|
81 |
Carbon oxysulfua |
Carbon oxysulfide (Carbon oxide sulfide (COS)) |
COS |
463-58-1 |
4540 |
|
82 |
Carbonphenothion |
Carbonphenothion |
C11H16ClO2PS3 |
786-19-6 |
100 |
|
83 |
Carbonyl clorua (photgen) |
Carbonyl dichloride (phosgene) |
CCl2O |
75-44-5 |
300 |
|
84 |
Coban kim loại và các hợp chất oxit, carbonnat, sulfua dạng bột |
Cobalt metal, oxides, carbonates, sulphides, as powders |
Co |
7440-48-4 |
1000 |
|
85 |
Crimidin |
Crimidine |
C7H10ClN3 |
535-89-7 |
100 |
|
86 |
2-Butenal |
Crotonaldehyde (2-Butenal) |
C4H6O |
4170-30-3 |
9080 |
|
87 |
(E)-2-Butenal |
Crotonaldehyde, (E)-(2-Butenal, (E)-) |
C4H6O |
123-73-9 |
9080 |
|
88 |
Xyanogen (Etandinitril) |
Cyanogen (Ethanedinitrile) |
C2H2 |
460-19-5 |
4540 |
|
89 |
Xyanogen clorua |
Cyanogen chloride |
CCl N |
506-77-4 |
4540 |
|
90 |
Xyanthoat |
Cyathoate |
C10H19N2O4PS |
3734-95-0 |
100 |
|
91 |
Xycloheximit |
Cycloheximide |
C15H23NO4 |
66-81-9 |
100 |
|
92 |
Xyclohexan amin |
Cyclohexylamine (Cyclohexanamine) |
C6H13N |
108-91-8 |
6810 |
|
93 |
Xyclopropan |
Cyclopropane |
C3H6 |
75-19-4 |
4540 |
|
94 |
Xyclotetrametylen tetra nitramin |
Cyclotetramethylenetetranitramine |
C4H8N8O8 |
2691-41-0 |
50000 |
|
95 |
Xyclotrimetylen trinitramin |
Cyclotrimethylene trinitramine |
C3H6N6O6 |
121-82-4 |
50000 |
|
96 |
Clo fenvinphos |
Chlorfenvinphos |
C12H14Cl3O4P |
470-90-6 |
100 |
|
97 |
Clo |
Chlorine |
Cl2 |
7782-50-5 |
10000 |
|
98 |
Clo dioxit |
Chlorine dioxide (Chlorine oxide (ClO2)) |
ClO2 |
10049-04-4 |
454 |
|
99 |
Clo monoxit |
Chlorine monoxide (Chlorine oxide) |
Cl2O |
7791-21-1 |
4540 |
|
100 |
Cloroform |
Chloroform (methane, trichloro-) |
CHCl3 |
67-66-3 |
9080 |
|
101 |
Clometyl metyl ete |
Chloromethyl methyl ether |
C2H5ClO |
107-30-2 |
1 |
|
102 |
Clo trinitro benzen |
Chlorotrinitrobenzene |
C6H2ClN3O6 |
28260-61-9 |
50000 |
|
103 |
Demeton |
Demeton |
C16H38O6P2S4 |
8065-48-3 |
100 |
|
104 |
Dialifos |
Dialifos |
C14H17CINO4PS2 |
10311-84-9 |
100 |
|
105 |
Diazo dinitro phenol |
Diazodinitrophenol |
C6H2N4O5 |
87-31-0 |
10000 |
|
106 |
Dibenzyl peroxy dicacbonat (>90%) |
Dibenzyl peroxydicarbonate (>90%) |
C16H14O6 |
2144-45-8 |
5000 |
|
107 |
Diboran |
Diborane |
B2H6 |
19287-45-7 |
1135 |
|
108 |
Diclo silan |
Dichlorosilane (silane, dichloro-) |
Cl2H2Si |
4109-96-0 |
4540 |
|
109 |
Dietyl peroxy dicarbonat (> 30%) |
Dietyl peroxydicarbonate (>30%) |
C6H10O6 |
14666-78-5 |
5000 |
|
110 |
Dietylen glycol dinitrat |
Diethylene glycol dinitrate |
C4H8N2O7 |
693-21-0 |
10000 |
|
111 |
1,1 Diflo etan |
Difluoroethane (Ethane, 1,1-difluoro-) |
C2H4F2 |
75-37-6 |
4540 |
|
112 |
Di-isobutyryl peroxit (> 50%) |
Di-isobutyryl peroxide (> 50%) |
C8H14O4 |
3437-84-1 |
5000 |
|
113 |
Dimefox |
Dimefox |
C4H12FN2OP |
115-26-4 |
100 |
|
114 |
Axit dimetyl photphoamido xyanidic |
Dimetyl phosphoramidocyanidic acid (C3H7N2P) |
C3H7N2P |
63917-41-9 |
1000 |
|
115 |
Dimetyl amin |
Dimethylamine (Methanamine, N-methyl-) |
C2H7N |
124-40-3 |
4540 |
|
116 |
Dimetylcarbamoyl clorua |
Dimethylcarbamoyl chloride |
C3H6CINO |
79-44-7 |
1 |
|
117 |
Dimetyldiclo silan |
Dimethyldichlorosilane (silane, dichlorodimethyl-) |
C2H6Cl2Si |
75-78-5 |
2270 |
|
118 |
Dimetyl nitrosamin |
Dimethylnitrosamine |
C2H6N2O |
62-75-9 |
1 |
|
119 |
2,4-Dinitro phenol và các muối |
2,4-Dinitrophenol, salts |
|
|
50000 |
|
120 |
Di-n-propyl peroxydicarbonat (> 80%) |
Di-n-propyl peroxydicarbonate (> 80%) |
C8H14O6 |
16066-38-9 |
5000 |
|
121 |
Diphacinon |
Diphacinone |
C23H16O3 |
82-66-6 |
100 |
|
122 |
Di-sec-butyl peroxydicarbonat (> 80%) |
Di-sec-butyl peroxydicarbonate (> 80%) |
C10H18O6 |
19910-65-7 |
5000 |
|
123 |
Disulfoton |
Disulfoton |
C8H19O2PS3 |
298-04-4 |
100 |
|
124 |
Epiclohydrin |
Epichlorohydrin (oxirane, (chloromethyl-) |
C3H5ClO |
106-89-8 |
9080 |
|
125 |
Epn (Phosphonothioic acid, P-phenyl-, O-ethyl O-(4-nitrophenyl) ester) |
Epn (Phosphonothioic acid, P-phenyl-, O-ethyl O-(4-nitrophenyl) ester) |
C14H14NO4PS |
2104-64-5 |
100 |
|
126 |
Etan |
Ethane |
C2H6 |
74-84-0 |
4540 |
|
127 |
Ethion |
Ethion |
C9H22O4P2S4 |
563-12-2 |
100 |
|
128 |
Etyl axetylen |
Ethyl acetylene (1-Butyne) |
C4H6 |
107-00-6 |
4540 |
|
129 |
Etyl clorua |
Ethyl chloride (Ethane, chloro) |
C2H5Cl |
75-00-3 |
4540 |
|
130 |
Etyl ete |
Ethyl ether (Ethane, 1,1’-oxybis-) |
C4H10O |
60-29-7 |
4540 |
|
131 |
Etyl mercaptan |
Ethyl mercaptan (Ethanethiol) |
C2H6S |
75-08-1 |
4540 |
|
132 |
Etyl nitrat |
Ethyl nitrate |
C2H5NO3 |
625-58-1 |
50000 |
|
133 |
Etyl nitrơ |
Ethyl nitrite (Nitrous acid, ethyl ester) |
C2H5NO2 |
109-95-5 |
4540 |
|
134 |
Etyl amin |
Ethylamine (Ethanamine) |
C2H7N |
75-04-7 |
4540 |
|
135 |
Etylen glycol dinitrat |
Ethylene glycol dinitrate |
C2H4N2O6 |
628-96-6 |
10000 |
|
136 |
Etylen oxit |
Ethylene oxide |
C2H4O |
75-21-8 |
5000 |
|
137 |
Etylen diamin |
Ethylenediamine (1,2-Ethanediamine) |
C2H8N2 |
107-15-3 |
9080 |
|
138 |
Etylenimin |
Ethylenediamine |
C2H5N |
151-56-4 |
10000 |
|
139 |
Fluenetil (2-floetyl 4-Biphenylaxetat) |
Fluenetil |
C16H15FO2 |
4301-50-2 |
100 |
|
140 |
Flo |
Fluorine |
F2 |
7782-41-4 |
10000 |
|
141 |
Axit flo axetic |
Fluoroacetic acid |
C2H3FO2 |
144-49-0 |
1 |
|
142 |
Amit của axit flo axetic |
Fluoroacetic acid, amides |
|
|
1 |
|
143 |
Este của axit flo axetic |
Fluoroacetic acid, esters |
|
|
1 |
|
144 |
Muối của axit flo axetic |
Fluoroacetic acid, salts |
|
|
1 |
|
145 |
Formaldehit (Nồng độ ≥ 90%) |
Formaldehyde (Conc. > 90%) |
CH2O |
50-00-00 |
5000 |
|
146 |
Furan |
Furan |
C4H4O |
110-00-9 |
2270 |
|
147 |
Hexametylphotphoroamit |
Hexamethylphosphoroamide |
C6H18N3OP |
680-31-9 |
1 |
|
148 |
Hydrazin |
Hydrazine |
H4N2 |
302-01-2 |
6810 |
|
149 |
Hydrazin nitrat |
Hydrazine nitrate |
H5N3O3 |
13464-97-6 |
50000 |
|
150 |
Axit Hydroxyanic |
Hydrocyanic acid |
HCN |
74-90-8 |
1135 |
|
151 |
Hydro |
Hydrogen |
H2 |
1333-74-0 |
5000 |
|
152 |
Hydro cloric (khí lỏng) |
Hydrogen chloride (liquefied gas) |
HCl |
7647-01-0 |
25000 |
|
153 |
Hydro florua |
Hydrogen fluoride |
HF |
7664-39-3 |
50000 |
|
154 |
Hydro selenua |
Hydrogen selenide |
H2Se |
7783-07-5 |
1000 |
|
155 |
Hydro sulfua |
Hydrogen sulfide |
H2S |
7783-06-4 |
4540 |
|
156 |
Hydroxy axetonitril |
Hydroxyacetonitrile (glycolonitrile) |
C2H3NO |
107-16-4 |
100 |
|
157 |
Sắt pentacacbonyl |
Iron, pentacacbonyl- (Iron carbonyl (Fe(CO)5), (TB-5-11)-) |
C5FeO5 |
13463-40-6 |
1135 |
|
158 |
Isobenzan |
Isobenzan |
C9H4Cl8O |
297-78-9 |
100 |
|
159 |
Isobutan |
Isobutane (Propane, 2-methyl) |
C4H10 |
75-28-5 |
4540 |
|
160 |
Isobutyronitril (2 metyl propan nitril) |
Isobutyronitrile (Propanenitrile, 2-methyl-) |
C4H7N |
78-82-0 |
9080 |
|
161 |
Isodrin |
Isodrin |
C12H8Cl6 |
465-73-6 |
100 |
|
162 |
Isopentan |
Isopentane (Butane, 2-methyl-) |
C5H12 |
78-78-4 |
4540 |
|
163 |
Isopren |
Isoprene (1,3-Butadinene, 2-methyl-) |
C5H8 |
78-79-5 |
4540 |
|
164 |
Isopropyl clorua |
Isopropyl chloride (Propane, 2-chloro-) |
C3H7CI |
75-29-6 |
4540 |
|
165 |
Isopropyl cloformat |
Isopropyl chloformate (Carbonochloridic acid, 1-methylethyl ester) |
C4H7CIO2 |
108-23-6 |
6810 |
|
166 |
Isopropylamin |
Isopropylamine (2-Propanamine) |
C3H9N |
75-31-0 |
4540 |
|
167 |
Juglone (5-hydroxynaphthalen-1,4-dion) |
Juglone (5-hydroxynaphthalene-1,4-dione) |
C10H6O3 |
481-39-0 |
100 |
|
168 |
Chì 2,4,6-trinitroresorcinoxit |
Lead 2,4,6-trinitroresorcinoxide lead styphnate) |
C6HN3O8Pb |
63918-97-8 |
50000 |
|
169 |
Alkyl chì |
Lead alkyls |
|
|
5000 |
|
170 |
Chì azit |
Lead azide |
PbN6 |
13424-46-9 |
50000 |
|
171 |
Các khí hóa lỏng đặc biệt dễ cháy (bao gồm cả LPG) và khí thiên nhiên |
Liquefied extremely flammable gases (including LPG) and natural gas |
|
|
50000 |
|
172 |
Thủy ngân fulminat |
Mercury fulminate |
C2HgN2O2 |
628-86-4 |
10000 |
|
173 |
Metacrylonitril |
Methacrylonitrile (2-Propenenitrile, 2-methyl-) |
C4H5N |
126-98-7 |
4540 |
|
174 |
Metan |
Methane |
CH4 |
74-82-8 |
4540 |
|
175 |
Metanol |
Methanol |
CH4O |
67-56-1 |
500000 |
|
176 |
Metyl clorua |
Methyl chloride (Methane, chloro-) |
CH3Cl |
74-87-3 |
4540 |
|
177 |
Metyl cloformat |
Methyl chloroformate (Carbonochloridic acid, methylester) |
C2H3ClO2 |
79-22-1 |
2270 |
|
178 |
Dimetyl ete |
Methyl ether (Methane, oxybis-) |
C2H6O |
115-10-6 |
4540 |
|
179 |
Metyl etyl keton peroxit (> 60%) |
Methyl ethyl ketone peroxide (> 60%) |
C8H18O6 |
1338-23-4 |
5000 |
|
180 |
Metyl format |
Methyl formate (Formic acid, methyl ester) |
C2H4O2 |
107-31-3 |
4540 |
|
181 |
Metyl hydrazin |
Methyl hydrazine (Hydrazine, methyl-) |
CH6N2 |
60-34-4 |
6810 |
|
182 |
Metyl isobutyl keton peroxit (nồng độ > 60%) |
Methyl isobutyl ketone peroxide (> 60%) |
C12H26O4 |
37206-20-5 |
50000 |
|
183 |
Metyl isoxyanat |
Methyl isocyanate |
C2H3NO |
624-83-9 |
150 |
|
184 |
Metyl mercaptan |
Methyl mercaptan (Methanethiol) |
CH4S |
74-93-1 |
4540 |
|
185 |
Metyl thioxyanat |
Methyl thiocyanate (Thiocyanic acid, methyl ester) |
C2H3NS |
556-64-9 |
9080 |
|
186 |
Metyl amin |
Methylamine (Methanamine) |
CH5N |
74-89-5 |
4540 |
|
187 |
Metyl isoxyanat |
Methylisocyanate |
C2H3NO |
624-83-9 |
150 |
|
188 |
Metyl triclo silan |
Methyltrichlorosilane (Silane, trichloromethyl-) |
CH3Cl3Si |
75-79-6 |
2270 |
|
189 |
Mevinphos |
Mevinphos |
C7H13O6P |
7786-34-7 |
100 |
|
190 |
Niken và các hợp chất chứa Ni dạng bột có thể phát tán trong không khí (các loại oxit, carbonat, sulfua) |
Nickel compounds in inhalable powder form (oxides, sulphides, carbonate) |
Ni |
7440-02-0 |
1000 |
|
191 |
Niken tetracarbonyl |
Nickel tetracarbonyl |
C4NiO4 |
13463-39-3 |
1000 |
|
192 |
Axit nitric |
Nitric acid (conc 80% or greater) |
HNO3 |
7697-37-2 |
6810 |
|
193 |
Nito monoxit |
Nitric oxdide (Nitrogen oxide (NO)) |
NO |
10102-43-9 |
4540 |
|
194 |
Nitro xenlulo (hàm lượng > 12,6% of nitrogen) |
Nitrocellulose (containing > 12,6% of nitrogen) |
|
9004-70-0 |
100000 |
|
195 |
Nito oxit |
Nitrogen oxides |
NOx |
11104-93-1 |
50000 |
|
196 |
Nitro glyxerin |
Nitroglycerin |
C3H5N3O9 |
55-63-0 |
10000 |
|
197 |
n-Metyl-n,2,4,6-tetranitroanilin |
n-Methyl-n,2,4,6-tetranitroaniline |
C7H5N5O8 |
479-45-8 |
50000 |
|
198 |
Oleum (hỗn hợp axit sulfuric với lưu huỳnh trioxit) |
Oleum (Fuming Sulfuric acid) (Sulfuric acid, mixture with sulfur trioxide) |
H2SO4*nSO3 |
8014-95-7 |
4540 |
|
199 |
oo-Dietyl s-etylsulphinylmetyl phophothioat |
oo-Diethyl s-ethylsulphinylmethyl phosphorothioate |
C7H17O4PS2 |
2588-05-8 |
100 |
|
200 |
oo-Dietyl s-etylsulphonylmetyl photphothioat |
oo-Diethyl s-ethylsulphonylmethyl phosphorothioate |
C7H17O5PS2 |
2588-06-9 |
100 |
|
201 |
oo-Dietyl s-etylthiometyl photphothioat |
oo-Diethyl s-ethylthiomethyl phosphorothioate |
C7H17O3PS2 |
2600-69-3 |
100 |
|
202 |
oo-Dietyl s-isopropylthiometyl photphodithioat |
oo-Diethyl s-isopropylthiomethyl phosphorodithioate |
C8H19O2PS3 |
78-52-4 |
100 |
|
203 |
oo-Dietyl s-propylthiometyl photphodithioat |
oo-Diethyl s-propylthiomethyl phosphorodithioate |
C8H19O2PS3 |
3309-68-0 |
100 |
|
204 |
Oxydisulfoton |
Oxydisulfoton |
C8H19O3PS3 |
2497-07-6 |
100 |
|
205 |
Oxy |
Oxygen |
O2 |
7782-44-7 |
200000 |
|
206 |
Oxy diflorua |
Oxygen difloride |
F2O |
7783-41-7 |
1000 |
|
207 |
Paraoxon (diety 14-nitrophenylphotphat) |
Paraoxon (diethyl 4-nitrophenylphosphate) |
C10H14NO6P |
311-45-5 |
100 |
|
208 |
Parathion |
Parathion |
C10H14NO5PS |
56-38-2 |
100 |
|
209 |
Parathion-metyl |
Parathion-methyl |
C8H10NO5PS |
298-00-0 |
100 |
|
210 |
Pensulfothion |
Pensulfothion |
C11H17O4PS2 |
115-90-2 |
100 |
|
211 |
Pentaboran |
Pentaborane |
B5H9 |
19624-22-7 |
1000 |
|
212 |
Pentaerythritol tetranitrat |
pentaerythritol tetranitrate |
C5H8N4O12 |
78-11-5 |
50000 |
|
213 |
Pentan |
Pentane |
C5H12 |
109-66-0 |
4540 |
|
214 |
Axit Peraxetic (> 60%) |
Peracetic acid (> 60%) |
C2H4O3 |
79-21-0 |
5000 |
|
215 |
Perclometyl mercaptan |
Perchloromethylmercaptan (Methanesulfenyl chloride, trichloro-) |
CCl4S |
594-42-3 |
4540 |
|
216 |
Sản phẩm xăng dầu (a) Xăng và xăng naphata (b) Dầu kerosen (bao gồm cả nhiên liệu lỏng động cơ) (c) Dầu đốt (bao gồm cả diesel nhiên liệu dầu đốt lò và các hỗn hợp dầu nhiên liệu) |
Petroleum products (A) Gasoline and gasoline naphtha (B) Oil and kerosene (including liquid fuel engine) (C) Fuel oil (diesel fuel including fumace oil and fuel oil mixture) |
|
|
2500000 |
|
217 |
Piperidin |
Piperidine |
C5H11N |
110-89-4 |
6810 |
|
218 |
Polyclo dibenzo furans và polyclodibenzo dioxins |
Polychlorodibenzo-furans and polychlorodibenzo-dioxins |
C12H6Cl2O2 |
33857-26-0 |
0 |
|
219 |
Kali nitrat (dạng tinh thể) |
Potassium nitrate |
KNO3 |
7757-79-1 |
1250 |
|
220 |
Promurit (1-(3,4-diclophenyl)-3-triazenethiocacboxamide) |
Promurit (1-(3,4-dichlorophenyl)-3-triazenethiocarboxamide) |
C7H6Cl2N4S |
5836-73-7 |
100 |
|
221 |
Propadien |
Propadiene (1,2-Propadiene) |
C3H4 |
463-49-0 |
4540 |
|
222 |
Propan |
Propane |
C3H8 |
74-98-6 |
4540 |
|
223 |
Propionitril |
Propionitrile (Propanenitrile) |
C3H5N |
107-12-0 |
4540 |
|
224 |
Propyl cloformat |
Propyl chloroformate (Carbonochloridic acid, propylester) |
C4H7ClO2 |
109-61-5 |
6810 |
|
225 |
Propylen |
Propylene (1-Propene) |
C3H6 |
115-07-1 |
4540 |
|
226 |
Propylen oxit |
Propylen oxide |
C3H6O |
75-56-9 |
5000 |
|
227 |
Propylen imin |
Propyleneimine (Aziridine, 2-methyl-) |
C3H7N |
75-55-8 |
4540 |
|
228 |
Propin |
Propyne (1-Propyne) |
C3H4 |
74-99-7 |
4540 |
|
229 |
Pyrazoxon |
Pyrazoxon |
C8H15N2O4P |
108-34-9 |
100 |
|
230 |
Phorat |
Phorate |
C7H17O2PS3 |
298-02-2 |
100 |
|
231 |
Phosacetim |
Phosacetim |
C14H13Cl2N2O2PS |
4104-14-7 |
100 |
|
232 |
Phosphamidon |
Phosphamidon |
C10H19CINO5P |
13171-21-6 |
100 |
|
233 |
Phot pho vàng |
Phosphorus (White, yellow) |
P4 |
7723-14-0 |
|
|
234 |
Phopho oxyclorua |
Phosphorus oxychloride (Phosphoryl chloride) |
POCl3 |
10025-87-3 |
2270 |
|
235 |
Photpho triclorua |
Phosphorus trichloride (Phosphorous trichloride) |
PCl3 |
7719-12-2 |
6810 |
|
236 |
Photpho trihydrua (photphin) |
Phosphorus trihydride (phosphine) |
PH3 |
7803-51-2 |
200 |
|
237 |
Selen hexaflorua |
Selenium hexafloride |
SeF6 |
7783-79-1 |
1000 |
|
238 |
Silan |
Silane |
SiH4 |
7803-62-5 |
4540 |
|
239 |
Natri clorat |
Sodium chlorate |
NaClO3 |
7775-09-9 |
25000 |
|
240 |
Natri picramat |
Sodium picramate |
C6H4N3NaO5 |
831-52-7 |
50000 |
|
241 |
Natri selenit |
Sodium selenite |
Na2SeO3 |
10102-18-8 |
100 |
|
242 |
Stibin (antimo hydrua) |
Stibine (antimony hydril) |
SbH3 |
7803-52-3 |
1000 |
|
243 |
Sulfotepp |
Sulfotepp |
C8H20O5P2S2 |
3689-24-5 |
100 |
|
244 |
Lưu huỳnh diclorua |
Sulfur dichloride |
SCl2 |
10545-99-0 |
100 |
|
245 |
Lưu huỳnh dioxit |
Sulfur dioxide |
SO2 |
7446-09-5 |
20000 |
|
246 |
Lưu huỳnh tetraflorua |
Sulfur tetrafloride (Sulfur fluoride) |
SF4 |
7783-60-0 |
1135 |
|
247 |
Lưu huỳnh trioxit |
Sulfur trioxide |
SO3 |
7446-11-9 |
15000 |
|
248 |
Lưu huỳnh diclorua |
Sulfur dichloride |
SCl2 |
10545-99-0 |
1000 |
|
249 |
Tepp – tetraetyl pyrophotphat |
T.E.P.P – (Tetraethyl pyrophosphate) |
C8H20O7P2 |
107-49-3 |
100 |
|
250 |
Telu hexaflorua |
Tellurium hexafloride |
TeF6 |
7783-80-4 |
1000 |
|
251 |
Tert-butyl peroxy isobutyrat (>80%) |
Tert-butyl peroxy isobutyrate (>80%) |
C8H16O3 |
109-13-7 |
5000 |
|
252 |
Tert-butyl peroxyaxetat (>70%) |
Tert-butyl peroxyacetate (>70%) |
C6H12O3 |
107-71-1 |
5000 |
|
253 |
Tert-butylperoxy isopropyl carbonat (>80%) |
Tert-butylperoxy isopropylcarbonate (>80%) |
C8H16O4 |
2372-21-6 |
5000 |
|
254 |
Tert-butylperoxy maleat (>80%) |
Tert-butylperoxy maleate (>80%) |
C8H12O5 |
1931-62-0 |
5000 |
|
255 |
Tert-butylperoxy pivalat (>77%) |
Tert-butylperoxy pivalate (>77%) |
C9H18O3 |
927-07-1 |
5000 |
|
256 |
Tetraflo etylen |
Tetrafluoroethylene (Ethene, tetrafluoro-) |
C2F4 |
116-14-3 |
4540 |
|
257 |
Tetrametylen disulphotetramin |
Tetramethylenedisulphotetramine |
C4H8N4O4S12 |
80-12-6 |
1 |
|
258 |
Tetrametyl silan |
Tetramethylsilane (Silane, tetramethyl-) |
C4H12Si |
75-76-3 |
4540 |
|
259 |
Tetranitro metan |
Tetranitromethane (Methane, tetranitro-) |
CN4O8 |
509-14-8 |
4540 |
|
260 |
Tirpate (2,4-Dimetyl-2-formyl-1,3-dithiolan oxim metylcarbamat) |
Tirpate(2,4-dimethyl-1,3-dithiolane-2-carboxaldehydeo-methylcarbamoyloxime) |
C8H14N2O2S2 |
26419-73-8 |
100 |
|
261 |
Titan tetraclorua |
Titanium tetrachloride (Titanium chloride (TiCl4) (T-4)-) |
TiCl4 |
7550-45-0 |
1135 |
|
262 |
Toluen 2,6-diisoxyanat |
Toluene 2,6-diisocyanate (Benzene, 1,3-diisocyanato-2-methyl-)1 |
C9H6N2O2 |
91-08-7 |
4540 |
|
263 |
Toluen diisoxyanat |
Toluene di-isocyanate |
C9H6N2O3 |
584-84-9 |
10000 |
|
264 |
Các chất có khả năng gây ung thư có nồng độ trên 5% về khối lượng: 4-Aminobiphenyl và/hoặc muối của nó, Benzidin và/hoặc các muối, Bis (clorometyl) ete, Clometyl metyl ete, 1,2-Dibrometan, Dietyl sulphat, Dimetyl sulphat, Dimetylcarbamoyl clorit, 1,2-Dibrom-3-clo propan, 1,2-Dimetylhydrazin, Dimetylnitro amin, Hexametylphotphoric triamit, Hydrazin, 2-Naphtylamin và/hoặc muối của 4-Nitrodiphenyl and 1,3-Propanesulton |
The potent carcinogen concentrations above 5% in volume: 4-Aminobiphenyl and/or its salts, Benzidine and/or salts, Bis (chloromethyl) ether, Chloromethyl methyl ether, 1,2- Dibromometan, Dietyl sulfate, Dimetyl sulfate, Dimetylcarbamoyl chlorit, 1,2-Dibrom-3-chloropropane, 1,2-Dimethylhydrazin, Dimethylnitrosomine, Hexamethylphosphoric triamide, 2-Naphtylamine and/or salts, 4-Nitrodiphenyland 1,3 Propanesultone |
|
|
500 |
|
265 |
Thionazin |
Thionazin |
C8H13N2O3PS |
297-97-2 |
100 |
|
266 |
Triclo silan |
Trichlorosilane (Silane, trichloro-) |
SiHCl3 |
10025-78-2 |
4540 |
|
267 |
Trietylenemelamin |
Triethylenemelamine |
C9H12N6 |
51-18-3 |
10 |
|
268 |
Triflocloetylen |
Trifluorochloroethylene (Ethene, chlorotrifluoro-) |
C2ClF3 |
79-38-9 |
4540 |
|
269 |
Trimetylamin |
Trimethylamine (Methanamine, N, N-dimethyl) |
C3H9N |
75-50-3 |
4540 |
|
270 |
Trimetylclosilan |
Trimethylchlorosilane (Silane, chlorotrimethyl-) |
C3H9ClSi |
75-77-4 |
4540 |
|
271 |
Trinitro anilin |
Trinitroaniline |
C6H4N4O6 |
489-98-5 |
50000 |
|
272 |
1,3,5-Trinitro benzen |
Trinitrobenzene |
C6H3N3O6 |
99-35-4 |
50000 |
|
273 |
Axit trinitro benzoic |
Trinitrobenzoic acid |
C7H3N3O8 |
129-66-8 |
50000 |
|
274 |
Trinitro cresol |
Trinitrocresol |
C7H5N3O7 |
28905-71-7 |
50000 |
|
275 |
Vinyl acetat |
Vinyl acetate monomer (Acetic acid ethenyl ester) |
C4H6O2 |
108-05-4 |
6810 |
|
276 |
Vinyl axetylen |
Vinyl acetylene (1-Buten-3-yne) |
C4H4 |
689-97-4 |
4540 |
|
277 |
Vinyl clorua |
Vinyl chloride (Ethene, chloro) |
C2H3Cl |
75-01-4 |
4540 |
|
278 |
Vinyl etyl ete |
Vinyl ethyl ether (Ethene, ethoxy-) |
C4H8O |
109-92-2 |
4540 |
|
279 |
Vinyl florua |
Vinyl fluoride (Ethene, fluoro) |
C2H3F |
75-02-5 |
4540 |
|
280 |
Vinyl metyl ete |
Vinyl methyl ether (Ethene, methoxy-) |
C3H6O |
107-25-5 |
4540 |
|
281 |
Vinyliden clorua |
Vinylidene chloride (Ethene, 1,1-dichloro-) |
C2H2Cl2 |
75-35-4 |
4540 |
|
282 |
Vinyliden florua |
Vinylidene fluoride (Ethene, 1,1-difluoro-) |
C2H2F2 |
75-38-7 |
4540 |
|
283 |
Warfarin ((RS)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2H-chromen-2-on) |
Warfarin ((RS)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2H-chromen-2-one) |
C19H16O4 |
81-81-2 |
100 |
Ghi chú:
- Trong các mục có nhiều chất thì mã CAS và công thức được chỉ ra là của chất đặc trưng cho nhóm.
Ví dụ: Mục 59, Axit asenic và hoặc các muối asenat thì mã cas được ghi: 7778-39-4 và công thức phân tử H3AsO4 là của axit asenic.
PHỤ LỤC V
DANH MỤC HÓA CHẤT PHẢI KHAI BÁO ĐƯỢC SỬA ĐỔI, BỔ SUNG
(Ban hành kèm theo Nghị định số 26/2011/NĐ-CP ngày 08 tháng 4 năm 2011 của Chính phủ)
|
STT |
Tên hóa chất |
Mã số Hải quan |
Hóa chất nguy hiểm phải lập Phiếu an toàn hóa chất |
|
1. |
Cồn etylic và rượu mạnh khác, đã biến tính, ở mọi nồng độ |
2207 20 |
|
|
2. |
Lưu huỳnh các loại, trừ lưu huỳnh thăng hoa, lưu huỳnh kết tủa và lưu huỳnh dạng keo |
2503 |
|
|
3. |
Amiăng (Asbestos) |
2524 |
* |
|
4. |
Bộ mi ca |
2525 20 |
|
|
5. |
Talk đã nghiền hoặc làm thành bột |
2526 20 |
|
|
6. |
Dầu và các sản phẩm khác từ chưng cất hắc ín than đá ở nhiệt độ cao; các sản phẩm tương tự, có khối lượng cấu tử thơm lớn hơn cấu tử không thơm |
2707 |
* |
|
|
- Benzen |
2707 10 |
|
|
|
- Toluen |
2707 20 |
|
|
|
- Xylen |
2707 30 |
|
|
|
- Naphthalen |
2707 40 |
|
|
|
- Phenol |
2707 60 |
|
|
|
- Dầu creosote |
2707 91 |
* |
|
7. |
Nhựa chưng (hắc ín) và than cốc nhựa chưng, thu được từ hắc ín than đá hoặc hắc ín khoáng chất khác |
2708 |
|
|
8. |
Chất chứa biphenyl đã polyclo hóa (PCBs), terphenyl đã polyclo hóa (PCTs) hoặc biphenyl đã polybrom hóa (PBBs) |
2710 91 |
* |
|
9. |
Khí dầu mỏ và các loại khí hydrocarbon khác |
2711 |
|
|
|
- Khí thiên nhiên (Dạng hóa lỏng) |
2711 11 |
|
|
|
- Propan |
2711 12 |
|
|
|
- Butan |
2711 13 |
|
|
|
- Etylen, propylen, butylen và butadien |
2711 14 |
|
|
|
- Khí thiên nhiên (Dạng khí) |
2711 21 |
|
|
10. |
Flo, clo, brom và iot |
2801 |
* |
|
|
- Clo |
2801 10 |
|
|
|
- Iot |
2801 20 |
|
|
|
- Flo, brom |
2801 30 |
|
|
11 |
Lưu huỳnh thăng hoa hoặc kết tủa; lưu huỳnh dạng keo |
2802 |
|
|
12 |
Axetylen |
2803 00 |
* |
|
13 |
Hydro, khí hiếm và các phi kim loại khác |
2804 |
|
|
|
- Hydro |
2804 10 |
|
|
|
- Argon |
2804 21 |
|
|
|
- Loại khác |
2804 29 |
|
|
|
- Nitơ |
2804 30 |
|
|
|
- Oxy |
2804 40 |
|
|
|
- Bor; tellurium |
2804 50 |
* |
|
|
- Phospho |
2804 70 |
* |
|
|
- Arsenic |
2804 80 |
* |
|
|
- Selennium |
2804 90 |
* |
|
14. |
Kim loại kiềm hoặc kiềm thổ; kim loại đất hiếm, scandium và ytttrium, đã hoặc chưa pha trộn hoặc tạo hợp kim với nhau; thủy ngân |
2805 |
* |
|
|
- Natri |
2805 11 |
|
|
|
- Canxi |
2805 12 |
|
|
|
- Kali |
2805 19 |
|
|
|
- Kim loại đất hiếm, scandium và yttrium, đã hoặc chưa pha trộn hoặc tạo hợp kim với nhau |
2805 30 |
|
|
|
- Thủy ngân |
2805 40 |
|
|
15 |
Hydro clorua (hydrocloric acid); axit closulfric |
2806 |
|
|
|
- Hydro clorua (hydrochloric acid) |
2806 10 |
|
|
|
Axit closulfuric |
2806 20 |
|
|
16. |
Axit sunfuric; axit sulfuric bốc khói (oleum) |
2807 |
* |
|
17. |
Axit nitric; axit sulfonitric |
2808 |
|
|
18. |
Diphosphorous pentaoxid; axit phosphoric; axit polyphosphoric đã hoặc chưa xác định về mặt hóa học |
2809 |
* |
|
|
- Diphosphorous pentaoxid |
2809 10 |
|
|
|
- Axit phosphoric và axit polyphosphoric: |
2809 20 |
|
|
19. |
Oxit boron; axit boric |
2810 |
* |
|
20. |
Axit vô cơ khác và các hợp chất vô cơ chứa oxy khác của các phi kim loại |
2811 |
* |
|
|
- Hydro florua (hydrofloric acid) |
2811 11 |
|
|
|
- Axit arsenic |
2811 19 |
|
|
|
- Silic dioxit |
2811 22 |
|
|
|
- Lưu huỳnh dioxit |
2811 23 |
|
|
|
- Diasenic pentaoxit |
2811 29 |
|
|
21. |
Halogenua và oxit halogenua của phi kim loại |
2812 |
|
|
|
- Clorua và oxit clorua |
2812 10 |
* |
|
|
- Loại khác |
2812 90 |
|
|
22. |
Sulfua của phi kim loại; Phopho trisulfua thương phẩm |
2813 |
* |
|
|
- Carbon disulfua |
2813 10 |
|
|
|
- Loại khác |
2813 90 |
|
|
23. |
Amoniac, dạng khan hoặc dạng dung dịch nước |
2814 |
* |
|
24. |
Natri hydroxit (xút ăn da); kali hydroxit (potash ăn da); natri peroxit hoặc kali peroxit |
2815 |
* |
|
25. |
Magie hydroxit và magie peroxit; oxit, hydroxit và peroxit của stronti hoặc bari |
2816 |
|
|
26. |
Kẽm peroxit |
2817 00 |
* |
|
27. |
Crom oxit và hydroxit |
2819 |
* |
|
28. |
Mangan oxit |
2820 |
* |
|
29. |
Oxit sắt và hydroxit sắt; chất màu từ đất có hàm lượng sắt hóa hợp Fe2O3 chiếm 70% trở lên |
2821 |
* |
|
30. |
Coban oxit và coban hydroxit |
2822 |
* |
|
|
- Coban oxit, Coban hydroxit |
2822 00 |
|
|
31. |
Titan oxit |
2823 |
|
|
32. |
Chì oxit |
2824 |
* |
|
|
- Chì monoxit (litharge, massicot) |
2824 10 |
|
|
|
- Chì tetraoxit |
2824 20 |
|
|
33. |
Hydrazine và hydroxylamine và các muối vô cơ của chúng; các loại bazơ vô cơ; các oxit, hydroxit và peroxit kim loại khác |
2825 |
|
|
34. |
Florua; florosilicat, floroaluminat và các loại muối flo phức khác |
2826 |
* |
|
35. |
Clorua, clorua oxit và clorua hydroxit; bromua và oxit bromua; iot và iot oxit |
2827 |
|
|
36. |
Hypoclorit; canxi hypoclorit thương phẩm; clorit; hypobromit |
2828 |
* |
|
37. |
Clorat và peclorat; bromat và pebromat; iotdat và peiodat |
2829 |
* |
|
38. |
Sunfua; polysunfua, đã hoặc chưa xác định về mặt hóa học |
2830 |
* |
|
39. |
Dithionit và sulfosilat |
2831 |
* |
|
40. |
Sulfit; thiosulfat |
2832 |
|
|
41. |
Crom (II) sulfat |
2833 23 |
* |
|
|
Niken sulfat |
2833 24 |
* |
|
|
Đồng sulfat |
2833 25 |
* |
|
|
Kẽm sulfat |
2833 26 |
* |
|
42. |
Nitrit; nitrat |
2834 |
* |
|
43. |
Phosphinat (hypophosphit), phosphonat (phosphit) và phosphat; polyphosphat, đã hoặc chưa xác định về mặt hóa học |
2835 |
|
|
|
- Phosphinat (hypophosphit) và phosphonat (phosphit) |
2835 10 |
* |
|
|
- Phosphat của mono hoặc |
2835 22 |
* |
|
|
- Phophat của trinatri |
2835 23 |
* |
|
|
- Phosphat của kali |
2835 24 |
* |
|
|
- Canxi phosphat khác (trừ monocanxi phosphat) |
2835 26 |
|
|
|
- Natri triphosphat (natri tripolyphosphat) |
2835 31 |
* |
|
44. |
Các muối cacbonat |
2836 |
* |
|
|
Amoni carbonat |
2836 10 |
|
|
|
Bari carbonat |
2836 60 |
|
|
|
Chì carbonat |
2836 70 |
|
|
45. |
Xyanua, xyanua oxit và xyanua phức |
2837 |
* |
|
46. |
Fulminat, xyanat và thioxyanat |
2838 |
* |
|
47. |
Natri metasilicat |
2839 11 |
* |
|
48. |
Borat; peroxoborat (perborat) |
2840 |
* |
|
49. |
Muối của axit oxometalic hoặc axit perxometalic |
2841 |
|
|
|
- Aluminat |
2841 10 |
|
|
|
- Kẽm hoặc chì cromat |
2841 20 |
* |
|
|
- Natri dicromat |
2841 30 |
|
|
|
- Cromat và dicromat khác; peroxocromat |
2841 50 |
* |
|
|
- Manganit, manganat và permanganat: |
|
|
|
|
- Kali permanganat |
2841 61 |
|
|
|
+ Loại khác |
2841 69 |
|
|
|
+ Molipdat |
2841 70 |
|
|
|
+ Vonframat |
2841 80 |
|
|
50. |
Natri arsenit |
2842 90 |
* |
|
51. |
Kim loại quý dạng keo; hợp chất hữu cơ hoặc vô cơ của kim loại quý, đã hoặc chưa xác định về mặt hóa học; hỗn hống của kim loại quý |
2843 |
|
|
|
- Bạc nitrat |
2843 21 |
* |
|
|
- Hợp chất vàng |
2843 30 |
* |
|
|
- Hợp chất khác; hỗn hống |
2843 90 |
|
|
52. |
Hợp chất vô cơ hay hữu cơ của kim loại đất hiếm, của cerium hoặc của scandi, hoặc của hỗn hợp các kim loại này |
2846 |
|
|
|
- Hợp chất cerium |
2846 10 |
|
|
|
- Loại khác |
2846 90 |
|
|
53. |
Hydro peroxit, đã hoặc chưa làm rắn bằng urê |
2847 |
* |
|
54. |
Phosphua đã hoặc chưa xác định về mặt hóa học, trừ phosphua sắt |
2848 |
* |
|
55. |
Carbua, đã hoặc chưa xác định về mặt hóa học |
2849 |
* |
|
56. |
Hydrua, nitrua, azide, silicua và borua, đã hoặc chưa xác định về mặt hóa học |
2850 |
* |
|
57. |
Thủy ngân sulfat |
2852 00 |
* |
|
58. |
Hydrocarbon mạch hở |
2901 |
|
|
59. |
Hydrocarbon mạch vòng |
2902 |
|
|
60. |
Dẫn xuất halogen hóa của hydrocarbon |
2903 |
* |
|
|
- Dẫn xuất clo hóa bão hòa của hydrocarbon mạch hở: |
|
|
|
|
+ Clometan (clorua metyl) và (cloetan etyl) |
2903 11 |
|
|
|
+ Diclorometan (metylen clorua) |
2903 12 |
|
|
|
+ Cloroform (triclorometan) |
2903 13 |
|
|
|
+ Carbon tetraclorua |
2903 14 |
|
|
|
+ 1,2-Dicloroetan (etylen diclorua) |
2903 15 |
|
|
|
+ Loại khác |
2903 19 |
|
|
|
- Dẫn xuất clo hóa chưa bão hòa của hydrocarbon mạch hở |
|
|
|
|
+ Vinyl clorua (cloetylen) |
2903 21 |
|
|
|
+ Tricloroethylen |
2903 22 |
|
|
|
+ Tetracloroethylen (percloroethylen) |
2903 23 |
|
|
|
+ Loại khác |
2903 29 |
|
|
|
- Dẫn xuất flo hóa, brom hóa hoặc iot hóa của hydrocarbon mạch hở |
2903 30 |
|
|
|
+ 1,2-Dibrometan |
2903 31 |
* |
|
|
+ Metyl bromid |
2903 39 |
* |
|
|
+ Triclorofluorometan |
2903 41 |
|
|
|
+ Diclorodifluorometan |
2903 42 |
|
|
|
+ Triclorotrifluoroetans |
2903 43 |
|
|
|
+ Diclorotetrafluoretans và cloropentafluoroetan |
2903 44 |
|
|
|
+ Các dẫn xuất khác đã halogen hóa hoàn toàn chỉ với flo và clo |
2903 45 |
|
|
|
+ Bromoclorodiflourometan, bromotrifluorometan và dibromotetrafluoroetan |
2903 46 |
|
|
|
+ Các dẫn xuất halogen hóa hoàn toàn khác |
2903 47 |
|
|
|
+ Loại khác |
2903 49 |
|
|
|
- Dẫn xuất đã halogen hóa của hydrocarbon cyclanic, cyclenic hoặc cycloterpenic: |
|
|
|
|
+ 1,2,3,4,5,6 - hexaclorocyclohexan |
2903 51 |
|
|
|
+ Loại khác |
2903 59 |
|
|
|
+ Dẫn xuất đã halogen hóa của hydrocarbon thơm: |
|
|
|
|
+ Clorobenzen, o-diclorobenzen và p-diclorobenzen |
2903 61 |
|
|
|
+ Hexaclorobenzen và DDT (1,1,1-tricloro-2,2-bis (p-clorophenyl) etan) |
2903 62 |
|
|
|
+ Loại khác |
2903 69 |
|
|
61. |
Dẫn xuất sulfo hóa, nitro hóa hoặc nitroso hóa của hydrocarbon, đã hoặc chưa halogen hóa |
2904 |
|
|
62. |
Rượu mạch hở và các dẫn xuất halogen hóa, đã sulfo hóa, nitro hóa hoặc nitroso hóa của chúng |
2905 |
|
|
63. |
Phenol; rượu phenol |
2907 |
* |
|
64. |
Dẫn xuất halogen hóa, sulfo hóa, nitro hóa hoặc nitroso hóa của phenol hoặc của rượu-phenol |
2908 |
* |
|
|
- Dẫn xuất chỉ được halogen hóa, muối của chúng |
2908 10 |
|
|
|
- Pentaclophenol (ISO) |
2908 11 |
* |
|
|
- Dẫn xuất chỉ được sulfo hóa, muối và este của chúng |
2908 20 |
|
|
|
- Loại khác |
2908 90 |
|
|
65. |
Ete, rượu-ete, phenol-ete, phenol-rượu-ete, peroxit rượu, peroxit ete, peroxit xeton, (đã hoặc chưa xác định về mặt hóa học), và các dẫn xuất halogen hóa, sulfonat hóa, nitro hóa hoặc nitroso hóa của các chất trên |
2909 |
|
|
66. |
Epoxit, rượu epoxy, phenol epoxy, ete epoxy có vòng ba cạnh và các dẫn xuất đã halogen hóa, sulfo hóa, nitro hóa, nitro hóa, hoặc nitroso hóa của chúng |
2910 |
|
|
67. |
Axetal và hemiaxetal, có hoặc không có chức oxy khác và các dẫn xuất halogen hóa, sulfo hóa, nitro hóa hoặc nitroso hóa của chúng |
2911 |
|
|
68. |
Aldehyt, có hoặc không có chức oxy khác; polyme mạch vòng của aldehyt; paraformaldehyde |
2912 |
* |
|
69. |
Xeton và quinon, có hoặc không có chức oxy khác, dẫn xuất halogen hóa, sulfo hóa, nitro hóa, hoặc nitroso hóa của chúng |
2914 |
* |
|
70. |
Axit carboxylic đơn chức, no, mạch hở và các alhydrit, halogenua, peroxit, peroxyaxit của chúng; các dẫn xuất halogen hóa, sulfo, nitro hóa hoặc nitriso hóa của các chất trên |
2915 |
|
|
|
- Axit fomic, muối và este của nó: |
|
|
|
|
- Axit fomic |
2915 11 |
|
|
|
- Muối của axit fomic |
2915 12 |
|
|
|
- Este của axit fomic |
2915 13 |
|
|
|
- Axit axetic và muối của nó; alhydric axetic: |
|
|
|
|
- Axit axetic |
2915 21 |
|
|
|
+ Natri axetat |
2915 22 |
|
|
|
+ Coban axetat |
2915 23 |
* |
|
|
- Alhydrit axetic |
2915 24 |
|
|
|
+ Loại khác |
2915 29 |
|
|
|
- Este của axit axetic: |
|
|
|
|
+ Etyl axetat |
2915 31 |
* |
|
|
+ Vinyl axetat |
2915 32 |
|
|
|
+ N-butyl axetat |
2915 33 |
* |
|
|
+ Isobutyl axetat |
2915 34 |
* |
|
|
+ 2 - Etoxyetyl axetat |
2915 35 |
|
|
|
+ Loại khác |
2915 39 |
|
|
|
- Axit mono-, di- hoặc tricloaxetic, muối và este của chúng |
2915 40 |
* |
|
|
- Axit propionic, muối và este của chúng |
2915 50 |
* |
|
|
- Axit butanoic, axit pentanoic, muối và este của chúng |
2915 60 |
* |
|
|
- Axit palmitic, axit stearic, muối và eate của chúng |
2915 70 |
* |
|
|
- Loại khác |
2915 90 |
|
|
71. |
Axit carboxylic đơn chức mạch hở chưa bão hòa, axit carboxylic đơn chức mạch vòng, các alhydrit, halogenua, peroxit và peroxyaxit của chúng; các dẫn xuất halogen hóa, sunfonat hóa, nitro hóa hoặc nitroso hóa của chúng |
2916 |
|
|
|
- Axit acrylic và muối của nó |
2916 11 |
|
|
|
- Este của axit acrylic |
2916 12 |
|
|
|
- Axit metacrylic và muối của nó |
2916 13 |
|
|
|
- Este của axit metacrylic |
2916 14 |
|
|
|
- Axit oleic, axit linoleic hoặc axit linolenic, muối và este của nó |
2916 15 |
|
|
|
- Loại khác |
2916 19 |
|
|
|
- Axit carboxylic đơn chức, cyclanic, cyclenic hoặc cycloterpenic, các alhydrit, halogenua, peroxit, peroxyaxit của chúng và các dẫn xuất của các chất trên |
2916 20 |
|
|
|
- Axit carboxylic thơm đơn chức, các alhydrit, halogenua, peroxit, peroxyaxit của chúng và các dẫn xuất của các chất trên: |
|
|
|
|
+ Axit benzoic, muối và este của nó |
2916 31 |
|
|
|
+ Peroxit bezoyl và clorua benzoyl |
2916 32 |
|
|
|
+ Axit phenylaxetic và muối của nó |
2916 34 |
|
|
|
+ Este của axit phenylaxetic |
2916 35 |
|
|
|
+ Binapacryl |
2916 36 |
|
|
|
+ Axit axetic 2,4-Diclorophenyl và muối và este của chúng |
2916 39 |
|
|
72. |
Axit carboxylic đa chức, các alhydrit, halogenua, peroxit, peroxyaxit của chúng; các dẫn xuất halogen hóa, sulfo hóa, nitro hóa hoặc nitroso hóa của các chất trên |
2917 |
|
|
|
- Axit polycarboxylic đơn chức mạch hở, các alhydrit, halogenua, peroxit và peroxyaxit của chúng, các dẫn xuất của các chất trên: |
|
|
|
|
+ Axit oxalic, muối và este của nó |
2917 11 |
|
|
|
+ Axit adipic, muối và este của nó |
2917 12 |
|
|
|
+ Axit azelaic, axit sebacic, muối và este của chúng |
2917 13 |
|
|
|
+ Alhydrit maleic |
2917 14 |
|
|
|
+ Loại khác |
2917 19 |
|
|
|
+ Axit carboxlic đa chức cyclanic, cyclenic hoặc cycloterpenic, các alhydrit, halogenua, peroxit và peroxyaxit của chúng và các dẫn xuất của các chất trên |
2917 20 |
|
|
|
- Axit carboxylic thơm đa chức, các alhydrit, halogenua, peroxit và peroxyaxit của chúng và các dẫn xuất của các chất trên: |
|
|
|
|
+ Dibutyl orthophthalates |
2917 31 |
* |
|
|
+ Dioctyl orthophthalates |
2917 32 |
* |
|
|
+ Dinonyl hoặc didecyl orthophthalates |
2917 33 |
* |
|
|
+ Este khác của các axit orthophthalates |
2917 34 |
* |
|
|
+ Alhydrit phthalic |
2917 35 |
* |
|
|
+ Axit terephthalic và muối của nó |
2917 36 |
* |
|
|
+ Dimetyl terephthalat |
2917 37 |
* |
|
|
+ Loại khác |
2917 39 |
|
|
73. |
Axit carboxylic có thêm chức oxy và các alhydrit, halogenua, peroxit và peroxyaxit của chúng; các dẫn xuất halogen hóa, sulfo hóa, nitro hóa hoặc nitroso hóa của các chất trên |
2918 |
|
|
|
- Axit lactic, muối và este của nó |
2918 11 |
|
|
|
- Muối và este của axit tactaric |
2918 13 |
|
|
|
- Axit citric |
2918 14 |
|
|
|
- Muối và este của axit citric |
2918 15 |
|
|
|
- Axit gluconic, muối và este của nó |
2918 16 |
|
|
|
- Loại khác |
2918 19 |
|
|
|
- Axit carboxylic có chức phenol nhưng không có chức oxy khác, các alhydrit, halogenua, peroxit và peroxyaxit của chúng và các dẫn xuất của các chất trên: |
|
|
|
|
+ Axit salicylic và muối và este của nó |
2918 21 |
|
|
|
+ Axit o-axetylsali cylic, muối và este của nó |
2918 22 |
|
|
|
+ Este khác của axit salicylic và muối của nó |
2918 23 |
|
|
|
+ Loại khác |
2918 29 |
|
|
|
- Axit carboxylic có chức aldehyt hoặc chức xeton nhưng không có chức oxy khác, các alhydrit, halogenua, peroxit và peroxyaxit của chúng và các dẫn xuất của các chất trên |
2918 30 |
|
|
74. |
Tri (2,3-dibromopropyl) phosphat |
2919 10 |
* |
|
75. |
Este của axit vô cơ khác của các phi kim loại (trừ este của hydro halogenua) và muối của chúng; các dẫn xuất halogen hóa, sulfo hóa, nitro hóa hoặc nitroso hóa của các chất trên |
2920 |
|
|
76. |
Hợp chất chức amin |
2921 |
|
|
77. |
Hợp chất amino chức oxy (trừ Lysine; tryptophane; threonine) |
2922 |
|
|
78. |
Muối và hydroxit amoni bậc 4; lecithin và chất phosphoaminolipids khác, đã hoặc chưa xác định về mặt hóa học. |
2923 |
|
|
|
- Choline và muối của nó |
2923 10 |
|
|
|
- Lecithin và các phosphoaminolipids khác |
2923 20 |
|
|
79. |
Hợp chất chức carboxyamit; hợp chất chức amit của axit carbonic |
2924 |
|
|
80. |
Hợp chất chứa carboxyimit (kể cả sacarin và muối của nó) và các hợp chất chức imin |
2925 |
|
|
81. |
Hợp chất chức nitril |
2926 |
* |
|
82. |
Hợp chất diazo, azo hoặc azoxy |
2927 |
|
|
83. |
Dẫn xuất hữu cơ của hydrazin hoặc của hydroxylamin |
2928 |
|
|
84. |
Hợp chất chức nitơ khác |
2929 |
|
|
85. |
Hợp chất lưu huỳnh - hữu cơ (trừ methionin) |
2930 |
|
|
86. |
Hợp chất vô cơ - hữu cơ khác |
2931 |
|
|
87. |
Hợp chất dị vòng chỉ chứa (các) dị tố oxy |
2932 |
|
|
88. |
Hợp chất dị vòng chỉ chứa (các) dị tố nitơ |
2933 |
|
|
89. |
Bộ nổ đẩy |
3601 |
* |
|
90. |
Thuốc nổ đã điều chế, trừ bộ nổ đẩy |
3602 |
* |
|
91. |
Hợp kim xeri - sắt và các hợp kim tự cháy, dẫn lửa khác ở mọi dạng; các sản phẩm làm từ vật liệu dễ cháy như đã ghi trong chú giải 2 của chương này |
3606 |
* |
|
|
- Nhiên liệu lỏng hoặc nhiên liệu ga hóa lỏng đựng trong thùng dùng để bơm hoặc bơm lại ga bật lửa, có dung tích không quá 300 cm3. |
3606 10 |
|
|
|
- Loại khác |
3606 90 |
|
|
92. |
Các loại alkylbenzen hỗn hợp và các loại alkylnaphthalen hỗn hợp, trừ các chất thuộc nhóm 27.07 hoặc nhóm 29.02 |
3817 00 |
* |
|
93. |
Nhựa từ dầu mỏ, nhựa curmaron, nhựa inden hoặc nhựa curmaron-inden và polyterpen |
3911 10 |
* |
PHỤ LỤC VI
DANH MỤC HÓA CHẤT ĐỘC PHẢI XÂY DỰNG PHIẾU KIỂM SOÁT MUA, BÁN HÓA CHẤT ĐỘC
(Ban hành kèm theo Nghị định số 26/2011/NĐ-CP ngày 08 tháng 4 năm 2011 của Chính phủ)
|
STT |
Tên hóa chất |
Công thức hóa học |
Số CAS |
|
|
Tên hóa chất tiếng Việt |
Tên hóa chất theo tiếng Anh |
|||
|
1. |
Acetonitril |
Acetonitrile (Methyl cyanide) |
C2H3N/CH3CN |
75-05-8 |
|
2 |
Acrolein |
Acrolein |
CH2=CHCHO |
107-02-8 |
|
3 |
Acrylamit |
Acrylamide (2-Propene amide) |
CH2CHCONH2 |
79-06-1 |
|
4 |
Acrylonitril |
Acrylonitrile |
C5H3N/CH2=CH-CN |
107-13-1 |
|
5 |
Aldicarb |
Aldicarb 2-Methyl-2(methylthio)propanal 0- ((methylamino)carbonyl)oxime |
C7H14N2O2S/CH3SC(CH3)2- CH=NOCONHCH3 |
116-06-3 |
|
6 |
Aldrin |
Aldrin (1,2,3,4,10,10- Hexachloro-1,4,4a,5,8,8a-hexahydro,endo,exo-1,4:5.8- dimethanonaphthalene) |
C12H8Cl6 |
309-00-2 |
|
7 |
Rượu allyl |
Allyl alcohol (Vinyl carbinol) |
C3H6O/CH2=CHCH2OH |
107-18-6 |
|
8 |
Allyl clorua |
Allyl chloride |
C3H5Cl/CH2=CHCH2Cl |
107-05-1 |
|
9 |
Allylamin |
Allylamine |
C3H7N/CH2=CHCH2NH2 |
107-11-9 |
|
10 |
Alpha-hexaclorocyclohexan |
Alpha-hexachlorocyclohexane |
C6H6Cl6 |
319-84-6 |
|
11 |
Alpha-naphthylthiourea |
Alpha-naphthylthiourea |
C11H10N2S |
86-88-4 |
|
12 |
Nhôn phốtphua |
Aluminium phosphide |
AIP |
20859-73-8 |
|
13 |
Amoniac |
Ammonia |
NH3 |
7664-41-7 |
|
14 |
Aminocarb |
Aminocarb (4-Dimethylamino-m-tolyl N-methylcarbamate) |
C11H16N2O2 |
2032-59-9 |
|
15 |
4-Aminobiphenyl |
4-Aminobiphenyl ((1,1'-Biphenyl)-4-amine) |
C12H11N/C6H5-C6H4NH2 |
92-67-1 |
|
16 |
Amiton |
Amiton |
C10H24NO3PS |
78-53-5 |
|
17 |
Amoni florua |
Ammonium fluoride |
NH4F |
12125-01-8 |
|
18 |
Anilin |
Aniline (Benzenamine) |
C6H7N/C6H5NH2 |
62-53-3 |
|
19 |
Anilin hydroclorua |
Aniline hydrochloride (Benzenamine hydrochloride) |
C6H8ClN/C6H7N.HCl |
142-04-1 |
|
20 |
Anabasin |
Anabasine |
C10H14N2 |
40774-73-0 |
|
21 |
Antimon hydrit |
Antimony hydride (Stibine) |
H3Sb |
7803-52-3 |
|
22 |
Arsen |
Arsenic (Grey arsenic) Asen |
As |
7440-38-2 |
|
23 |
Axit arsen |
Arsenic acid |
H3AsO4 |
7778-39-4 |
|
24 |
|
Arsenic (V) oxide hydrate |
As2O5xH2O |
12044-50-7 |
|
25 |
Arsen triclorua |
Arsenic trichloride Asen triclorua (Arsenic III chloride) |
AsCl3 |
7784-34-1 |
|
26 |
Arsen trioxit |
Arsenic trioxide (Arsenic(III)oxide) |
As2O3 |
1327-53-3 |
|
27 |
Arsin |
Arsine (Arsenic trihydride) |
AsH3 |
7784-42-1 |
|
28 |
Amiăng (trắng) |
Asbestos (anthophyllite) |
- |
12001-29-5 |
|
29 |
Amiăng (xanh) |
Asbestos (crocidolite) |
- |
12001-28-4 |
|
30 |
Amiăng (nâu) |
Asbestos (tremolite) |
- |
121732-73-5 |
|
31 |
Azinphos-etyl |
Azinphos-ethyl |
C12H16N3O3PS2 |
2642-71-9 |
|
32 |
Azinphos-metyl |
Azinphos-methyl |
C10H12N3O3PS2 |
86-50-0 |
|
33 |
Barium azid |
Barium azide |
BaN6 |
18810-58-7 |
|
34 |
Barium xyanua |
Barium cyanide |
Ba(CN)2 |
542-62-1 |
|
35 |
Benz(a) hóa chất thu được từ khí hóa than đá |
Benz(a)anthracene (1,2-Benzoanthracene) |
C18H12 |
56-55-3 |
|
36 |
Benzal clorua |
Benzal chloride |
C6H5CHCl2 |
98-87-3 |
|
37 |
Benzen |
Benzene |
C6H6 |
71-43-2 |
|
38 |
Axit benzen arsonic |
Benzene arsonic acid (Phenylarsonic acid) |
C6H7AsO3/C6H5AsO(OH)2 |
98-05-5 |
|
39 |
1,4-benzoquinon |
1,4-benzoquinone |
C6H4O2 |
106-51-4 |
|
40 |
1,4-Benzenediamin dihydroclorit |
1,4-Benzenediamine dihydrochloride |
C6H8N2.2HCl/C6H4(NH2)2.2HCl |
624-18-0 |
|
41 |
Benzyl butyl phtalat |
Benzyl butyl phthalate |
C19H20O4 |
85-68-7 |
|
42 |
Benzidin |
Benzidine ((1,1'-Biphenyl)-4,4'-diamine) |
C12H12N2/NH2C6H4-C6H4NH2 |
92-87-5 |
|
43 |
Benzotriclorua |
Benzotrichloride |
C7H5Cl3/C6H5CCl3 |
98-07-7 |
|
44 |
Bezoyl peroxit |
Benzoyl peroxide |
C14H10O4 |
94-36-0 |
|
45 |
Berilli (dạng bột, hợp chất) |
Beryllium (powder, compounds) |
Be |
7440-41-7 |
|
46 |
Beta - hexaclorocyclohexan |
Beta-hexachlorocyclohexane |
C6H6Cl6 |
319-85-7 |
|
47 |
Bis(clorometyl) ete |
Bis(chloromethyl) ether |
(CH2Cl)2O |
542-88-1 |
|
48 |
Bis(2-cloroetyl) sulphit |
Bis(2-chloroethyl) sulphide (Sulfur mustar) |
C4H8Cl2S |
505-60-2 |
|
49 |
Bo triclorua |
Boron trichloride |
BCl3 |
10294-34-5 |
|
50 |
Bo bromua |
Boron bromide (Boron tribromide) |
BBr3 |
10294-33-4 |
|
51 |
Bo trifluorua |
Boron trifluoride |
BF3 |
7637-07-2 |
|
52 |
Brom |
Bromine |
Br2 |
7726-95-6 |
|
53 |
Bromometan (Metyl bromua) |
Bromomethane (Methyl bromide) |
CH3Br |
74-83-9 |
|
54 |
Bromoform |
Bromoform |
CHBr3 |
75-25-2 |
|
55 |
2-Bromo-2-nitro-1,3-propanediol |
2-Bromo-2-nitro-1,3-propanediol (b-Bromo-bnitrotrimethyleneglycol) |
HOCH2CBr(NO2)2CH2OH/C3H6O4BrN |
52-51-7 |
|
56 |
1,3-Butadien |
1,3-Butadiene |
C4H6/CH2=(CH)2=CH2 |
106-99-0 |
|
57 |
Clorambucil |
Chlorambucil |
C14H19Cl2NO2 |
305-03-3 |
|
58 |
1-Cloro-3-nitrobenzen |
1-Chloro-3-nitrobenzene |
C6H4ClNO2 |
121-73-3 |
|
59 |
1-Cloro-2-nitrobenzen |
1-Chloro-2-nitrobenzene |
C6H4ClNO2 |
88-73-3 |
|
60 |
(3-Clorophenyl)acetonitril |
(3-Chlorophenyl)acetonitrile |
C8H6ClN |
1529-41-5 |
|
61 |
2-Cloroanilin |
2-Chloroaniline |
(C6H4)Cl(NH2) |
95-51-2 |
|
62 |
3-Cloroanilin |
3-Chloroaniline |
(C6H4)Cl(NH2) |
108-42-9 |
|
63 |
Cadmi clorua |
Cadmium chloride |
CdCl2 |
10108-64-2 |
|
64 |
Cadmi oxit |
Cadmium oxide |
CdO |
1306-19-0 |
|
65 |
Cadmi sulfit |
Cadmium sulfide |
CdS |
1306-23-6 |
|
66 |
Canxi arsenat |
Calcium arsenate |
As2Ca3O8/Ca3(AsO4)2 |
7778-44-1 |
|
67 |
Canxi xyanua |
Calcium cyanide |
C2CaN2/Ca(CN)2 |
592-01-8 |
|
68 |
Campheclo |
Camphechlor (Chlorinated camphene) |
C10H10Cl8 |
8001-35-2 |
|
69 |
Captafol |
Captafol (N-(1,1,2,2-Tetrachloroethylthio)cyclohex-4-ene-1,2-dicarboximide) |
C10H9Cl4NO2S |
2425-06-1 |
|
70 |
Carbofuran |
Carbofuran (2,3-Dihydro-2,2-dimethylbenzofuran-7-yl methylcarbamate) |
C12H15NO3 |
1563-66-2 |
|
71 |
Clorfenvinphos |
Chlorfenvinphos |
C12H14Cl3O4P |
470-90-6 |
|
72 |
Clorotrinitrobenzen |
Chlorotrinitrobenzene |
C6H2ClN3O6 |
28260-61-9 |
|
73 |
Crimidin |
Crimidine |
C7H10ClN3 |
535-89-7 |
|
74 |
Cyanthoat |
Cyanthoate |
C10H19N2O4PS |
3734-95-0 |
|
75 |
Cycloheximid |
Cycloheximide |
C15H23NO4 |
66-81-9 |
|
76 |
Cyclotrimethylen trinitramin |
Cyclotrimethylene trinitramine |
C3H6N6O6 |
121-82-4 |
|
77 |
Carbon disulfit |
Carbon disulfide |
CS2 |
75-15-0 |
|
78 |
Carbon monoxit |
Carbon monoxide |
CO |
630-08-0 |
|
79 |
Carbon tetrachlorit |
Carbon tetrachloride |
CCl4 |
56-23-5 |
|
80 |
Carbophenothion |
Carbophenothion |
C11H16ClO2PS3 / (CH3CH2)2P(S)SCH2SC6H4Cl |
786-19-6 |
|
81 |
Cloral hydrat |
Chloral hydrate |
C2H3Cl3O2/Cl3CCH(OH)2 |
302-17-0 |
|
82 |
Clo |
Chlorine |
Cl2 |
7782-50-5 |
|
83 |
Axit cloroacetic |
Chloroacetic acid |
ClCH2COOH |
79-11-8 |
|
84 |
Cloroacetonitril |
Chloroacetonitrile |
C2H2ClN/ClCH2CN |
107-14-2 |
|
85 |
Cloroanilin p- |
Chloroaniline p- Chloroaminobenzene, p- 4-Chloroaniline |
C6H6ClN/ClC6H4NH2 |
106-47-8 |
|
86 |
Clorobenzen |
Chlorobenzene |
C6H5Cl |
108-90-7 |
|
87 |
Cloroetanol |
Chloroethanol |
ClCH2CH2OH |
107-07-3 |
|
88 |
Clorodifluorometan (R-22) |
Chlorodifluoromethane (R-22) |
CHClF2 |
75-45-6 |
|
89 |
Clorometyl metyl ete |
Chloromethyl methyl ether |
CH3OCH2Cl |
107-30-2 |
|
90 |
Clorpyrifos |
Chlorpyrifos (O,O-Diethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate) |
C9H11Cl3NO3PS |
2921-88-2 |
|
91 |
Crôm (VI) oxit |
Chromium (VI) oxide |
CrO3 |
1333-82-0 |
|
92 |
Chrysen |
Chrysen (1,2-benzophenanthrene) |
C18H12 |
218-01-9 |
|
93 |
Clopyralid |
Clopyralid |
C6H3Cl2NO2 / (C5H2N)Cl2COOH |
1702-17-6 |
|
94 |
Đồng (II) orthoarsenat |
Copper (II) orthoarsenate |
As2Cu3H8O12/Cu3(AsO4)2.4H2O |
10103-61-4 |
|
95 |
Crufomat |
Crufomate (4-tert-Butyl-2-chlorophenyl methylmethylphosphoramidate) |
C12H19CINO3P |
299-86-5 |
|
96 |
Cupric arsenit |
Cupric arsenite |
AsHO3Cu |
10290-12-7 |
|
97 |
Xianamit |
Cyanamide |
CH2N2/H2NCN |
420-04-2 |
|
98 |
Xianua |
Cyanides |
C≡N |
74-90-8 |
|
99 |
1,1-Dimetyl hydraxine |
1,1-Dimethylhydrazine |
C2H8N2/NH2-N(CH3)2 |
57-14-7 |
|
100 |
3-Cloro-1,2-dibromopropan |
3-Chloro-1,2-dibromopropane |
BrCH2BrCHCH2Cl |
96-12-8 |
|
101 |
1,2-Dicloroetan |
1,2-Dichloroethane |
ClCH2CH2Cl / C2H4Cl2 |
107-06-2 |
|
102 |
1,2-Diphenylhydrazin |
1,2-Diphenylhydrazine |
C12H12N2 / C6H5-NH-NH-C6H5 |
122-66-7 |
|
103 |
2,3- Dicloroanilin |
2,3-Dichloroaniline |
(C6H3)Cl2(NH2) |
608-27-5 |
|
104 |
2,3-Dinitrotoluen |
2,3-Dinitrotoluene |
C6H3CH3(NO2)2 / C7H6N2O4 |
602-01-7 |
|
105 |
2,4-Dicloroanilin |
2,4-Dichloroaniline |
(C6H3)Cl2(NH2) |
554-00-7 |
|
106 |
2,4-Diclorophenol |
2,4-Dichlorophenol |
C6H4Cl2O |
120-83-2 |
|
107 |
2,4-Dinitroanilin |
2,4-Dinitroaniline |
C6H5N3O4/C6H3(NH2)(NO2)2 |
97-02-9 |
|
108 |
2,4-Dinitrophenol |
2,4-Dinitrophenol |
C6H4N2O5/C6H3(OH)(NO2)2 |
51-28-5 |
|
109 |
2,4-Dinitrotoluen |
2,4-Dinitrotoluene |
C7H6N2O4 / C6H3CH3(NO2)2 |
121-14-2 |
|
110 |
3,3’-Diclorobenzidin |
3,3’-Dichlorobenzidine |
C6H3ClNH2C6ClNH2 / C12H10Cl2N2 |
91-94-1 |
|
111 |
3,4-Dicloroanilin |
3,4-Dichloroaniline |
(C6H3)Cl2(NH2) |
95-76-1 |
|
112 |
3,4-Dinitrotoluen |
3,4-Dinitrotoluene |
C7H6N2O4 / C6H3CH3(NO2)2 |
610-39-9 |
|
113 |
2,5-Dicloroanilin |
2,5-Dichloroaniline |
(C6H3)Cl2(NH2) |
95-82-9 |
|
114 |
2,6-Dicloroanilin |
2,6-Dichloroaniline |
(C6H3)Cl2(NH2) |
608-31-1 |
|
115 |
2,6-Dinitrotoluen |
2,6-Dinitrotoluene |
C7H6N2O4 / C6H3CH3(NO2)2 |
606-20-2 |
|
116 |
DDT |
DDT (Dichlorodiphenyltrichloroethane) |
C14H9Cl5 |
50-29-3 |
|
117 |
Dialifos |
Dialifos |
C14H17ClNO4PS2 |
10311-84-9 |
|
118 |
Dietylene glycol dinitrat |
Diethylene glycol dinitrate2-(2-nitrooxyethoxy)ethyl nitrate |
C4H8N2O7 |
693-21-0 |
|
119 |
Dimefox |
Dimefox |
C4H12FN2OP |
115-26-4 |
|
120 |
Dinitrophenol |
Dinitrophenol |
C6H4N2O5 |
51-28-5 |
|
121 |
Diophacinon |
Diphacinone |
C23H16O3 |
82-66-6 |
|
122 |
Disulfoton |
Disulfoton |
C8H19O2PS3 |
298-04-4 |
|
123 |
Demeton-o-metyl |
Demeton-o-metyl |
C6H15O3PS2 / (CH3O)2P(S)OCH2CH2SCH2CH3 |
867-27-6 |
|
124 |
Demeton-s |
Demeton-s (O,O-Diethyl S-2-ethylthioethyl phosphorothioate) |
C8H19O3PS2 |
126-75-0 |
|
125 |
Demeton-s-metyl |
Demeton-s-metyl (S-2-Ethylthioethyl O,O-dimethyl phosphorothioate) |
C6H15O3PS2 / (CH3O)2P(O)SCH2CH2SCH2CH3 |
919-86-8 |
|
126 |
Diammonium hydrogen arsenat |
Diammonium hydrogen arsenate (Ammonium arsenate) |
AsH9N2O4/ (NH4)2HAsO4 |
7784-44-3 |
|
127 |
Diazinon |
Diazinon |
C12H21N2O3PS/(CH3)2CHC4N2H(CH3)OPS(OC2H5)2 |
333-41-5 |
|
128 |
Diazometan |
Diazomethane (Phosphorothioic acid O,O-diethyl O-(6-methyl-2-(1-methylethyl)-4-pyrimidinyl) ester) |
CH2N2 |
334-88-3 |
|
129 |
Dibenz(a,h)anthracen |
Dibenz(a,h)anthracene |
C22H14 |
53-70-3 |
|
130 |
Diboran |
Diborane |
B2H6 |
19287-45-7 |
|
131 |
Diclorosilan |
Dichlorosilane |
SiH2Cl2 |
4109-96-0 |
|
132 |
Dicrotophos |
Dicrotophos ((E)-2-Dimethylcarbamoyl-1-methylvinyl dimethyl phosphate) |
C8H16NO5P |
141-66-2 |
|
133 |
Dieldrin |
Dieldrin (1,2,3,4,10,10-Hexachloro-6,7-epoxy-1,4,4a,5,6,7,8,8a-octahydro,endo,exo-1,4:5,8- dimethanonaphthalene) |
C12H8Cl6O |
60-57-1 |
|
134 |
Dimetyl sulfat |
Dimethyl sulfate |
C2H6O4S / (CH3O)2SO2 |
77-78-1 |
|
135 |
Dinitrotoluen (hỗn hợp đồng phân) |
Dinitrotoluene (mixed isomers) |
C7H6N2O4/C6H3(CH3)(NO2)2 |
25321-14-6 |
|
136 |
Dinoseb |
Dinoseb (2-sec-Butyl-4,6-dinitrophenol) |
C10H12N2O5 |
88-85-7 |
|
137 |
Dioxathion (hỗn hợp đồng phân) |
Dioxathion (isomer mixture) |
C12H26O6P2S4 |
78-34-2 |
|
138 |
Diphenylamin |
Diphenylamine |
C12H11N / C6H5NHC6H5 |
122-39-4 |
|
139 |
Dinatri arsenat |
Disodium arsenate |
Na2HAsO4.7H2O |
10048-95-0 |
|
140 |
2,3-Epoxy-1-propanol |
2,3-Epoxy-1-propanol (Glycidol) |
C3H6O2 |
556-52-5 |
|
141 |
2-Ethoxyetanol |
2-Ethoxyethanol (Ethylene glycol monoethyl ether) |
CH3CH2OCH2CH2OH |
110-80-5 |
|
142 |
2-Ethoxyethyl acetat |
2-Ethoxyethyl acetate |
C6H12O3 / CH3COOCH2CH2OCH2CH3 |
111-15-9 |
|
143 |
Endosulfan (hỗn hợp đồng phân) |
Endosulfan (mixed isomers) |
C9H6Cl6O3S |
115-29-7 |
|
144 |
Epiclorohydrin |
Epiclorohydrin (1-Chloro-2,3-epoxypropane) |
C3H5Cl |
106-89-8 |
|
145 |
EPN |
EPN (O-Ethyl O-4-nitrophenyl phenyl phosphonothioate) |
C14H14NO4PS |
2104-64-5 |
|
146 |
Ethino |
Ethino |
C9H22O4P2S4 |
563-12-2 |
|
147 |
Ethyl carbamat |
Ethyl carbamate |
C3H7NO2 / NH2COOC2H5 |
51-79-6 |
|
148 |
Ethyl Cloroformat |
Ethyl chloroformate |
C3H5ClO2/ClCOOC2H5 |
541-41-3 |
|
149 |
Etylen dibromid |
Ethylene dibromide |
Br(CH2)2Br/C2H4Br2 |
106-93-4 |
|
150 |
Etylen glycol dinitrat |
Ethylene glycol dinitrate |
C2H4N2O6/NO2-OCH2CH2O-NO2 |
628-96-6 |
|
151 |
Etylen oxit |
Ethylene oxide |
C2H4O |
75-21-8 |
|
152 |
Etyleneimin |
Ethyleneimine |
C2H5N/CH2NHCH2 |
151-56-4 |
|
153 |
Fenitrothion |
Fenitrothion (O,O-Dimethyl-O-4-nitro-m-tolyl phosphorothioate) |
C9H12NO5PS |
122-14-5 |
|
154 |
Fenthion |
Fenthion (O,O-Dimethyl-O-(4-methylthio-m-tolyl) phosphorothioate) |
C10H15O3PS2/(H3CO)2PS-O-C6H3(CH3)-S-CH3 |
55-38-9 |
|
155 |
Fluorin |
Fluorine |
F2 |
7782-41-4 |
|
156 |
Axit fluoroacetic |
Fluoroacetic acid |
C2H3FO2/CH2FCOOH |
144-49-0 |
|
157 |
Formaldehyd |
Formaldehyde |
CH2O |
50-00-0 |
|
158 |
Fonofos |
Fonofos (O-Ethyl S- phenylethylphosphonodithioate) |
C2H5SPSCH2CH3OCH2CH3 / C10H15OPS2 |
944-22-9 |
|
159 |
Fufural |
Furfural |
C4H3OCHO |
98-01-1 |
|
160 |
2-Hexanon |
2-Hexanone (Methyl n-butyl ketone (MnBK, MBK)) |
C6H12O/C4H9COCH3 |
591-78-6 |
|
161 |
Heptaclo |
Heptachlor |
C10H5Cl7 |
76-44-8 |
|
162 |
Hexaclorobenzen |
Hexachlorobenzene |
C6Cl6 |
118-74-1 |
|
163 |
Hexaclorocyclohexan (hỗn hợp đồng phân) |
Hexachlorocyclohexane (mixed isomers) |
C6H6Cl6 |
608-73-1 |
|
164 |
Hexaclorophen |
Hexachlorophene |
C13H6Cl602/C6H(OH)Cl3CH2Cl3(OH)C6H |
70-30-4 |
|
165 |
Hexametylen diisocyanat |
Hexamethylene diisocyanate (1,6-Hexamethylene diisocyanate) |
C8H12N2O2/OCN-(CH2)6-NCO |
822-06-0 |
|
166 |
Hexametyl phosphoric triamit |
Hexamethylphosphoric triamide |
C6H18N3OP/{(CH3)2N}3P(O) |
680-31-9 |
|
167 |
Hydrazin |
Hydrazine (Diamide) |
N2H4/H2N-NH2 |
302-01-2 |
|
168 |
Hydro bromua |
Hydrogen Bromide |
HBr |
10035-10-6 |
|
169 |
Axit clohydric |
Hydrochloric acid |
HCl |
7647-01-0 |
|
170 |
Hydro xyanua |
Hydrogen cyanide |
HCN |
74-90-8 |
|
171 |
Hydro fluorua |
Hydrogen fluoride |
HF |
7664-39-3 |
|
172 |
Hydro selenid |
Hydrogen selenide |
H2Se |
7783-07-5 |
|
173 |
Hydro Sulphít |
Hydrogen sulphide |
H2S |
7783-06-4 |
|
174 |
Hydroxylamin |
Hydroxylamine |
H3NO/NH2OH |
7803-49-8 |
|
175 |
Glycolonitril |
Hydroxyacetonitrile (Glycolonitrile) |
C2H3NO |
107-16-4 |
|
176 |
Hydroxylamin hydroclorit |
Hydroxylamine hydrochloride |
NH2OH.HCl |
5470-11-1 |
|
177 |
Indomethacin |
Indomethacin |
C19H16ClNO4 |
53-86-1 |
|
178 |
Isobenzan |
Isobenzan |
C9H4Cl8O |
297-78-9 |
|
179 |
Isodrin |
Isodrin |
C12H8Cl6 |
465-73-6 |
|
180 |
Iốt |
Iodine |
I2 |
7553-56-2 |
|
181 |
Iốt xyanua |
Iodine cyanide |
CNI |
506-78-5 |
|
182 |
Iodometan |
Iodomethane |
CH3l |
74-88-4 |
|
183 |
Sắt (III)-o-arsenit, pentahydrat |
Iron (III)-o-arsenite, pentahydrate |
As2Fe2O6.Fe2O3.5H2O |
63989-69-5 |
|
184 |
Isophoron diisoxyanat |
Isophorone diisocyanate |
C12H18N2O2 |
4098-71-9 |
|
185 |
Juglon |
Juglone (5-Hydroxy-naphthalene-1,4-dione) |
C10H6O3 |
481-39-0 |
|
186 |
Chì axetat |
Lead acetate |
C4H6O4Pb / (CH3COO)2Pb |
301-04-2 |
|
187 |
Chì cromat |
Lead chromate |
PbCrO4 |
7758-97-6 |
|
188 |
Chì naphtenat |
Lead naphthenate |
[(CH2)nCOO]2Pb |
61790-14-5 |
|
189 |
Chì (II) arsenit |
Lead(II) arsenite |
As2O4Pb/Pb(AsO2)2 |
10031-13-7 |
|
190 |
Chì (II) oxit |
Lead(II) oxide |
PbO |
1317-36-8 |
|
191 |
Lindan |
Lindane (gamma-1,2,3,4,5,6-Hexachlorocyclohexane) |
C6H6Cl6 |
58-89-9 |
|
192 |
2-Mercaptoimidazolin |
2-Mercaptoimidazoline |
C3H6N2S |
96-45-7 |
|
193 |
2-Methoxyetanol |
2-Methoxyethanol |
CH3OCH2CH2OH |
109-86-4 |
|
194 |
2-Methoxyetyl acetat |
2-Methoxyethyl acetate |
C5H10O3 / CH3COOCH2CH2OCH3 |
110-49-6 |
|
195 |
4-Metyl pyritin |
4-Methylpyridine |
C6H7N/(C5H4N)CH3 |
108-89-4 |
|
196 |
Magie asenat |
Magneium asenate |
Mg3(AsO4)2.8H2O |
10103-50-1 |
|
197 |
Magie phốtphua |
Magnesium phosphide |
Mg3P2 |
12057-74-8 |
|
198 |
m-cresol |
m-Cresol (3-Methylphenol) |
C7H8O/C6H4(OH)CH3 |
108-39-4 |
|
199 |
Thủy ngân axetat |
Mercuric acetate Thủy ngân |
Hg(C2H3O2)2/Hg(CH3COO)2 |
1600-27-7 |
|
200 |
Thủy ngân clorua |
Mercuric chloride |
Hg Cl2 |
7487-94-7 |
|
201 |
Thủy ngân natri |
Mercuric nitrate |
HgN2O6/Hg(NO3)2 |
10045-94-0 |
|
202 |
Thủy ngân oxit |
Mercuric oxide |
HgO |
21908-53-2 |
|
203 |
Thủy ngân sunphát |
Mercuric sulfate |
HgSO4 |
7783-35-9 |
|
204 |
Thủy ngân |
Mercury |
Hg |
7439-97-6 |
|
205 |
Meta-Toluidin |
meta-Toluidine |
C7H9N/C6H4CH3NH2 |
108-44-1 |
|
206 |
Methacrylonitril |
Methacrylonitrile |
C4H5N |
126-98-7 |
|
207 |
Methamitophos |
Methamidophos |
C2H8NO2PS |
10265-92-6 |
|
208 |
Metanol |
Methanol |
CH4O/CH3OH |
67-56-1 |
|
209 |
Methomyl |
Methomyl |
C5H10N2O2S |
16752-77-5 |
|
210 |
Metyl bromid |
Methyl bromide |
CH3Br |
74-83-9 |
|
211 |
Metyl cloroformat |
Methyl chloroformate |
CH3OCOCl/C2H3ClO2 |
79-22-1 |
|
212 |
Metyl isoxyanat |
Methyl isocyanate |
CH3NCO |
624-83-9 |
|
213 |
Axit metyl arsonic |
Methylarsonic acid |
CH3AsO(OH)2/CH5AsO3 |
124-58-3 |
|
214 |
Metyl mercaptan |
Methyl Mercaptan |
CH3SH |
74-93-1 |
|
215 |
Mevinpho |
Mevinphos (Methyl 3- (dimethoxyphosphinoyloxy)but-2-enoate) |
C7H13O6P |
7786-34-7 |
|
216 |
Monocrotopho |
Monocrotophos (Dimethyl(E)-1-methyl-2- (methylcarbamoyl) vinylphosphate) |
C7H14NO5P |
6923-22-4 |
|
217 |
N-Methyl-N,2,4,6-N- tetranitroanilin |
N-Methyl-N,2,4,6-N- tetranitroaniline |
C14H20N2 |
96096-52-5 |
|
218 |
Axit nitric |
Nitric acid |
HNO3 |
7697-37-2 |
|
219 |
Nitric oxit |
Nitric Oxide |
NO |
0102-43-9 |
|
220 |
2-Nitroanilin |
2-Nitroaniline |
C6H6N2O2 |
88-74-4 |
|
221 |
3-Nitroanilin |
3-Nitroaniline |
C6H6N2O2 |
99-09-2 |
|
222 |
4-Nitroanilin |
4-Nitroaniline |
C6H6N2O2 |
100-01-6 |
|
223 |
Nitrobenzen |
Nitrobenzene |
C6H5NO2 |
98-95-3 |
|
224 |
2-Nitrotoluen |
2-Nitrotoluene |
C7H7NO2 |
88-72-2 |
|
225 |
2-Nitropropan |
2-Nitropropane |
C3H7NO2/CH3CHNO2CH3 |
79-46-9 |
|
226 |
n,n-Dimetyl anilin |
n,n-Dimethylaniline |
C8H11N/C6H5N(CH3)2 |
121-69-7 |
|
227 |
n,n-Dimetyl formamit |
n,n-Dimethylformamide |
C3H7NO/HCON(CH3)2 |
68-12-2 |
|
228 |
n,n-Dimetyl –p-toluidin |
n,n-Dimethyl –p-toluidine |
C9H13N/CH3C6H4N(CH3)23 |
99-97-8 |
|
229 |
Nikel carbonyl |
Nikel carbonyl |
C4NiO4/Ni(CO)4 |
13463-39-3 |
|
230 |
Nicotin |
Nicotine |
C10H14N2 |
54-11-5 |
|
231 |
Nicotin sulfat |
Nicotine sulfate |
C20H26N4.O4S |
65-30-5 |
|
232 |
Nicotin tartrat |
Nicotine tartrate |
C10H14N2.2C4H6O6 |
65-31-6 |
|
233 |
Nitrobenzen |
Nitrobenzene |
C6H5NO2 |
98-95-3 |
|
234 |
Nitrofen |
Nitrofen |
C12H7Cl2NO3 |
1836-75-5 |
|
235 |
Nitơ dioxit |
Nitrogen dioxide |
NO2 |
10102-44-0 |
|
236 |
Nickel tetracarbonyl |
Nickel tetracarbonyl |
Ni(CO)4 |
13463-39-3 |
|
237 |
|
Nitroglycerine (trùng 238) |
|
|
|
238 |
Nitroglycerin |
Nitroglycerin |
C3H5N3O9/C3H5(NO3)3 |
55-63-0 |
|
239 |
n-Metyl anilin |
n-Methylaniline |
C7H9N/C6H5NH(CH3) |
100-61-8 |
|
240 |
Axit osmic |
Osmic acid |
OsO4 |
20816-12-0 |
|
241 |
Ozôn+ |
Ozone |
O3 |
10028-15-6 |
|
242 |
o-Anisidin |
o-Anisidine |
C7H9NO/H2NC6H4OCH3 |
90-04-0 |
|
243 |
o-Cresol |
o-Cresol |
C7H8O/CH3C6H4OH |
95-48-7 |
|
244 |
o-Diclorobenzen |
o-Diclorobenzene |
C6H4Cl2 |
95-50-1 |
|
245 |
o-Nitrotoluen |
o-Nitrotoluene |
C7H7NO2/C6H4(CH3)(NO2) |
88-72-2 |
|
246 |
o-Tolidin |
o-Tolidine |
C14H16N2 |
119-93-7 |
|
247 |
o-Tolidin dihydroclorit |
o-Tolidine dihydrocloride |
(C6H3-3-CH3-4-NH2)2 2HCl |
612-82-8 |
|
248 |
Axit o-Toluic |
o-Toluic acid |
C8H8O2 |
118-90-1 |
|
249 |
O,O-Dietyl S-etylsulphinylmetyl phosphorothioat |
O,O-Diethyl S-etylsulphinylmethyl phosphorothioate |
C7H17O4PS2 |
2588-05-8 |
|
250 |
O,O-Dietyl S-isopropythiometyl phosphorodithioat |
O,O-Diethyl S-isopropythiomethyl phosphorodithioate |
C8H19O2PS3 |
78-52-4 |
|
251 |
O,O-Dietyl S-propylthiometyl phosphorodithioat |
O,O-Diethyl S-propylthiomethyl phosphorodithioate |
C8H19O2PS3 |
3309-68-0 |
|
252 |
Oxy disulfoton |
Oxydisulfoton |
C8H19O3PS3 |
2497-07-6 |
|
253 |
Oxy difluorua |
Oxygen difluoride |
OF2 |
7783-41-7 |
|
254 |
p-Toluidin |
p-Toluidine |
CH3C6H4NH2 |
106-49-0 |
|
255 |
p-Anisidin |
p-Anisidine (4-Methoxybenzenamine) |
C7H9NO/H2NC6H4OCH3 |
104-94-9 |
|
256 |
Paraquat |
Paraquat (1,1’-Dimethyl-4,4’-bipyridinium dichloride (paraquat dichloride)) |
CH3(C5H4N)2CH3Cl2 |
1910-42-5 |
|
257 |
Parathion |
Parathion (O,O-Diethyl-O-(4-nitrophenyl)phosphorothioate) |
(C2H5O)2PSOC6H4NO2 |
56-38-2 |
|
258 |
para-Toluidin |
para-Toluidine |
C7H9N/C6H4CH3NH2 |
106-49-0 |
|
259 |
p-Cresol |
p-Cresol |
C7H8O/CH3C6H4OH |
106-44-5 |
|
260 |
PentaCloronaphthalen |
Pentachloronaphthalene |
C10H3Cl5 |
1321-64-8 |
|
261 |
Pentaclorophenol |
Pentachlorophenol |
C6Cl5OH |
87-86-5 |
|
262 |
Paraoxon (Dietyl 4-nitrophenyl phosphat) |
Paraoxon (Diethyl 4-nitrophenyl phosphate) |
C10H14NO6P |
83-49-8 |
|
263 |
Parathion-metyl |
Parathion-methyl |
C10H14NO5PS |
56-38-2 |
|
264 |
Pentaboran |
Pentaborane |
B5H9 |
19624-22-7 |
|
265 |
Phorat |
Phorate |
C7H17O2PS3 |
298-02-2 |
|
266 |
Phosacetim |
Phosacetim |
C14H13Cl2N2O2PS |
4104-14-7 |
|
267 |
Phosphamidon |
Phosphamidon |
C10H19ClNO5P |
13171-21-6 |
|
268 |
Promurit |
Promurit (1-(3,4-Dichlorophenyl)-3-triazenethio-carboxamide) |
C7H6Cl2N4S |
5836-73-7 |
|
269 |
Propyleneimine |
Propyleneimine |
C3H7N |
75-55-8 |
|
270 |
Pyrazoxon |
Pyrazoxon |
C8H15N2O4P |
108-34-9 |
|
271 |
Phenol |
Phenol |
C6H6O/C6H5OH |
108-95-2 |
|
272 |
Phenylhydrazin |
Phenylhydrazine |
C6H8N2/C6H5NHNH2 |
100-63-0 |
|
273 |
Phosalon |
Phosalone |
C8H8N2/C6H5NHNH2 |
2310-17-0 |
|
274 |
Phosgen |
Phosgene |
COCl2 |
75-44-5 |
|
275 |
Phosphamiton |
Phosphamidon |
C10H19ClNO5P |
13171-21-6 |
|
276 |
Phosphin |
Phosphine |
PH3 |
7803-51-2 |
|
277 |
Phốt pho (vàng) |
Phosphorus (yellow) |
P4 |
7723-14-0 |
|
278 |
Phosphorus triclorit |
Phosphorus trichloride |
PCl3 |
7719-12-2 |
|
279 |
Piperidin |
Piperidine |
CH2(CH2)4NH |
110-89-4 |
|
280 |
p-NitroClorobenzen |
p-Nitrochlorobenzene |
NO2C6H4Cl |
100-00-5 |
|
281 |
p-Nitrotoluen |
p-Nitrotoluene |
C7H7NO2/C6H4(CH3)NO2 |
99-99-0 |
|
282 |
Biphenyl đã polyclo hóa (PCBs) |
Polychlorinated Biphenyls (PCBs) |
|
11097-69-1 |
|
283 |
Kali arsenat |
Potassium arsenate |
KH2AsO4 |
7784-41-0 |
|
284 |
Kali arsenit |
Potassium arsenite |
KAsO4 |
10124-50-2 |
|
285 |
Kali bromat |
Potassium bromate |
KBrO3 |
7758-01-2 |
|
286 |
Kali hexafluorosilicat |
Potassium hexafluorosilicate |
K2SiF6 |
16871-90-2 |
|
287 |
Kali hexaxyanocobaltat(III) |
Potassium hexacyanocobaltate(III) |
C9CoK3N6 |
13963-58-1 |
|
288 |
Kali hexacloroplatinat (IV) |
Potassium hexachloroplatinate (IV) |
K2PtCl6 |
16921-30-5 |
|
289 |
Kali hexafluoroarsenat (V) |
Potassium hexafluoroarsenate (V) |
KAsF6 |
17029-22-0 |
|
290 |
Rượu propargyl |
Propargyl alcohol |
C3H4O/CHCCH2OH |
107-19-7 |
|
291 |
Propoxu |
Propoxur (2-Isopropoxyphenyl methylcarbamate) |
C11H15NO3 |
114-26-1 |
|
292 |
Propyleneimin |
Propyleneimine |
C3H7N |
75-55-8 |
|
293 |
Propylen oxit |
Propylene oxide |
CH3CHCH2O/C3H6O |
75-56-9 |
|
294 |
Rotenon |
Rotenone |
C23H22O6 |
83-79-4 |
|
295 |
Axit selenơ |
Selenious acid |
H2SeO3 |
7783-00-8 |
|
296 |
Selen (dạng bột) |
Selenium (powder) |
Se |
7782-49-2 |
|
297 |
Selen dioxit |
Selenium dioxide |
SeO2 |
7446-08-4 |
|
298 |
Selen hexafluorua |
Selenium hexafluoride |
SeF6 |
7783-79-1 |
|
299 |
Selen oxyclorit |
Selenium oxychloride |
SeOCl2 |
7791-23-3 |
|
300 |
Selen trioxit |
Selenium trioxide |
SeO3 |
13768-86-0 |
|
301 |
Silicon tetrafluorit |
Silicon tetrafluoride |
SiF4 |
7783-61-1 |
|
302 |
Bạc kali xianua |
Silver potassium cyanide |
AgK(CN)2 |
506-61-6 |
|
303 |
Silvex |
Silvex |
C9H7Cl2O3 |
93-72-1 |
|
304 |
Bạc xyanua |
Silver cyanide |
AgCN |
506-64-9 |
|
305 |
Natri arsenat dibasic |
Sodium arsenate dibasic |
AsHNa2O4/HNa2AsO4 |
7778-43-0 |
|
306 |
Natri azid |
Sodium azide |
NaN3 |
26628-22-8 |
|
307 |
Natri xyanua |
Sodium cyanide |
NaCN |
143-33-9 |
|
308 |
Natri fluoroacetat |
Sodium fluoroacetate |
C2H2FO2.Na / CH2FCOONa |
62-74-8 |
|
309 |
Natri hexafluorosilicat |
Sodium hexafluorosilicate |
Na2SiF6 |
16893-85-9 |
|
310 |
Hỗn hợp natri- thủy ngân |
Sodium-mercury amalgam |
Na2Hg |
11110-52-4 |
|
311 |
Natri nitrit |
Sodium nitrite |
NaNO2 |
7632-00-0 |
|
312 |
Natri selenit |
Sodium selenite |
Na2SeO3 |
10102-18-8 |
|
313 |
Strontium cromat |
Strontium chromate |
CrO4Sr |
7789-06-2 |
|
314 |
Strychnin |
Strychnine |
C21H22N2O2 |
57-24-9 |
|
315 |
Strychnin sulfat |
Strychnine sulfate |
C21H22N2O2, 1/2 H2SO4 |
60-41-3 |
|
316 |
Sulfotep |
Sulfotep (Thiodiphosphoric acid tetraethyl ester) |
C8H20O5P2S2 |
3689-24-5 |
|
317 |
Axit sulfuric |
Sulfuric acid |
H2SO4 |
7664-93-9 |
|
318 |
Lưu huỳnh dioxit |
Sulphur dioxide |
SO2 |
7446-09-5 |
|
319 |
1,1,1,2-Tetracloroetan |
1,1,1,2-Tetrachloroethane |
CCl3CH2Cl |
630-20-6 |
|
320 |
1,1,2,2-Tetracloroetan |
1,1,2,2-Tetrachloroethane (Acetylene tetrachloride) |
CHCl2CHCl2/C2H2Cl4 |
79-34-5 |
|
321 |
1,2,3,4-Tetracloronaphtalen |
1,2,3,4-Tetrachloronaphthalene |
C10H4Cl4 |
20020-02-4 |
|
322 |
1,2,3,6-Tetrahydro-1-metyl-4-phenylpyritin |
1,2,3,6-Tetrahydro-1-methyl-4-phenylpyridine |
C12H15N |
28289-54-5 |
|
323 |
2,3,4,6-Tetraclorophenol |
2,3,4,6-Tetrachlorophenol |
C6H2Cl4O |
58-90-2 |
|
324 |
2,4,6-Trinitrotoluen |
2,4,6-Trinitrotoluene (TNT) |
C7H5N3O6/C6H2(CH3)(NO2)3 |
118-96-7 |
|
325 |
2,4-Toluen diisocyanat |
2,4-Toluene diisocyanate |
C9H6N2O2/CH3C6H3(NCO)2 |
584-84-9 |
|
326 |
2,6-Toluen diisocyanat |
2,6-Toluene diisocyanate |
C9H6N2O2 |
91-08-7 |
|
327 |
Toxaphen |
Toxaphene |
C10H10Cl8 |
8001-35-2 |
|
328 |
T.E.P.P |
T.E.P.P (Tetraethyl pyrophosphate) |
C8H20O7P2/(C2H5O)2-PO-O-PO-(OC2H5)2 |
107-49-3 |
|
329 |
Tetraethyl chì |
Tetraethyl lead |
Pb(C2H5)4 |
78-00-2 |
|
330 |
Tetrametyl chì |
Tetramethyl lead |
C4H12Pb |
75-74-1 |
|
331 |
Tali |
Thallium Tali |
Tl |
7440-28-0 |
|
332 |
Talidomid |
Thalidomide |
C13H10N2O4 |
50-35-1 |
|
333 |
Talllic nitrat, trihydrat |
Thalllic nitrate, trihydrate |
Tl(NO3)3 3H2O |
13453-38-8 |
|
334 |
Tali carbonat |
Thallium carbonate |
Tl2CO3 |
6533-73-9 |
|
335 |
Tali hexafluorophosphat |
Thallium hexafluorophosphate |
TlPF6 |
60969-19-9 |
|
336 |
Tali nitrat |
Thallium nitrate |
TINO3 |
10102-45-1 |
|
337 |
Thalidomid |
Thalidomide |
C13H10N2O4 |
50-35-1 |
|
338 |
Tallous sulfat |
Thallous sulfate |
Tl2SO4 |
7446-18-6 |
|
339 |
Thiabendazol |
Thiabendazole |
C10H7N3S |
148-79-8 |
|
340 |
Thiocarbanilid |
Thiocarbanilide |
C13H12N2S |
102-08-9 |
|
341 |
Thiophosphoryl clorua |
Thiophosphoryl chloride |
PSCl3 |
3982-91-0 |
|
342 |
Thiosemicarbazid |
Thiosemicarbazide |
NH2CSNHNH2 |
79-19-6 |
|
343 |
Thiram |
Thiram |
C6H12N2S4 |
137-26-8 |
|
344 |
Thiometon |
Thiometon (S-2-Ethylthioethyl O,O- dimethyl phosphorodithioate) |
C6H15O2PS3 / (CH3O)2P(S)SCH2CH2SCH2CH3 |
640-15-3 |
|
345 |
Thiophosgene |
Thiophosgene |
CSCl2 |
463-71-8 |
|
346 |
Thiourea |
Thiourea |
CH4N2S |
62-56-6 |
|
347 |
Thiram |
Thiram |
C6H12N2S4 |
137-26-8 |
|
348 |
Thorin |
Thorin |
C16H11N2O10S2Na2As |
132-33-2 |
|
349 |
Thori carbonat |
Thorium carbonate |
Th(CO3)2 |
19024-62-5 |
|
350 |
Thori nitrat |
Thorium nitrate |
Th(NO3)4 |
13823-29-5 |
|
351 |
Thymol |
Thymol |
C10H14O |
89-83-8 |
|
352 |
Tris(2-cloroethyl)phosphat |
Tris(2-chloroethyl)phosphate |
(ClCH2CH2O)3P(O) |
115-96-8 |
|
353 |
Tri-o-cresyl phosphat |
Tri-o-cresyl phosphate (TOCP) |
C21H21O4P |
78-30-8 |
|
354 |
Tungsten hexafluorit |
Tungsten hexafluoride |
WF6 |
7783-82-6 |
|
355 |
Telua hexafluorit |
Tellurium hexafluoride |
TeF6 |
7783-80-4 |
|
356 |
Thionazin |
Thionazin |
C8H13N2O3PS |
297-97-2 |
|
357 |
Tirpate (2,4-Dimethyl-1,3-dithiolan-2-carboxaldehyde O-metylcarbamoyloxime) |
Tirpate (2,4-Dimethyl-1,3-dithiolane-2-carboxaldehyde O-methylcarbamoyloxime) |
C8H14N2O2S2 |
26419-73-8 |
|
358 |
Triclorometanesulphenyl clorit |
Trichloromethanesulphenyl chloride |
CHCl3 |
594-42-3 |
|
359 |
Trietylenemelamin |
Triethylenemelamine |
C9H12N6 |
51-18-3 |
|
360 |
Trinitrobenzen |
Trinitrobenzene |
C6H3N3O6 |
99-35-4 |
|
361 |
Vinyl clorit |
Vinyl chloride |
C2H3Cl/H2C=CHCl |
75-01-4 |
|
362 |
2,4-Xylidin |
2,4-Xylidine |
C8H11N |
95-68-1 |
|
363 |
2,6-Xylidin |
2,6-Xylidine |
C8H11N |
87-62-7 |
|
364 |
Warfarin |
Warfarin |
C19H16O4 |
81-81-2 |
|
365 |
Kẽm cromat |
Zinc chromate |
ZnCrO4 |
13530-65-9 |
|
366 |
Kẽm phốtphua |
Zinc phosphide |
Zn3P2 |
1314-84-7 |
PHỤ LỤC VII
DANH MỤC HÓA CHẤT PHẢI XÂY DỰNG BIỆN PHÁP PHÒNG NGỪA, ỨNG PHÓ SỰ CỐ HÓA CHẤT
(Ban hành kèm theo Nghị định số 26/2011/NĐ-CP ngày 08 tháng 4 năm 2011 của Chính phủ)
|
STT |
Tên hóa chất theo tiếng Việt |
Tên hóa chất theo tiếng Anh |
Mã số CAS |
Công thức hóa học |
Khối lượng giới hạn (kg) |
|
1 |
Diclo phenyl isoxyanua |
Dichlorophenyl isocyanate |
|
Cl2C6H3NCO |
|
|
2 |
Clo benzyl clorua |
Chlorobenzyl chloride |
|
C7H6Cl2 |
|
|
3 |
Diclo pentan |
Dichloropentane |
|
C5H10Cl2 |
|
|
4 |
Nitrotoluen |
Nitrotoluene |
|
C7H7NO2 |
|
|
5 |
Nitroanilin |
Nitroaniline |
|
C6H4NH2NO2 |
|
|
6 |
Nitrophenol |
Nitrophenols |
|
C6H5NO3 |
|
|
7 |
Xylyl bromua |
Xylyl bromide |
|
C8H9Br |
|
|
8 |
Anisidin |
Anisidine |
|
C7H9NO |
|
|
9 |
Clo toluen |
Chlorotoluene (o-chlorotoluene m-chlorotoluene p-chlorotoluene) |
(95-49-8 108-41-8 106-43-4) |
C7H7Cl |
|
|
10 |
Toluidin |
Toluidine |
|
C7H9N |
|
|
11 |
Phenylendiamin |
Phenylenediamine |
|
C6H8N2 |
|
|
12 |
1-Clo butan |
Butyl chloride |
|
C4H9Cl |
|
|
13 |
Chì axetat |
Lead acetate (Lead(II) acetate, Lead(IV) acetate) |
(301-04-2, 546-67-8) |
Pb(CH3COO)4 |
|
|
14 |
Cresol |
Cresol |
|
C7H8O |
|
|
15 |
n-propyl iođua |
Iodopropane |
|
C3H7I |
|
|
16 |
Hỗn hống (thủy ngân – natri) |
Amalgam |
(11110-52-4) |
|
|
|
17 |
Các hợp chất của Niken dạng bột có thể phát tán rộng trong không khí (niken monoxit, niken dioxit, niken sulphua, triniken disulphua, diniken trioxit) |
(Nickel monoxide, |
(1313-99-1, 12035-36-8, 11113-75-0 12035-72-2, 34875-54-2) |
(NiO, |
|
|
18 |
Thủy ngân bromua |
Mercury bromide (Mercury(I) bromide, Mercury(II) bromide) |
(15385-58-7, 7789-47-1) |
(HgBr, |
|
|
19 |
Xylen (o-Xylen, m-Xylen, p-Xylen) |
Xylene (o, m, p-Xylene) |
(95-47-6, 108-38-3, 106-42-3) |
C8H10 |
|
|
20 |
p-Nitro Clo benzen |
p-Nitrochlorobenzene |
100-00-5 |
ClC6H4NO2 |
|
|
21 |
4-Nitro anilin |
4-Nitroaniline |
100-01-6 |
C6H6N2O2 |
|
|
22 |
4-nitro Phenol |
Phenol, 4-nitro - |
100-02-7 |
C6H5NO3 |
|
|
23 |
Anisoyl clorua |
Anisoyl chloride |
100-07-2 |
C8H7ClO2 |
|
|
24 |
Nitroanisol |
Nitroanisole |
100-17-4 |
C7H7NO3 |
|
|
25 |
Canxi clorat |
Calcium chlorate |
10017-74-3 |
Ca(ClO3)2 |
|
|
26 |
Amyl nitrat |
Amyl nitrate |
1002-16-0 |
C5H11NO3 |
|
|
27 |
Bari nitrat |
Bari nitrate |
10022-31-8 |
Ba(NO3)2 |
|
|
28 |
Dinitơ monoxit |
Nitrous oxide |
10024-97-2 |
N2O |
|
|
29 |
Lưu huỳnh clorua |
Sulfur monoclorite |
10025-67-9 |
Cl2S2 |
|
|
30 |
Triclo silan |
Trichlorosilane (Silane, trichloro-) |
10025-78-2 |
HsiCl3 |
4540 |
|
31 |
Photpho oxyclorua |
Phosphorus oxychloride (Phosphoryl chloride) |
10025-87-3 |
POCl3 |
2270 |
|
32 |
Stibi clorua |
Antimony trichloride |
10025-91-9 |
SbCl3 |
|
|
33 |
Silicon tetraclorua |
Silicon tetrachloride |
10026-04-7 |
SiCl4 |
|
|
34 |
Tin tetraclorua pentahydrat |
Stannic chloride pentahydrate |
10026-06-9 |
SnCl4 5H2O |
|
|
35 |
Kẽm tetraclorua |
Zirconium(IV) chloride |
10026-11-6 |
ZrCl4 |
|
|
36 |
Photpho pentaclorua |
Phosphorus pentaclorite |
10026-13-8 |
PCl5 |
|
|
37 |
Ozôn |
Ozone (trioxygen) |
10028-15-6 |
O3 |
|
|
38 |
Chì (II) arsenit |
Lead(II) arsentite |
10031-13-7 |
Pb(AsO2)2 |
|
|
39 |
2-Etyl butyl axetat |
2-Ethylbutyl acetate |
10031-87-5 |
C8H16O2 |
|
|
40 |
Magie peclorat |
Magnesium perchlorate |
10034-81-8 |
Mg(ClO4)2 |
|
|
41 |
Hydro iođua |
Hydroiodic acid |
10034-85-2 |
HI |
|
|
42 |
Hydro Bromua |
Hydrogen Bromide |
10035-10-6 |
HBr |
|
|
43 |
N,N-Dietyletylendiamin |
N,N-Diethylethylenediamine |
100-36-7 |
C6H16N2 |
|
|
44 |
N,N-Dietylaminoetan ol và các muối proton hóa chất tương ứng |
N,N-Diethylaminoetanol |
100-37-8 |
(C2H5)2NC2H5O |
|
|
45 |
Benzyl bromua |
Benzyl bromide |
100-39-0 |
C7H7Br |
|
|
46 |
Hydroxylamin sulphat |
Hydroxylammonium sulfate |
10039-54-0 |
(NH3OH)2SO4 |
|
|
47 |
Etylbenzen |
Ethylbenzene |
100-41-4 |
C8H10 |
|
|
48 |
Vinylbenzen |
Vinyl benzene (Styrene) |
100-42-5 |
C8H8 |
|
|
49 |
Stronti nitrat |
Strontium nitrate |
10042-76-9 |
Sr(NO3)2 |
|
|
50 |
Benzyl clorua |
Benzyl chloride |
100-44-7 |
C6H5Cl |
|
|
51 |
Thủy ngân nitrat |
Mercuric nitrate |
10045-94-0 |
Hg(NO3)2 |
|
|
52 |
Benzonitril |
Benzonitrile |
100-47-0 |
C6H5CN |
|
|
53 |
Đinatri hydro arsenat |
Disodium arsenate |
10048-95-0 |
Na2HAsO4 |
|
|
54 |
Clo dioxit |
Chlorine dioxide (Chlorine oxide) |
10049-04-4 |
ClO2 |
454 |
|
55 |
1,2,3,6- Tetrahydrobenzal dehit |
1,2,3,6- Tetrahydrobenzaldehyde |
100-50-5 |
C7H10O |
|
|
56 |
Benzaldehit |
Benzaldehyde |
100-52-7 |
C7H6O |
|
|
57 |
Thủy ngân phenyl hydroxit |
Phenylmercuric hydroxide |
100-57-2 |
C6H6HgO |
|
|
58 |
N-Metyl anilin |
N-Methylaniline |
100-61-8 |
C7H9N |
|
|
59 |
Phenylhydrazin |
Phenylhydrazine |
100-63-0 |
C6H15N2 |
|
|
60 |
Anisol (metoxybenzen) |
Anisole (methoxybenzene) |
100-66-3 |
C7H8O |
|
|
61 |
Vinylpyridin |
2-Vinylpyridine |
100-69-6 1121-55-7 100-43-6 |
C2H5C5H4N |
|
|
62 |
Acrolein dime (2-Propenal dime) |
Acrolein dimer |
100-73-2 |
C6H8O2 |
|
|
63 |
Hexametylentetramin |
Hexamine |
100-97-0 |
(CH2)6N4 |
|
|
64 |
Chì nitrat |
Lead(II) nitrate |
10099-74-8 |
Pb(NO3)2 |
|
|
65 |
Axít silixic, muối chì |
Silicic acid, Lead |
10099-76-0 |
PbSi4O9 |
|
|
66 |
Natri pemanganat |
Sodium permanganate |
10101-50- |
NaMnO4 |
|
|
67 |
Natri selenit |
Sodium selenite |
10102-18-8 |
Na2SeO3 |
100 |
|
68 |
Nitơ monoxit |
Nitric oxide (Nitrogen oxide) |
10102-43-9 |
NO |
4540 |
|
69 |
Nitơ dioxit |
Nitrogen dioxide |
10102-44-0 |
NO2 |
|
|
70 |
Tali nitrat |
Thallium nitrate |
10102-45-1 |
TINO3 |
|
|
71 |
Sắt III asenat |
Ferric arsenate |
10102-49-5 |
FeAsO4 |
|
|
72 |
Sắt II asenat |
Ferrous arsenate |
10102-50-8 |
Fe3(AsO4)2 |
|
|
73 |
Axít Metaassenic |
Metaarssenic Acid |
10102-53-1 |
HAsO3 |
|
|
74 |
Magie asenat |
Magnesium arsenate |
10103-50-1 |
Mg3(AsO4)2 |
|
|
75 |
Natri dihydro asenat |
Sodium dihydrogen arsenate |
10103-60-3 |
NaH2AsO4 |
|
|
76 |
Muối đồng (I) asenat |
Copper dihydrogen arsenate |
10103-61-4 |
Cu(H2AsO4) |
|
|
77 |
Cadimi clorua |
Cadmium chloride |
10108-64-2 |
CdCl2 |
|
|
78 |
4,4- Metylen bis (2-cloanilin) và/hoặc muối của nó ở dạng bột |
4,4’- Methylenebis (2-chloroaniline) and/or salts, in powder form |
101-14-4 |
C13H12Cl2N2 |
10 |
|
79 |
Canxi pemanganat |
Calcium permanganate |
10118-76-0 |
Ca(MnO4)2 |
|
|
80 |
1-propen-2-clo-1,3-diol-diaxetat |
1-propen-2-chloro-1,3-diol-diacetate |
10118-77-6 |
C11H22O |
10 |
|
81 |
Canxi nitrat |
Calcium nitrate |
10124-37-5 |
Ca(NO3)2 |
|
|
82 |
Amoni thủy ngân clorua |
Mercury ammonium chloride |
10124-48-8 |
ClHgN H2 |
|
|
83 |
Kali arsonat |
Potassium arsorite |
10124-50-2 |
KAsO2 |
|
|
84 |
3-Cyclohexenyl triclo silan |
3-Cyclohexenyltrichlorosilane |
10137-69-6 |
C6H9 SiCl3 |
|
|
85 |
4,4’-Di amino di phenyl metan |
4,4’-Di amino di phenyl methane |
101-77-9 |
C13H14N2 |
|
|
86 |
Dicyclohexylamin |
Dicyclohexylamine |
101-83-7 |
C12H23N |
|
|
87 |
Thiocacbanilid |
Thiocarbanilide |
102-08-9 |
(C6H5NH)2CS |
|
|
88 |
3-Methyl-N-etyl aniline |
N-Ethyltoluidine |
102-27-2 |
C9H13N |
|
|
89 |
Molipđen pentacloua |
Molybdenum(V) chloride |
10241-05-1 |
Mo2Cl10 |
|
|
90 |
Methamitophotpho |
Methamidophospho |
10265-92-6 |
C2H8NO2PS |
|
|
91 |
Tripropylamin |
Tripropylamine |
102-69-2 |
(C3H6)3N |
|
|
92 |
Triallylamin |
Triallylamine |
102-70-5 |
(C3H2)3N |
|
|
93 |
Trietanolamin |
Trietanolamin |
102-71-6 |
(C2H5O)3N |
|
|
94 |
Dibutylaminoetanol |
Dibutylaminoethanol |
102-81-8 |
C6H15NO |
|
|
95 |
Tributylamin |
Tributylamine |
102-82-9 |
[CH3(CH2)3]3N |
|
|
96 |
Đồng (II) asenit |
Cupric Arsenite |
10290-12-7 |
Cu3(AsO3)2 |
|
|
97 |
Bo tribromua |
Boron bromide (Boron tribromide) |
10294-33-4 |
BBr3 |
|
|
98 |
Bo triclorua |
Boron trichloride (Borane, tricloro-) |
10294-34-5 |
BCl3 |
2270 |
|
99 |
Dialifos |
Dialifos |
10311-84-9 |
C14H17ClNO4 PS2 |
100 |
|
100 |
Magie clorat |
Magnesium chlorate |
10326-21-3 |
Mg(ClO3)2 |
|
|
101 |
Kẽm metaasenit |
Zinc Meta-Arsenite |
10326-24-6 |
Zn(HAsO2)2 |
|
|
102 |
Kẽm clorat |
Zinc chlorate |
10361-95-2 |
Zn(ClO3)2 |
|
|
103 |
n-Propybenzen |
N-Propyl benzene |
103-65-1 |
C9H12 |
|
|
104 |
N-Etylanilin |
N-Ethylaniline |
103-69-5 |
C6H5NH(C2H5) |
|
|
105 |
Phenyl isocyanat |
Phenyl isocyanate |
103-71-9 |
C6H5NCO |
|
|
106 |
Magiê nitrat |
Magnesium nitrate |
10377-60-3 |
Mg(NO3)2 |
|
|
107 |
Magan nitrat |
Manganese(II) nitrate |
10377-66-9 |
Mn(NO3)2 |
|
|
108 |
Phenylacetyl clorua |
Phenylacetyl chloride |
103-80-0 |
C8H7ClO |
|
|
109 |
Benzyldimetylamin |
Dimethylbenzylamine |
103-83-3 |
C9H13N |
|
|
110 |
Sắt (III) nitrat |
Iron(III)nitrate |
10421-48-4 |
Fe(NO3)3 |
|
|
111 |
Butylbenzen |
Buthyl benzene |
104-51-8 |
C10H14 |
|
|
112 |
2-Etylhexylamin |
2-Ethylhexylamine |
104-75-6 |
C8H19N |
|
|
113 |
2-Metyl-5-etylpyridin |
2-Methyl-5-ethylpyridine |
104-90-5 |
C8H11N |
|
|
114 |
p-Anisidin |
p-Anisidine (4-Methoxybenzenanime) |
104-94-9 |
C7H9NO |
|
|
115 |
1-Pentol |
1-Pentol |
105-29-3 |
C5H12O |
|
|
116 |
Etyl bromaxetat |
Ethyl bromoacetate |
105-36-2 |
C4H7BrO2 |
|
|
117 |
Etyl propionat |
Ethyl propionate |
105-37-3 |
C5H10O2 |
|
|
118 |
Dinitơ tetraoxit |
Dinitrogen tetroxide |
10544-72-6 |
N2O4 |
|
|
119 |
Lưu huỳnh diclorua |
Sulphur dichloride |
10545-99-0 |
SCl2 |
1000 |
|
120 |
Isopropyl cloaxetat |
Isopropyl chloroacetate |
105-48-6 |
C5H9 ClO2 |
|
|
121 |
Etyl butyrat |
Ethyl butyrate |
105-54-4 |
C6H12O2 |
|
|
122 |
Dietyl cacbonat (etyl cacbonat) |
Diethyl cacbonate (ethyl carbonate) |
105-58-8 |
C5H10O3 |
|
|
123 |
Metyldietanolamin |
Methyldiethanolamine |
105-59-9 |
C5H13 ON |
|
|
124 |
Dimetylcyclohexan |
Dimethylcyclohexane |
105-67-9 |
C8H16 |
|
|
125 |
Amyl butyrat |
Amyl Butyrate |
106-27-4 |
C9H18O2 |
|
|
126 |
Butyric anhydrit |
Butyric anhydride |
106-31-0 |
C8H17O2 |
|
|
127 |
P-Clo anilin |
Chloroaniline p- |
106-47-8 |
ClC6H6N |
|
|
128 |
Clo phenol |
1-Chlorophenol |
106-48-9 |
C6H5ClO |
|
|
129 |
p-Toluidin |
p-Toluidine |
106-49-0 |
C7H9N |
|
|
130 |
1,4-benzoquinon |
1,4-benzoquinone |
106-51-4 |
C6H4O2 |
|
|
131 |
Dietyl diclo silan |
Diethyldichlorosilane |
1719-53-5 |
C4H10Cl2Si |
|
|
132 |
Isobutyl acrylat |
Isobutyl acrylate |
106-63-8 |
C7H12O2 |
|
|
133 |
1,2-Butylen oxit |
1,2-Butylene oxide |
106-88-7 |
C4H8O |
|
|
134 |
Epiclo hydrin |
Epichlorohydrine (Oxirane, (chloromethyl)-) |
106-89-8 |
C3H5ClO |
9080 |
|
135 |
Allyl glycidyl ete |
Allyl glycidyl ether |
106-92-3 |
C6H10O2 |
|
|
136 |
1,2-dibromoetan |
1,2-dibromoethane (ethylene dibromide) |
106-93-4 |
C2H4Br2 |
50000 |
|
137 |
Brom propan |
1-Propyl bromide |
106-94-5 |
C3H7Br |
|
|
138 |
Allyl bromua |
Allyl bromide |
106-95-6 |
C3H5Br |
|
|
139 |
3-Bromopropyn (propargyl bromua) |
3-Bromopropyne (Propargyl bromide) |
106-96-7 |
C3H3Br |
|
|
140 |
Butan |
Butane |
106-97-8 |
C4H10 |
4540 |
|
141 |
Buten 1 |
1-Butene |
106-98-9 |
C4H8 |
4540 |
|
142 |
1,3-Butadien |
1,3-Butadiene |
106-99-0 |
C4H6 |
4540 |
|
143 |
Etyl axetylen |
Ethyl acetylene (1-Butyne) |
107-00-6 |
C4H6 |
4540 |
|
144 |
Buten 2 |
2-Butene |
107-01-7 |
C4H8 |
4540 |
|
145 |
Acrolein |
Acroleine (2-Propenal) |
107-02-8 |
C3H4O |
2270 |
|
146 |
Propanethiol (propyl mercaptan) |
Propanethiol |
79869-58-2 |
C3H8S |
|
|
147 |
Anlyl clorua |
Allyl chloride |
107-05-1 |
C3H5Cl |
|
|
148 |
1,2-Dicloruaetan |
1,2-Dichloroethane |
107-06-2 |
C2H4Cl2 |
|
|
149 |
Clo etanol |
Chloroethanol |
107-07-3 |
C2H5ClO |
|
|
150 |
Propylamin |
Propylamine |
107-10-8 |
C3H9N |
|
|
151 |
Allylamin |
Allylamine (2-Propen-1-amine) |
107-11-9 |
C3H7N |
4540 |
|
152 |
Propionitril |
Propionitrile (Propanenitrile) |
107-12-0 |
C3H5N |
4540 |
|
153 |
Acrylonitril |
Acrylonitrile |
107-13-1 |
C3H3N |
20000 |
|
154 |
Clo acetonitril |
Chloroacetonitrile |
107-14-2 |
C2H2ClN |
|
|
155 |
Etylenediamine |
Ethylenediamine (1,2-Ethanediamine) |
107-15-3 |
C2H8N2 |
9080 |
|
156 |
Hydroxyaxetonitril |
Hydroxyacetonitrile (glycolonitrile) |
107-16-4 |
C2H3NO |
100 |
|
157 |
Rượu Allyl |
Allyl alcohol (2-Propen-l-ol) |
107-18-6 |
C3H6O |
6810 |
|
158 |
Rượu propargyl |
Propargyl alcohol |
107-19-7 |
C3H4O |
|
|
159 |
Clo acetandehit |
2-Chlorocethanal |
107-20-0 |
C2H5ClO |
|
|
160 |
Vinyl metyl ete |
Vinyl methyl ether (Ethene, methoxy-) |
107-25-5 |
C3H6O |
4540 |
|
161 |
Acetaldehit oxim |
Acetaldehyde oxime |
107-29-9 |
CH3CH=NOH |
|
|
162 |
Clo metyl metyl ete |
Chloromethyl methyl ether |
107-30-2 |
C2H5ClO |
1 |
|
163 |
Metyl format |
Methyl formate (Formic acid, methyl ester) |
107-31-3 |
C2H4O2 |
4540 |
|
164 |
Axít Propylarsonic |
Propylarsonic Acid |
107-34-6 |
C3H9AsO3 |
|
|
165 |
Allyltriclo silan |
Allyl trichlorosilane |
107-37-9 |
C3H5 Cl3Si |
|
|
166 |
Diisobutyllen |
Diisobutylene |
107-39-1 |
C8H16 |
|
|
167 |
Tepp-tetraetyl pyroxyaxetat |
T.E.P.P.(Tetraethyl pyrophosphate) |
107-49-3 |
C8H20O7P2 |
100 |
|
168 |
Tert-butyl peroxyaxetat (>70%) |
Tert-butyl peroxyacetate (>70%) |
107-71-1 |
C6H12O3 |
5000 |
|
169 |
Amyltriclo silan |
Amyltrichlorosilane |
107-72-2 |
C5H11Cl3Si |
|
|
170 |
2-Bromopentan |
2-Bromopentane |
107-81-3 |
C5H11Br |
|
|
171 |
1-Bromo-3- metylbutan |
1-Bromo-3- methylbutane |
107-82-4 |
C5H11Br |
|
|
172 |
Metyl propyl keton |
2-Pentanone |
107-87-9 |
C5H10O |
|
|
173 |
Aldol |
3-Hydroxybutanal |
107-89-1 |
C4H8O2 |
|
|
174 |
Axit butyric |
Butyric acid |
107-92-6 |
C4H8O2 |
|
|
175 |
Axit crotonic |
Crotonic acid |
107-93-7 |
C4H6O2 |
|
|
176 |
1-Metoxy-2-propanol |
1-Methoxy-2-propanol |
107-98-2 |
C4H10O2 |
|
|
177 |
N,N-Dimetylaminoetanol và các muối proton hóa chất tương ứng |
N,N-Dimetylaminoethanol |
108-01-0 |
C4H11NO |
|
|
178 |
Nitropropan |
1-nitropropane, |
108-03-2 |
C3H7NO2 |
|
|
179 |
Vinyl acetat |
Vinyl acetate (ethenyl ester) |
108-05-4 |
C4H6O2 |
6810 |
|
180 |
1,3-Dimetylbutylamin |
1,3-Dimethylbutylamine |
108-09-8 |
C6H15N |
|
|
181 |
Metyl isobutyl keton |
Methyl isobutyl ketone |
108-10-1 |
C6H12O |
|
|
182 |
Metyl isobutyl carbinol |
Methyl isobutyl carbinol |
108-11-2 |
C6H14O |
|
|
183 |
Diisopropylamin |
Diisopropylamine |
108-18-9 |
C6H15N |
|
|
184 |
Diisopropyl ete |
Diisopropyl ether |
108-20-3 |
C6H14O |
|
|
185 |
Isopropyl axetat |
Isopropyl acetate |
108-21-4 |
C5H10O2 |
|
|
186 |
Isopropenyl axetat |
Isopropenyl acetate |
108-22-5 |
C5H8O2 |
|
|
187 |
1-metyletyl este |
Isopropyl chloroformate (Carbonochloridic acid, 1-methylethyl ester) |
108-23-6 |
C4H7ClO2 |
6810 |
|
188 |
Acetic anhydrit |
Acetic anhydride |
108-24-7 |
C4H6O3 |
|
|
189 |
Maleic anhydrit |
Maleic anhydride |
108-31-6 |
C4H2O3 |
|
|
190 |
Pyrazoxon |
Pyrazoxon |
108-34-9 |
C8H15N2O4P |
100 |
|
191 |
Clo anilin |
2-Chloroaniline |
95-51-2 |
C6H6ClN |
|
|
192 |
meta-Toluidin |
meta-Toluidine |
108-44-1 |
C7H9N |
|
|
193 |
Resorcinol |
Resorcinol |
108-46-3 |
C6H6O2 |
|
|
194 |
Metaldehit |
Metaldehyde |
108-62-3 |
C8H16O4 |
|
|
195 |
1,3,5- Trimetylbenzen |
1,3,5-Trimetylbenzene |
108-67-8 |
C9H12 |
|
|
196 |
Dimetyl-n-propylamin |
Dimethyl-N-propylamine |
108-68-9 |
C5H13N |
|
|
197 |
Xyanuric clorua |
Cyanuric chloride |
108-77-0 |
C3N3Cl3 |
|
|
198 |
Diisobutyl keton |
Diisobutyl ketone |
108-83-8 |
C9H17O |
|
|
199 |
Metylamyl axetat |
Methylamyl acetate |
108-84-9 |
C8H16O2 |
|
|
200 |
Bromuabenzen |
Bromobenzene |
108-86-1 |
C6H5Br |
|
|
201 |
Metylcyclohexan |
Methylcyclohexane |
108-87-2 |
C7H14 |
|
|
202 |
Toluen |
Toluene |
108-88-3 |
C7H8 |
|
|
203 |
4-Metyl pyritin |
4-Methylpyridine |
108-89-4 |
C6H7N |
|
|
204 |
Clo benzen |
Chlorobenzene |
108-90-7 |
C6H5Cl |
|
|
205 |
Cyclohexanamine |
Cyclohexylamine (Cyclohexanamine) |
108-91-8 |
C6H13N |
6810 |
|
206 |
Cyclohexanon |
Cyclohexanone |
108-91-1 |
C6H10O |
|
|
207 |
Phenol |
Phenol |
108-95-2 |
C6H6O |
|
|
208 |
Phenyl mercaptan |
Phenyl mercaptan (Thiophenol) |
108-98-5 |
C6H6S |
|
|
209 |
Vinyl etyl ete |
Vinyl ethyl ether |
109-92-2 |
C4H8O |
Trùng 231 |
|
210 |
2-Clo pyridin |
2-Chloropyridine |
109-09-1 |
C5H4ClN |
|
|
211 |
Tert-butyl peroxy isobutyrat (>80%) |
Tert-butyl peroxy isobutyrate (>80%) |
109-13-7 |
C8H16O3 |
5000 |
|
212 |
1-guanyl-4-nitrosaminoguanyl-1-tetrazen |
1-guanyl-4-nitrosaminoguanyl-1-tetrazene |
109-27-3 |
C2H8N10O |
10000 |
|
213 |
Vinyl isobutyl ete |
Vinyl isobutyl ether |
109-53-5 |
C6H12O |
|
|
214 |
Dietylaminopropylamin |
Diethylaminopropylamine |
109-55-7 |
C5H14N2 |
|
|
215 |
N-Propyl axetat |
Propyl acetate |
109-60-4 |
C5H10O2 |
|
|
216 |
Propyl clo format |
Propyl chloroformate (Carbonochloridic acid, propylester) |
109-61-5 |
C4H7ClO2 |
6810 |
|
217 |
Bo triflo dietyl etherat |
Boron trifluoride diethyl etherate |
109-63-7 |
C4H10BF3O |
|
|
218 |
Brom butan |
1-Bromobutane |
109-65-9 |
C4H9Br |
|
|
219 |
Pentan |
Pentane |
109-66-0 |
C5H12 |
4540 |
|
220 |
Penten 1 |
1-Pentene |
109-67-1 |
C5H10 |
4540 |
|
221 |
1-Brom-3-clo propan |
1-Chloro-3-bromopropane |
109-70-6 |
C3H6BrCl |
|
|
222 |
n-Butylamin |
n-Butylamine |
109-73-9 |
C4H11N |
|
|
223 |
Butyronitril |
Butyronitrile |
109-74-0 |
C4H7N |
|
|
224 |
Malononitril |
Malononitrile |
109-77-3 |
C3H2N2 |
|
|
225 |
Butyl mercaptan |
Butyl mercaptan (Butanethiol) |
109-79-5 |
C4H10S |
|
|
226 |
2-Methoxyetanol |
2-Methoxyethanol |
109-86-4 |
C3H8O2 |
|
|
227 |
Metylal |
Dimethoxymethane |
109-87-5 |
C3H8O2 |
|
|
228 |
Dietylamin |
Diethylamine |
109-89-7 |
C4H11N |
|
|
229 |
Vinyl etyl ete |
Vinyl ethyl ether (Ethene, ethoxy-) |
109-92-2 |
C4H8O |
4540 |
|
230 |
Divinyl etyl ete |
Vinyl ether |
109-93-3 |
C4H6O |
|
|
231 |
Etyl format |
Ethyl formate |
109-94-4 |
C3H6O2 |
|
|
232 |
Etyl nitrite |
Ethyl nitrite (Nitrous acid, ethyl ester) |
109-95-5 |
C2H5NO2 |
4540 |
|
233 |
Tetrahydrofuran |
Tetrahydrofuran |
109-99-9 |
C4H8O |
|
|
234 |
Furan |
Furan |
110-00-9 |
C4H4O |
2270 |
|
235 |
Tetrahydrothiophen (thiolan) |
Tetrahydrothiophene |
110-01-0 |
C4H8S |
|
|
236 |
Thiophen |
Thiophene |
110-02-1 |
C4H4S |
|
|
237 |
1,2-Di-(dimetylamino) etan |
1,2-Di-(dimethylamino)ethane |
110-18-9 |
C6H16N2 |
|
|
238 |
Isobutyl axetat |
Isobutyl acetate |
110-19-0 |
C6H12O2 |
|
|
239 |
N-Amyl metyl keton |
2-Heptanone |
110-43-0 |
C7H14O |
|
|
240 |
Amyl nitrit |
Amyl nitrite |
110-46-3 |
C5H11NO2 |
|
|
241 |
2-Methoxyethyl acetat |
2-Methoxyethyl acetate |
110-49-6 |
C5H10O3 |
|
|
242 |
Hexan |
Hexane |
110-54-3 |
C6H14 |
|
|
243 |
N-amylamin |
Pentylamine |
110-58-7 |
C5H13N |
|
|
244 |
Valeraldehit |
Pentanaldehyde (Valeraldehyde, Pentanal) |
110-62-3 |
C5H10O |
|
|
245 |
1,4-Butynediol |
1,4-Butynediol |
110-65-6 |
C4H6O2 |
|
|
246 |
Amyl mercaptan |
Amyl mercaptan |
110-66-7 |
C5H12S |
|
|
247 |
N-Metylbutylamin |
N-Methylbutylamine |
110-68-9 |
C5H13N |
|
|
248 |
Butyraldoxim |
Butyraldoxime |
110-69-0 |
C4H9NO |
|
|
249 |
Stibi kali tartrat |
Antimony potassium tartrate |
11071-15-1 |
K2Sb2C8H8O12 |
|
|
250 |
Etylen glycol dietyl ete |
Ethylene glycol dimethyl ether |
110-71-4 |
C4H10O2 |
|
|
251 |
Propyl format |
Propyl formate |
110-74-7 |
C4H8O2 |
|
|
252 |
N-Propyl isocyanat |
N-Propyl isocyanate |
110-78-1 |
C4H7NO |
|
|
253 |
2-Ethoxyetanol |
2-Ethoxyethanol (Ethylene glycol monoethyl ether) |
110-80-5 |
C4H10O2 |
|
|
254 |
Cyclohexan |
Cyclohexane |
110-82-7 |
C6H12 |
|
|
255 |
Cyclohexen |
Cyclohexene |
110-83-8 |
C6H10 |
|
|
256 |
Piperazin |
Piperazine |
110-85-0 |
C4H10N2 |
|
|
257 |
Pyridin |
Pyridine |
110-86-1 |
C5H5N |
|
|
258 |
2,3-Dihydropyran |
Dihydropyran |
110-87-2 |
C5H8O |
|
|
259 |
Piperidin |
Piperidine |
110-89-4 |
C5H11N |
6810 |
|
260 |
Morpholin |
Morpholine |
110-91-8 |
C4H9NO |
|
|
261 |
Diisobutylamin |
Diisobutylamine |
110-96-3 |
C8H19N |
|
|
262 |
Polychlorinated Biphenyls |
Polychlorinatede Biphenyls |
11097-69-1 |
C12H10-xClx |
|
|
263 |
Nitơ oxit |
Nitrogen oxide |
11104-93-1 |
NO |
50000 |
|
264 |
Hỗn hống natri - thủy ngân |
Sodium-mercury amalgam |
11110-52-4 |
|
|
|
265 |
2-Ethoxyethyl acetat |
2-Ethoxyethyl acetate |
111-15-9 |
C6H12O3 |
|
|
266 |
Hexanol |
Hexanol (Hexan-1-ol) |
111-27-3 |
C6H14O |
|
|
267 |
Butyl vinyl ete |
N-Butyl vinyl ether |
111-34-2 926-02-3 |
C6H12O |
|
|
268 |
N-Butyl isocyanat |
N-Butyl isocyanate |
111-36-4 |
C5H9NO |
|
|
269 |
Dietylentriamin |
Diethylenetriamine |
111-40-0 |
C4H13N3 |
|
|
270 |
Di-n-propyl ete |
Di-n-propyl ether |
111-43-3 |
C6H14O |
|
|
271 |
2,2-Diclo dietyl ete |
2,2'-Dichlorodiethyl ether |
111-44-4 |
C4H8C12O |
|
|
272 |
Thiodiglycol: Bis(2-hydroxyetyl) sulfit |
Bis(2-hydroxyetyl) sulfite |
111-48-8 |
C4H10O2S |
|
|
273 |
Hexametylenimin |
Hexamethyleneimine |
111-49-9 |
C6H13N |
|
|
274 |
Octan |
Octane |
111-65-9 |
C8H18 |
|
|
275 |
Adiponitril |
Adiponitrile |
111-69-3 |
C6H8N2 |
|
|
276 |
N-Heptanaldehit |
N-Heptanaldehyde (Heptanal) |
111-71-7 |
C7H14O |
|
|
277 |
Axit Acetic trimetystannyl ester |
Acetic acid,trimethylstannyl ester |
1118-14-5 |
C5H12 O2 Sn |
|
|
278 |
Nonan |
Nonane |
111-84-2 |
C9H20 |
|
|
279 |
Di-n-butylamin |
Dibutylamine |
111-92-2 |
C8H19N |
|
|
280 |
Undecan |
Undecane |
1120-21-4 |
C11H24 |
|
|
281 |
Octadecyl triclo silan |
Octadecyltrichorosilane |
112-04-9 |
C18H37 Cl3 Si |
|
|
282 |
1,3-propan sulton |
1,3-propanesultone |
1120-71-4 |
C3H6 O3 S |
1 |
|
283 |
Trietylentetramin |
Triethylenetetramine |
112-24-3 |
C6H18N4 |
|
|
284 |
Etylphenyldiclosilan |
Ethylphenyldichlorosilane |
1125-27-5 |
C8H10 C12 Si |
|
|
285 |
Tetraetylenpentamin |
Tetraethylenepentamine |
112-57-2 |
C8H23N5 |
|
|
286 |
N-Butylanilin |
N-Butylanilin |
1126-78-9 |
C10H15N |
|
|
287 |
Propoxur |
Propoxure (2-Isopropoxyphenyl methylcarbamate) |
114-26-1 |
C11H15NO3 |
|
|
288 |
Propylen |
Propylene (1-Propene) |
115-07-1 |
C3H6 |
4540 |
|
289 |
Dimetyl ete |
Methyl ether (Methane, oxybis-) |
115-10-6 |
C2H6O |
4540 |
|
290 |
2-Metyl propen |
2-Methylpropene (1-Propene, 2-methyl-) |
115-11-7 |
C4H8 |
4540 |
|
291 |
Etyl triclo silan |
Ethyltrichlorosilane |
115-21-9 |
C2H5Cl3Si |
|
|
292 |
Octaflo cyclobutan |
Octafluorocyclobutane |
115-25-3 |
C4F8 |
|
|
293 |
Dimefox |
Dimefoxe |
115-26-4 |
C4H12FN2OP |
100 |
|
294 |
Endosulfan (hỗn hợp đồng phân) |
Endosulfane (mixed isomers) |
115-29-7 |
C25H6O3S |
|
|
295 |
Pensulfothion |
Pensulfothion |
115-90-2 |
C11H17O4PS2 |
100 |
|
296 |
Tris(2-clo ethyl)phosphat |
Tris(2-chloroethyl)phosphate |
115-96-8 |
C6H12Cl3O4P |
|
|
297 |
Aldicarb |
Aldicarb |
116-06-3 |
C7H14N2O2S |
100 |
|
298 |
Tetraflo Etylen |
Tetrafluoroethylene (Ethene, tetrafluoro-) |
116-14-3 |
C2F4 |
4540 |
|
299 |
Hexaclo aceton |
Hexachloroacetone |
116-16-5 |
C3Cl6O |
|
|
300 |
Metyl diclo axetat |
Methyl dichloroacetate |
116-54-1 |
C3H4Cl2O2 |
|
|
301 |
Hexaclo benzen |
Hexachlorobenzene |
118-74-1 |
C6Cl6 |
|
|
302 |
Axit o-Toluic |
o-Toluic acid |
118-90-1 |
C8H8O2 |
|
|
303 |
2,4,6-trinitrotoluene |
2,4,6-trinitrotoluene |
118-96-7 |
C7H5N3O6 |
50000 |
|
304 |
Thủy ngân oleat |
Mercury oleate |
1191-80-6 |
C36H68O4Hg |
|
|
305 |
Nitrotoluidin (mono) |
Nitrotoluidine |
119-32-4 |
C7H8N2O2 |
|
|
306 |
o-Tolidin |
o-Tolidine |
119-93-7 |
C14H16N2 |
|
|
307 |
N- Etylbenzyltoluidin |
N-Ethylbenzyltoluidine |
119-94-8 |
C16H19N |
|
|
308 |
Amiăng (amphibol forms) |
Asbestos (amphibole forms) |
12001-28-4 |
|
|
|
309 |
Amiăng (crocidolit) |
Asbestos (crocidolite) |
12001-28-4 |
|
|
|
310 |
Amiăng (anthophyllit) |
Asbestos (anthophyllite) |
12001-29-5 |
|
|
|
311 |
Đồng acetoasenit |
copper(II) acetoarsenite (C.I.Pigment Green 21) |
12002-03-8 |
C2H3O4AsCu |
|
|
312 |
Thủy ngân nucleat |
Mercury nucleate |
12002-19-6 |
|
|
|
313 |
Canxi silic |
Calcium silicide |
12013-56-8 |
CaSi2 |
|
|
314 |
Sắt silicon |
Iron silicide |
12022-95-6 |
FeSi |
|
|
315 |
Liti peroxit |
Lithium peroxide |
12031-80-0 |
Li2O2 |
|
|
316 |
Photpho heptasulfua |
Phosphorus heptasulfide |
12037-82-0 |
P4S7 |
|
|
317 |
Asen (V) oxit |
Arsenic Pentoxide |
12044-50-7 |
As2O5 |
|
|
318 |
Magie phốtphua |
Magnesium phosphide |
12057-74-8 |
Mg3P2 |
|
|
319 |
Chì selenua |
Lead Selenide |
12069-00-0 |
PbSe |
|
|
320 |
2,4-Diclo phenol |
2,4-Dichlorophenol |
120-83-2 |
C6H4Cl2O |
|
|
321 |
Cyclopentanon |
Cyclopentanone |
120-93-3 |
C5H8O |
|
|
322 |
2,4-Dinitrotoluen |
2,4-Dinitrotoluene |
121-14-2 |
|
|
|
323 |
Axít 4-hydroxy-3- nitrophenyl Arsonic |
Arsonic-(4-hydroxy-3-nitrophenyl) Acid |
121-19-7 |
C6H6AsNO6 |
|
|
324 |
Amoni florua |
((1,1'-Biphenyl)-4-amine) Ammonium fluoride |
12125-01-8 |
NH4F |
|
|
325 |
Amon sulfua |
Ammonium sulfide |
12135-76-1 |
(NH4)2S |
|
|
326 |
Kali monoxit |
Potassium oxide |
12136-45-7 |
K2O |
|
|
327 |
Chì photphit Dibasic |
Dibasic Lead Phosphite |
12141-20-7 |
PbHPO32(PbO) |
|
|
328 |
Trimetyl borat |
Trimethyl borate |
121-43-7 |
C3H9BO3 |
|
|
329 |
Trietylamin |
Triethylamine |
121-44-8 |
C6H15N |
|
|
330 |
Trimetyl phosphit |
Trimethyl phosphite |
121-45-9 |
C3H9O3P |
|
|
331 |
2,5-Norbornadien (dicycloheptadien) |
2,5-Norbornadiene |
121-46-0 |
C7H8 |
|
|
332 |
3-Nitro-4-clo benzotriflorua |
3-Nitro-4-chlorobenzotrifluoride |
121-50-6 |
C7H5ClF3N |
|
|
333 |
n,n-Dimetyl anilin |
n,n-Dimethylaniline |
121-69-7 |
C8H11N |
|
|
334 |
Amiăng (chrysotil) |
Asbestos (chrysotile) |
12172-73-5 |
|
|
|
335 |
1-Clo-3-nitrobenzen |
1-Chloro-3-nitrobenzene |
121-73-3 |
C6H4ClNO2 |
|
|
336 |
Xyclotrimetylen trinitramin |
Cyclotrimethylene trinitramine |
121-82-4 |
C3H6N6O6 |
50000 |
|
337 |
Clo nitroanilin |
Chloronitroaniline |
121-87-9 |
C6H5ClN2O2 |
|
|
338 |
Fenitrothion |
Fenitrothion (O,O-Dimethyl O-4-nitro-m-tolyl phosphorothioate) |
122-14-5 |
C9H12NO5PS |
|
|
339 |
Diphenylamin |
Diphenylamine |
122-39-4 |
C12H11N |
|
|
340 |
Etyl orthoformat |
Ethyl orthoformate |
122-51-0 |
C7H16O3 |
|
|
341 |
Trietyl phosphit |
Triethy Phosphite |
122-52-1 |
C6H15O3P |
|
|
342 |
1,2-Diphenylhydrazin |
1,2-Diphenylhydrazine |
122-66-7 |
C12H12N2 |
|
|
343 |
Alpha-Metylvaleraldehit |
Alpha-Methylvaleraldehyde |
123-15-9 |
C6H12O |
|
|
344 |
Dipropyl keton |
Dipropyl ketone |
123-19-3 |
C7H14O |
|
|
345 |
Vinyl butyrat |
Vinyl butyrate |
123-20-6 |
C6H10O2 |
|
|
346 |
Hydroquinon |
Hydroquinone |
123-31-9 |
C6H6O2 |
|
|
347 |
Propionaldehit |
Propionaldehyde |
123-38-6 |
C3H6O |
|
|
348 |
Diaceton |
Diacetone alcohol |
123-42-2 |
C6H12O2 |
|
|
349 |
Pentan-2,4-dion |
Pentane-2,4-dione (Acetylacetone) |
123-54-6 |
C5H8O2 |
|
|
350 |
Propionic anhydrit |
Propionic anhydride |
123-62-6 |
C6H10O3 |
|
|
351 |
Paraldehit |
Paraldehyde |
123-63-7 |
C6H12O3 |
|
|
352 |
Butyraldehit |
Butyraldehyde |
123-72-8 |
C4H8O |
|
|
353 |
Butenal 2, (E)- |
Crotonaldehyde, (E)-(2-Butenal, (E)-) |
123-73-9 |
C4H6O |
9080 |
|
354 |
Pyrolidin |
Pyrrolidine |
123-75-1 |
C4H9N |
|
|
355 |
Butyl axetat |
n-Butyl acetate |
123-86-4 |
C6H12O2 |
|
|
356 |
1,4-Dioxan |
1,4-Dioxane |
123-91-1 |
C4H8O2 |
|
|
357 |
Diallylamin |
Diallylamine |
124-02-7 |
C6H11N |
|
|
358 |
Hexametylendiamin |
Hexamethylenediamine |
124-09-4 |
C6H16N2 |
|
|
359 |
Ocryl aldehit (etyl hexadehyd) |
Octanal |
124-13-0 |
C8H16O |
|
|
360 |
N-Decan |
N-Decane |
124-18-5 |
C10H22 |
|
|
361 |
Maned (công thức hóa học: C4H6MnN2S4) |
Maned (carbamodithioic acid, N,N'-1,2-ethanediylbis-manganese (2+) salt (1:1)) |
12427-38-2 |
C4H6MnN2S4 |
|
|
362 |
Dimetylamin |
Dimethylamine (Methanamine, N-methyl-) |
124-40-3 |
C2H7N |
4540 |
|
363 |
Natri Metylat |
Sodium methoxide |
124-41-4 |
CH3NaO |
|
|
364 |
Urea hydro peroxit |
Urea hydrogen peroxide |
124-43-6 |
CH6N2O3 |
|
|
365 |
Magiê flo silicat |
Magnesium fluorosilicate |
12449-55-7 |
MgSiF6 |
|
|
366 |
Axit metyl arsonic |
Methylarsonic acid |
124-58-3 |
CH5AsO3 |
|
|
367 |
Metansulphonyl clorid |
Methanesulfonyl chloride |
124-63-0 |
CH3ClO2S |
|
|
368 |
Axít Arsinic, dimetyl-, muối natri |
Arsinic dimethyl Acid Sodium Salt |
124-65-2 |
C2H7AsO2Na |
|
|
369 |
Chì cromat molybdat sulphat đỏ |
Lead chromate molybdate sulphate red |
12656-85-8 |
PbCrO4, PbMoO4, PbSO4 |
|
|
370 |
Tris (2,3 dibro propyl) phosphate |
Tris (2,3 dibromopropyl) phosphate |
126-72-7 |
C9H15Br6PO4 |
|
|
371 |
Demeton-s |
Demeton-s (O,O-Diethyl S-2- ethylthioethyl phosphorothioate) |
126-75-0 |
C8H19 O3PS2 |
|
|
372 |
Metacrylonitril |
Methacrylonitrile (2-Propenenitrile, 2-methyl-) |
126-98-7 |
C4H5N |
4540 |
|
373 |
Clo pren |
Chloroprene |
126-99-8 |
C4H5Cl |
|
|
374 |
Tetraclo Etene |
Etene, tetrachloro - |
127-18-4 |
C2Cl4 |
|
|
375 |
Axit nitrobenzensulphonic |
2-Nitrobenzenesulfonic acid |
127-68-4 |
C6H5NO5S |
|
|
376 |
Natri hydro 4-amino phenylarsona |
Natri hydro 4-amino phenylarsona |
127-85-5 |
C6H8AsNO3Na |
|
|
377 |
Axit Amyl phosphat |
Amyl acid phosphate |
12789-46-7 |
C5H13O4P |
|
|
378 |
Axit trinitrobenzoic |
Trinitrobenzoic acid |
129-66-8 |
C7H3N3O8 |
50000 |
|
379 |
Nhôm cacbon |
Aluminium carbide |
1299-86-1 |
C3Al4 |
|
|
380 |
Xylidin |
Xylidine |
1300-73-8 |
C8H11N |
|
|
381 |
Natri aluminat |
Sodium aluminate |
1302-42-7 |
AlO2Na |
|
|
382 |
Arsen pentoxit |
Arsenic pentoxide |
1303-28-2 |
As2O5 |
1000 |
|
383 |
Kẽm asenat |
Zinc Arsenate |
1303-39-5 |
Zn3(AsO4)2 |
|
|
384 |
Bari oxit |
Barium oxide |
1304-28-5 |
BaO |
|
|
385 |
Bari peroxit |
Barium peroxide |
1304-29-6 |
BaO2 |
|
|
386 |
Canxi peroxit |
Calcium peroxide |
1305-79-9 |
CaO2 |
|
|
387 |
Cadimi oxit |
Cadmium oxide |
1306-19-0 |
CdO |
|
|
388 |
Cadimi sulfua |
Cadmium sulfide |
1306-23-6 |
CdS |
|
|
389 |
Cadimi selenua |
Cadmium selenide |
1306-27-4 |
CdSe |
|
|
390 |
Cadimi tellurua |
Cadmium telluride |
1306-25-8 |
CdTe |
|
|
391 |
Chì dioxit |
Lead dioxide |
1309-60-0 |
PbO2 |
|
|
392 |
Kali hydroxit |
Potassium hydroxide |
1310-58-3 |
KOH |
|
|
393 |
Liti hydroxit |
Lithium hydroxide |
1310-65-2 |
LiOH |
|
|
394 |
Natri hydroxit |
Sodium hydroxide |
1310-73-2 |
NaOH |
|
|
395 |
Rubidi hydroxit |
Rubidium hydroxide |
1310-82-3 |
RbOH |
|
|
396 |
Xyhexatin; Plictran |
Xyhexatine; Plictrane |
13121-70-5 |
C18H34OSn |
|
|
397 |
Kali sulfua |
Potassium sulfide |
1312-73-8 |
K2S |
|
|
398 |
Natri monoxit |
Sodium oxide |
1313-59-3 |
Na2O |
|
|
399 |
Natri sulfua |
Sodium sulfide |
1313-82-2 |
Na2S |
|
|
400 |
Niken nitrat |
Nickel(II) nitrate |
13138-45-9 |
Ni(NO3)2 |
|
|
401 |
Stronti peroxit |
Strontium peroxide |
1314-18-7 |
SrO2 |
|
|
402 |
Kẽm peroxit |
Zinc peroxide |
1314-22-3 |
ZnO2 |
|
|
403 |
Phopho trioxit |
Phosphorus trioxide |
1314-24-5 |
P2O5 |
|
|
404 |
Tri chì tetraoxit |
Lead tetraoxide |
1314-41-6 |
Pb3O4 |
|
|
405 |
Photpho pentoxit |
Phosphorus pentoxide |
1314-56-3 |
P2O5 |
|
|
406 |
Vanadi pentoxit |
Anadium(V) oxide |
1314-62-1 |
V2O5 |
|
|
407 |
Photpho pentasulfua |
Phosphorus pentasulfide |
1314-80-3 |
P2S5 |
|
|
408 |
Kẽm phốtphua |
Zinc phosphide |
1314-84-7 |
Zn3P3 |
|
|
409 |
Photpho sesquisulfua |
Phosphorus sesquisulfide |
1314-85-8 |
P4S3 |
|
|
410 |
Phosphamidon |
Phosphamidon |
13171-21-6 |
C10H19ClNO5P |
100 |
|
411 |
Chì (II) oxit |
Lead(II) oxide |
1317-36-8 |
PbO |
|
|
412 |
Bis(2,4,6-trinitrophenyl)amin |
Bis(2,4,6-trinitrophenyl)amine |
131-73-7 |
C12H5N7O12 |
50000 |
|
413 |
Axit cresylic |
Cresylic acid |
1319-77-3 |
C7H8O |
|
|
414 |
PentaClo |
Pentachloronaphthalene |
1321-64-8 |
C10H3Cl5 |
|
|
415 |
Amiăng (amosit) |
Asbestos (amosite) |
132207-32-0 |
|
|
|
416 |
Thorin |
Thorine |
132-33-2 |
C16H13AsN2O10S2 |
|
|
417 |
Arsen trioxit |
Arsenic trioxide |
1327-53-3 |
As2O3 |
100 |
|
418 |
Tricresyl phosphat |
Tricresyl phosphate |
1330-78-5 |
C21H21O4P |
|
|
419 |
Metylcyclohexanon |
Methylcyclohexanone |
1331-22-2 583-60-8 591-24-2 589-92-4 |
C7H12O |
|
|
420 |
Asbestos |
Asbestos |
1331-21-4 |
NaOH |
|
|
421 |
Alpha-Metylbenzyl alcohol |
Alpha-Methylbenzyl alcohol |
13323-81-4 |
C8H10O |
|
|
422 |
Axit phenolsulphonic |
Phenolsulfonic acid |
1333-39-7 |
C6H6O4S |
|
|
423 |
Hydro |
Hydrogen |
1333-74-0 |
H2 |
5000 |
|
424 |
Crôm (VI) oxit |
Chromium (VI) oxide |
1333-82-0 |
CrO3 |
|
|
425 |
Natri hydrodiflorua |
Sodium hydrogendifluoride |
1333-83-1 |
NaHF2 |
|
|
426 |
Magiê peroxit |
Magnesium peroxide |
1335-26-8 |
MgO2 |
|
|
427 |
Thủy ngân oxycyanid |
Mercury oxycyanide |
1335-31-5 |
C2Hg2N2O |
|
|
428 |
Biphenyl đã polyclo hóa (PCBs) |
Polychlorinated Biphenyls (PCBs) |
1336-36-3 |
|
|
|
429 |
Metyl etyl keton peroxit (>60%) |
Methyl ethyl ketone peroxide (>60%) |
1338-23-4 |
C8H16O4 |
5000 |
|
430 |
Amon hydrodiflorua |
Ammonium hydrogendifluoride |
1341-49-7 |
NH4HF2 |
|
|
431 |
Didymium nitrat (Praseodymium (III) nitrat hexahydrat: Pr(NO3)3.6H2O) |
Didymium nitrate |
134191-62-1 |
|
|
|
432 |
Chì azit |
Lead azide |
13424-46-9 |
N6Pb |
50000 |
|
433 |
Alpha- naphtylamin |
1-Naphthylamine |
134-32-7 |
C10H9N |
|
|
434 |
Chì sulfocromat vàng |
Lead sulfochromate yellow |
1344-37-2 |
PbCrO4 |
|
|
435 |
Thủy ngân Sulfua |
Mercury sulfide |
1344-48-5 |
HgS |
|
|
436 |
Stronti perclorat |
Strontium perchlorate |
13450-97-0 |
Sr(ClO4)4 |
|
|
437 |
Scheele's green |
Scheele's green |
1345-20-6 |
|
|
|
438 |
Axít Pyroarsenic |
Pyroarsenic acid |
13453-15-1 |
H4As2O7 |
|
|
439 |
Tali clorat |
Thallium chlorate |
13453-30-0 |
TI(CIO4)2 |
|
|
440 |
Tali nitrat trihydrat |
Thallium nitrate trihydrate |
13453-38-8 |
TI(NO3)3.3H2O |
|
|
441 |
Niken tetracacbonyl |
Nickel tetracacbonyle |
13463-39-3 |
Ni(CO)4 |
1000 |
|
442 |
Sắt pentacacbonyl |
Iron, pentacarbonyl- (Iron carbonyl (Fe(CO)5), (TB-5-11)-) |
13463-40-6 |
Fe(CO)5 |
1135 |
|
443 |
Kẽm asenat |
Zinc arsenate |
13464-33-0 |
Zn3(AsO4)2 |
|
|
444 |
Axit Asen (III) và các muối |
Arsenios (III) acid and/or salts |
13464-35-2 |
HAsO2 |
100 |
|
445 |
Hydrazin nitrat |
Hydrazine nitrate |
13464-97-6 |
H5N3O3 |
50000 |
|
446 |
Clo silan |
Chlorosilane |
13465-78-6 |
ClH3 Si |
|
|
447 |
Bari perclorat |
Barium perchlorate |
13465-95-7 |
Ba(ClO4)2 |
|
|
448 |
Nhôm nitrat |
Aluminium nitrate |
13473-90-0 |
Al(NO3)3 |
|
|
449 |
Bari clorat |
Barium chlorate |
13477-00-4 |
Ba(ClO3)2 |
|
|
450 |
Bari arsenic |
Barium Arsenic |
13477-04-8 |
Ba3As2O8 |
|
|
451 |
Bari hypoclorit |
Barium hypochlorite |
13477-10-6 |
Ba(ClHO)2 |
|
|
452 |
Canxi perclorat |
Calcium perchlorate |
13477-36-6 |
Ca(ClO4)2 |
|
|
453 |
Đồng (II) asenat |
Tricopper diarsenate |
13478-34-7 |
Cu3(AsO4)2 |
|
|
454 |
Axít Arsenic, muối bạc (+1) muối |
Arsenic acid (H3AsO4), silver(1+) salt |
13510-44-6 |
Ag3AsO4 |
|
|
455 |
Kẽm cromat |
Zinc chromate |
13530-65-9 |
ZnCrO4 |
|
|
456 |
Axit flo photphoric |
Fluorophosphoric acid |
13537-32-1 |
H2PO3F |
|
|
457 |
Crom nitrat |
Chromium nitrate |
13548-38-4 |
Cr(NO3)3 |
|
|
458 |
Beri nitrat |
Beryllium nitrate |
13597-99-4 |
Be(NO3)2 |
|
|
459 |
Chì perclorat |
Lead perchlorate |
13637-76-8 |
Pb(ClO4)2 |
|
|
460 |
Deca - Các Polybrominated biphenlys (PBBs) |
Decabromodiphenyl |
13654-09-6 |
C12Br10 |
|
|
461 |
Kali đồng (I) xyanua |
Cuprous Potassium Cyanide |
13682-73-0 |
CuK(CN)2 |
|
|
462 |
Natri vanadat |
Sodium vanadate |
13718-26-8 |
NaVO3 |
|
|
463 |
Thiram |
Thiram |
137-26-8 |
C6H12N2S4 |
|
|
464 |
2-Etylbutanol |
2-Ethylbutanol |
137-32-6 |
C5H12O |
|
|
465 |
Ziriconi nitrat |
Zirconium nitrate |
13746-89-9 |
Zr(NO3)4 |
|
|
466 |
Selen trioxit |
Selenium trioxide |
13768-86-0 |
SeO3 |
|
|
467 |
Kali metavanadat |
Potassium metavanadate |
13769-43-2 |
KVO3 |
|
|
468 |
Natri nhôm hydrit |
Sodium aluminium hydride |
13770-96-2 |
NaAlH4 |
|
|
469 |
Axit diflorophotphoric |
Difluorophosphoric acid |
13779-41-4 |
F2H O2P |
|
|
470 |
Chì tetraflo borat |
Lead tetrafluoroborate |
13814-96-5 |
Pb(BF4)2 |
|
|
471 |
Thori nitrat |
Thorium nitrate |
13823-29-5 |
Th(NO3)4 |
|
|
472 |
Liti hypoclorua |
Lithium hypochlorite |
13840-33-0 |
LiClO |
|
|
473 |
Brom clorua |
Bromine monochloride |
13863-41-7 |
BrCl |
|
|
474 |
9- Phosphabicyclononan (cyclooctadin phosphin) |
9-Phosphabicyclonoane |
13886-99-2 |
C28H55P |
|
|
475 |
P-Nitrosodimetylanilin |
P-Nitrosodimethylaniline |
138-89-6 |
C8H10N2O |
|
|
476 |
Kali hexaxyanocobaltat (III) |
Potassium hexacyanocobaltate (III) |
13963-58-1 |
K3Co(CN)6 |
|
|
477 |
Kali vàng (+1) dixyanua |
Gold Potassium Dicyanide |
13967-50-5 |
KAu(CN)2 |
|
|
478 |
Bari bromic |
Barium bromate |
13967-90-3 |
Ba(BrO3)2 |
|
|
479 |
Tripropylen |
Tripropylene |
13987-01-4 |
C3H6 |
|
|
480 |
N-Etyldiethanolamin |
N-Ethyldiethanolamine |
139-87-7 |
C6H15NO2 |
|
|
481 |
2-Amino-5-dietylaminopentan |
2-Amino-5-diethylaminopentane |
140-80-7 |
|
|
|
482 |
Phenylacetonitril |
Benzyl cyanide |
140-29-4 |
C8H7N |
|
|
483 |
N-Aminoetylpiperazin |
N-Aminoethylpiperazine |
140-31-8 |
C6H15N3 |
|
|
484 |
Etyl acrylat |
Ethyl acrylate |
140-88-5 |
C5H8O2 |
|
|
485 |
Butyl acrylat |
Butyl acrylate |
141-32-2 |
C7H12O2 |
|
|
486 |
Etanolamin |
Ethanolamine |
141-43-5 |
C2H7NO |
|
|
487 |
Propyltriclo silan |
Propyltrichlorosilane |
141-57-1 |
C3H7 Cl3Si |
|
|
488 |
Dicrotophos |
Dicrotophos ((E)-2-Dimethylcarbamoyl-1-methylvinyl dimethyl phosphate) |
141-66-2 |
C8H16 NO5P |
|
|
489 |
Butyryl clorua |
Butyryl chloride |
141-75-3 |
C4H7ClO |
|
|
490 |
Etyl axetat |
Ethyl acetate |
141-78-6 |
C4H8O2 |
|
|
491 |
Mesityl oxit |
Mesityl oxide |
141-79-7 |
C6H10O |
|
|
492 |
Anilin hydroclorit |
Aniline hydrocloride (Benzenamine hydrochloride) |
142-04-1 |
C6H8 NCl |
|
|
493 |
Di kali niken tetraxyanit |
Dipotassium nickel tetracyanide |
14220-17-8 |
K2Ni(CN)4 |
|
|
494 |
Cyclopenten |
Cyclopentene |
142-29-0 |
C5H8 |
|
|
495 |
Etyl clo thioformat |
Ethyl chlorothioformate |
142-62-1 |
C6H12O2 |
|
|
496 |
Kali vàng (+3) tetracyanit |
Gold (+3) Potassium tetracyanide |
14263-59-3 |
KAu(CN)4 |
|
|
497 |
Natri đồng (I) xyanua |
Sodium Copper Cyanide |
14264-31-4 |
Na2Cu(CN)3 |
|
|
498 |
N-Hepten |
N-Heptane |
142-82-5 |
C7H16 |
|
|
499 |
Dipropylamin |
Dipropylamine |
142-84-7 |
C6H15N |
|
|
500 |
Kli dithionit |
Potassium dithionite |
14293-73-3 |
K2S2O4 |
|
|
501 |
Dibutyl ete |
Dibutyl ether |
142-96-1 |
C8H18O |
|
|
502 |
Natri xyanua |
Sodium cyanide |
143-33-9 |
NaCN |
|
|
503 |
Hypoclorua |
Hypochlorite |
14380-61-1 |
ClO |
|
|
504 |
Axit flo axetic |
Fruoroacetic acid |
144-49-0 |
C2H3FO2 |
1 |
|
505 |
Cadmium tetrafluoroborat |
Cadmium tetrafluoroborate |
|
Cd(BF4)2 |
|
|
506 |
Kẽm bromat |
Zinc bromate |
14519-07-4 |
Zn(BrO3)2 |
|
|
507 |
Magiê bromat |
Magnesium bromate |
14519-17-6 |
Mg(BrO3)2 |
|
|
508 |
Cuprietylendiamin |
Cupriethylenediamine |
14552-35-3 |
C4H18 CuN4O |
|
|
509 |
Dietyl peroxydicacbonat (>30%) |
Dietyl peroxydicarbonate (>30%) |
14666-78-5 |
C6H10O6 |
5000 |
|
510 |
Đồng dixyanua |
Copper Dicyanide |
14763-77-0 |
Cu(CN)2 |
|
|
511 |
Thiabendazol |
Thiabendazole |
148-79-8 |
C10H7N3S |
|
|
512 |
Coban xyanua |
Coban Cyanide |
14965-99-2 |
Co(CN)3 |
|
|
513 |
Metylphenyldiclo silan |
Methylphenyldichlorosilane |
149-74-6 |
C7H8Cl2Si |
|
|
514 |
Crom oxyclorua |
Chromyl chloride |
14977-61-8 |
CrCl2O2 |
|
|
515 |
Etyl borat |
Triethyl borate |
150-46-9 |
C6H15 BO3 |
|
|
516 |
Natri metaarsonat |
Sodium Metaarsonate |
15120-17-9 |
Na2HAsO3 |
|
|
517 |
Kali xyanua |
Possium Cyanide |
151-50-8 |
KCN |
|
|
518 |
Etylenimin |
Ethyleneimine |
151-56-4 |
C2H5N |
10000 |
|
519 |
4-(clo formyl) morpholin |
4-(chloroformyl) morpholine |
15159-40-7 |
C5H8ClNO2 |
1 |
|
520 |
(3-Clo phenyl)acetonitril |
(3-Chlorophenyl)acetonitrile |
1529-41-5 |
C8H6ClNs |
|
|
521 |
Canxi dithionit |
Calcium dithionite |
15512-36-4 |
CaS2O4 |
|
|
522 |
Cacbofuran |
Carbofuran |
1563-66-2 |
C12H15NO3 |
100 |
|
523 |
Phenetidin |
Phenetidine |
156-43-4 |
C8H11NO |
|
|
524 |
Trimetylhexametylen diisocyanat |
Trimethylhexamethylene diisocyanate |
28679-16-5 |
C11H18N2O2 |
|
|
525 |
Canxi xyanin |
Calcium cyanamide |
156-62-7 |
Ca(CN)2 |
|
|
526 |
Cyclohexyl mercaptan |
Cyclohexyl mercaptan |
1569-69-3 |
C6H12 S |
|
|
527 |
Trimetylcyclohexylamin |
3,3,5-Trimethylcyclohexylamine |
15901-42-5 |
C9H19 N |
|
|
528 |
Thủy ngân axetat |
Mercuric acetate Thủy ngân |
1600-27-7 |
Hg(O2C2H3)2 |
|
|
529 |
Di-n-propyl peroxydicacbonat (>80%) |
Di-n-propyl peroxydicarbonate (>80%) |
16066-38-9 |
C8H14 O6 |
5000 |
|
530 |
Tert-butyl isocyanat |
Tert-Butyl isocyanate |
1609-86-5 |
C5H9NO |
|
|
531 |
Quinuclidin-3-ol |
Quinuclidin-3-ol |
1619-34-7 |
C7H13NO |
|
|
532 |
Axit Butyl phosphat |
Butyl acid phosphate |
1623-15-0 |
C4H11 O4P |
|
|
533 |
5-Metylhexan-2-on |
5-Methylhexan-2-one |
163038-04-8 |
C7H14 O2 |
|
|
534 |
Metyl tert-butyl ete |
Methyl tert-butyl ether |
1634-04-4 |
C5H12O |
|
|
535 |
Natri hydrosulfua |
Sodium hydrosulfide |
16721-80-5 |
NaHS |
|
|
536 |
Methomyl |
Methomyl |
16752-77-5 |
C5H10N2O2S |
|
|
537 |
Kẽm florosilicat |
Zinc fluorosilicate |
16871-71-9 |
ZnSiF6 |
|
|
538 |
Kali hexafluorosilicat |
Potassium hexafluorosilicate |
16871-90-2 |
K2SiF6 |
|
|
539 |
Axit floroboric |
Fluoroboric acid |
16872-11-0 |
HBF4 |
|
|
540 |
Natri hexafluorosilicat |
Sodium hexafluorosilicate |
16893-85-9 |
Na2(SiF6) |
|
|
541 |
Kali hexaclo platinat (IV) |
Potassium hexachloroplatinate (IV) |
16921-30-5 |
K2PtCl6 |
|
|
542 |
Triallyl borat |
Triallyl borate |
1693-71-6 |
C9H15 BO3 |
|
|
543 |
Axit hexaflo photphoric |
Hexafluorophosphoric acid |
16940-81-1 |
HPF6 |
|
|
544 |
Axit clo platinic |
Chloroplatinic acid |
16941-12-1 |
H2PtCl6 |
|
|
545 |
Axit flo silicic |
Hexafluorosilicic acid |
16961-83-4 |
H2SiF6 |
|
|
546 |
Nhôm bo hydrit |
Aluminium borohydride |
16962-07-5 |
Al[BH4]3 |
|
|
547 |
Clopyralit |
Clopyralid |
1702-17-6 |
C6H3Cl2NO2 |
|
|
548 |
Kali hexafluoroarsenat(V) |
Potassium hexafluoroarsenate (V) |
17029-22-0 |
KAsF6 |
|
|
549 |
Isopropyl nitrat |
Isopropyl nitrate |
1712-64-7 |
C3H7NO3 |
|
|
550 |
2,3,7,8-tetraclo dibenzo-p-dioxin |
2,3,7,8-tetrachlorodibenzo-p-dioxin |
1746-01-6 |
C12H4 C14O2 |
1 |
|
551 |
Thiourea dioxit |
Thiourea dioxide |
1758-73-2 |
CH4N2O2S |
|
|
552 |
Metyl 2-clo propionat |
Methyl 2-chloropropionate |
17639-93-9 |
C4H7 ClO2 |
|
|
553 |
Niken nitrit |
Nickel nitrite |
17861-62-0 |
Ni(NO2)2 |
|
|
554 |
Etyl diclo silan |
Ethyldichlorosilane |
1789-58-8 |
C2H6 Cl2 Si |
|
|
555 |
Isopropyl isocyanat |
Isopropyl isocyanate |
1795-48-8 |
C4H7 NO |
|
|
556 |
Hydrodiflorua |
Bifluoride |
18130-74-0 |
HF2 |
|
|
557 |
Nitrofen |
Nitrofen (2,4-Dichloro-1-(4-nitrophenoxy) benzene) |
1836-75-5 |
C12H7Cl2NO3 |
|
|
558 |
Allyl format |
Allyl formate |
1838-59-1 |
C4H6 O2 |
|
|
559 |
Dibenzyldiclo silan |
Dibenzyldichlorosilane |
18414-36-3 |
C14H14 Cl2Si |
|
|
560 |
Isobutyl isocyanat |
Isobutyl isocyanate |
1873-29-6 |
C5H9 NO |
|
|
561 |
Bari azit |
Barium azide |
18810-58-7 |
BaN6 |
50000 |
|
562 |
Thori carbonat |
Thorium carbonate |
19024-62-5 |
Th(VO3)4 |
|
|
563 |
Acetoxytrietyl Stannane |
Acetoxytrietyl Stannane |
1907-13-7 |
C8H18 O2 Sn |
|
|
564 |
Paraquat |
Paraquate |
1910-42-5 |
C12H14Cl2N2 |
|
|
565 |
3-Clo propanol-1 |
3-Chloropropan-1-ol |
19210-21-0 |
C3H7CIO |
|
|
566 |
Diboran |
Diborane |
19287-45-7 |
B2H6 |
1135 |
|
567 |
Tert-butylperoxy maleat (>80%) |
Tert-butylperoxy maleate (>80%) |
1931-62-0 |
C8H12O5 |
5000 |
|
568 |
1,2,3,7,8,9-hexaclo dibenzo-p-dioxin |
1,2,3,7,8,9-hexachlorodibenzo-p-dioxin |
19408-74-3 |
C12H2 Cl6 O2 |
100 |
|
569 |
Pentaboran |
Pentaborane |
19624-22-7 |
B5H9 |
1000 |
|
570 |
4- Metoxy-4-metylpentan-2-on |
4-Methoxy-4-methylpentan-2-one |
19872-52-7 |
C6H12O5 |
|
|
571 |
Di-sec-butyl peroxydicarbonat (>80%) |
Di-sec-butyl peroxydicarbonate (>80%) |
19910-65-7 |
C10H18O6 |
5000 |
|
572 |
1,2,3,4-Tetraclo naphtalen |
1,2,3,4-Tetrachloronaphthalene |
20020-02-4 |
C10H4 Cl4 |
|
|
573 |
2,2',4,4',6,6'-hexanitrostilbene |
2,2',4,4',6,6'-hexanitrostilbene |
20062-22-0 |
C14H6N6O12 |
50000 |
|
574 |
Clo toluidin |
3-chloro-p-toluidine |
95-74-9 |
C7H8ClN |
|
|
575 |
Aminocarb |
Aminocarb (4-Dimethylamino-m-toIyl N- methylcarbamate) |
2032-59-9 |
C11H16N2O2 |
|
|
576 |
Axit 2- Aminophenylarsonic |
2- Aminophenylarsonic acid |
2045-00-3 |
C6H8AsNO3 |
|
|
577 |
Di-n-amylamin |
Di-n-amylamine |
2050-92-2 |
C10H23N |
|
|
578 |
Bo triflorrua |
Boron trifluoride (Borane, trifluoro-) |
20654-88-0 |
BF3 |
2270 |
|
579 |
Natri hydrosulfua ngậm nước trên 25% nước |
Sodium hydrosulfide |
207683-19-0 |
NaSH |
|
|
580 |
Osmium tetroxit |
Osmium tetroxide |
20816-12-0 |
OsO4 |
|
|
581 |
Nhôm phốtphua |
Aluminium phosphide (AlP) |
20859-73-8 |
AlP |
|
|
582 |
EPN |
Epn (Phosphonothioic acid,P-phenyl-, O-ethyl O-(4-nitrophenyl) ester) |
2104-64-5 |
C14H14 NO4PS |
100 |
|
583 |
Kali asenat |
Potassium Arsenate |
21093-83-4 |
K3AsO4 |
|
|
584 |
Cesium hydroxit |
Caesium hydroxide |
21351-79-1 |
Cs(OH) |
|
|
585 |
Dibenzyl peroxydicacbonat (>90%) |
Dibenzyl peroxydicarbonate (>90%) |
2144-45-8 |
C16H14 O6 |
5000 |
|
586 |
Bạc Asenat |
Silver Arsenate |
13510-44-6 |
Ag3AsO4 |
|
|
587 |
2.2-Bis(tert-butylperoxy) butan (>70%) |
2.2-Bis(tert-butylperoxy) butane (>70%) |
2167-23-9 |
C12H26O4 |
5000 |
|
588 |
Chrysen |
Chrysen (1,2-benzophenanthrene) |
218-01-9 |
C18H12 |
|
|
589 |
Thủy ngân oxit |
Mercuric oxide |
21908-53-2 |
HgO |
|
|
590 |
Clo metyl clo format |
Chloromethyl chloroformate |
22128-62-7 |
C2H2 Cl2O2 |
|
|
591 |
3.3.6.6.9.9-Hexamety-1.2.4.5- tetroxacyclononat (>75%) |
3.3.6.6.9.9-Hexamethyl-1.2.4.5-tetroxacyclononate (>75%) |
22397-33-7 |
C11H22O4 |
5000 |
|
592 |
Magiê silic |
Magnesium silicide |
22831-39-6 |
Mg2Si |
|
|
593 |
Isocyanatobenzotriflo |
Isocyanatobenzotrifluoride |
2285-12-3 |
C8H4 F3NO |
|
|
594 |
Phosalon |
Phosalone |
2310-17-0 |
C12H15CINO4 PS2 |
|
|
595 |
Kẽm permanganat |
Zinc permanganate |
23414-72-4 |
Zn(MnO4)2 |
|
|
596 |
Kali arsenit |
Potassium arsenite |
236-680-2 |
|
|
|
597 |
Tert-butylperoxy isopropylcacbonat (>80%) |
Tert-butylperoxy isopropylcarbonate (>80%) |
2372-21-6 |
C8H16 O4 |
5000 |
|
598 |
Kali flo axetat |
Potassium fluoroacetate |
23745-86-0 |
C2H3FO2.K |
|
|
599 |
Dodecaclo pentaxyclodecan |
Dodecachloropentaxyclodecane |
2385-85-5 |
C10Cl12 |
|
|
600 |
Captafol |
Captafol (N-(1,1,2,2-Tetrachloroethylthio)cyclohex-4-ene-1,2-dicarboximide) |
2425-06-1 |
C10H9 Cl4NO2S |
|
|
601 |
Triclo buten |
Trichlorobutene |
2431-50-7 |
C4H5 Cl3 |
|
|
602 |
2-Dimetylaminoetyl acrylat |
2-Dimethylaminoethyl acrylate |
2439-35-2 |
C7H13 NO2 |
|
|
603 |
2-Etylhexyl clo format |
2-Ethylhexyl chloroformate |
24468-13-1 |
C9H17 ClO2 |
|
|
604 |
Oxydisulfoton |
Oxydisulfotone |
2497-07-6 |
C8H19 O3PS3 |
100 |
|
605 |
Vinyltoluen |
Vinyltoluene |
25013-15-4 |
C9H10 |
|
|
606 |
1,2-Dibromobutan-3-on |
1,2-Dibromobutan-3-one |
25109-57-3 |
C4H6 Br2O |
|
|
607 |
Dimetyldioxan |
Dimethyldioxane |
25136-55-4 |
C6H12 O2 |
|
|
608 |
Buten |
Butene |
25167-67-3 |
C4H8 |
4540 |
|
609 |
Dimetyl thiophotphorylclo |
Dimethyl thiophosphoryl chloride |
2524-03-0 |
C2H6 ClO2PS |
|
|
610 |
Dietylthiophotphoryl clo |
Diethylthiophosphoryl chloride |
2524-04-1 |
C4H10ClO2PS |
|
|
611 |
Dinitrotoluene (hỗn hợp đồng phân) |
Dinitrotoluene (mixed isomers) |
25321-14-6 |
C7H6 N2O4 |
|
|
612 |
Dietylbezen |
Diethylbenzene |
25340-17-4 |
C10H14 |
|
|
613 |
Vinyl clo axetat |
Vinyl chloroacetate |
2549-51-1 |
C4H5ClO2 |
|
|
614 |
Lưu huỳnh hexaflorua |
Sulfur hexafluoride |
2551-62-4 |
SF6 |
|
|
615 |
Clo nitro toluen |
Chloronitrotoluene |
25567-68-4 |
C7H6ClNO2 |
|
|
616 |
Trimetylhexametylendiamin |
Trimethylhexamethylenediamines |
25620-58-0 |
C9H22N2 |
|
|
617 |
Metylcyclohexanol |
Methylcyclohexanol |
25639-42-3 |
C7H14O |
|
|
618 |
oo-dietyl s-etylsulphinylmetyl photphorothioat |
oo-diethyl s-ethylsulphinylmethyl phosphorothioate |
2588-05-8 |
C7H17O4PS2 |
100 |
|
619 |
oo-dietyl s-etylsulphonylmet photphorothioat |
oo-diethyl s-ethylsulphonylmethyl phosphorothioate |
2588-06-9 |
C7H17O5PS2 |
100 |
|
620 |
oo-dietyl s-etylthiometyl photphorothioat |
oo-diethyl s-ethylthiomethyl phosphorothioate |
2600-69-3 |
C7H17 O3PS2 |
100 |
|
621 |
Acridin |
Acridine |
260-94-6 |
C13H9N |
|
|
622 |
2.2 Dihydroperoxypropan (>30%) |
2.2 Dihydroperoxypropane (>30%) |
2614-76-8 |
C3H8O4 |
5000 |
|
623 |
Tirpate (2,4-dimetyl-1,3-dithiolan-2-cacboxaldehydeo-metylcacbamoyloxim) |
Tirpate(2,4-dimethyl-1,3-dithiolane- 2-carboxaldehydeo-methylcarbamoyloxime) |
26419-73-8 |
C8H14N2O2S2 |
100 |
|
624 |
Azinphos-etyl |
Azinphos-ethyl |
2642-71-9 |
C12H16N3O3PS2 |
100 |
|
625 |
Đồng clorat |
Copper chlorate |
26506-47-8 |
Cu(ClO3)2 |
|
|
626 |
Natri azid |
Sodium azide |
26628-22-8 |
NaN3 |
|
|
627 |
Xyclotetrametyle netetranitramine |
Cyclotetramethylenetetranitramine |
2691-41-0 |
C4H8 N8O8 |
50000 |
|
628 |
Sulphuryl florua |
Sulfuryl fluoride |
2699-79-8 |
SF2O2 |
|
|
629 |
Diclo phenyltriclo silan |
Dichlorophenyltrichlorosilane |
27137-85-5 |
C6H3 Cl5Si |
|
|
630 |
Canxi asenit |
Calcium arsenite |
27152-57-4 |
Ca3 (AsO3)2 |
|
|
631 |
Axit Diisooctyl phosphat |
Diisooctyl acid phosphate |
27215-10-7 |
C16H35 O4P |
|
|
632 |
Vanadyl sulphat |
Vanadyl sulfate |
27774-13-6 |
VO(SO4) |
|
|
633 |
Axit diclo isocyanuric |
Dichloroisocyanuric acid |
2782-57-2 |
C3H Cl2 N3 O3 |
|
|
634 |
Octa- Các Polybrominated biphenyls (PBBs) |
|
27858-07-7 |
C12H2Br8 |
|
|
635 |
Clo trinitrobenzen |
Chlorotrinitrobenzene |
28260-61-9 |
C6H2 CI N3 O6 |
50000 |
|
636 |
1,2,3,6-Tetrahydro-1-metyl-4-phenylpyritin |
1,2,3,6-Tetrahydro-1-methyl-4-phenylpyridine |
28289-54-5 |
C12H15N |
|
|
637 |
3-Clo-4-metylphenyl isocyanat |
3-Chloro-4-methylphenyl isocyanate |
28479-22-3 |
C8H6ClNO |
|
|
638 |
Isophorondiamin |
Isophoronediamine |
2855-13-2 |
C10H22N2 |
|
|
639 |
2-Dimetylaminoety 1 metacrylat |
2-Dimethylaminoethyl methacrylate |
2867-47-2 |
C8H15NO2 |
|
|
640 |
Cyclopentan |
Cyclopentane |
287-92-3 |
C5H10 |
|
|
641 |
Trinitrocresol |
Trinitrocresol |
28905-71-7 |
C7H5 N3 O7 |
50000 |
|
642 |
Stibi asenat |
Antimony asenate |
28980-47-4 |
SbAsO4 |
|
|
643 |
Cycloheptan |
Cycloheptane |
291-64-5 |
C7H14 |
|
|
644 |
Clorpyrifos |
Chlorpyrifos (O,O-Dicthyl O-3,5,6-trichloro-2-pyridyl phosphorothioate) |
2921-88-2 |
C9H11CI3NO3 PS |
|
|
645 |
Allyl clo fomat |
Allyl chloroformate |
2937-50-0 |
C4H5ClO2 |
|
|
646 |
Trinitroanilin |
Trinitroaniline |
29652-42-1 |
C6H4N4 O6 |
50000 |
|
647 |
Isobenzan |
Isobenzane |
297-78-9 |
C9H4CI8O |
100 |
|
648 |
Nicotin salicylat |
Nicotine salicylate |
29790-52-1 |
C7H6O3 |
|
|
649 |
Thionazin |
thionazine |
297-97-2 |
C8H13N2O3PS |
100 |
|
650 |
Parathion-metyl |
Parathion-methyl |
298-00-0 |
C8H10N O5PS |
100 |
|
651 |
Phorat |
Phorate |
298-02-2 |
C7H17 O2PS3 |
100 |
|
652 |
Demeton -O |
O-Demetone |
298-03-3 |
C8H19 O3PS2 |
|
|
653 |
Disulfoton |
Disulfotone |
298-04-4 |
C8H19 O2PS3 |
100 |
|
654 |
Crufomat |
Crufomate (4-tert-ButyI-2-chlorophenyl methylmethylphosphoramidate) |
299-86-5 |
C12H19ClNO3P |
|
|
655 |
1.1-Bis(tert-butylperoxy) xyclohexan (>80%) |
1.1-Bis(tert-butylperoxy) xyclohexane (>80%) |
3006-86-8 |
C14H28 O4 |
5000 |
|
656 |
Chì axetat |
Lead acetate |
301-04-2 |
Pb(O2C2H3)2 |
|
|
657 |
Hydrazin |
Hydrazine |
302-01-2 |
N2H4 |
6810 |
|
658 |
Clo ral hydrat |
Chloral hydrate |
302-17-0 |
C2H3Cl3O2 |
|
|
659 |
Clo rambucil |
Chlorambucil |
305-03-3 |
C14H19 CI2NO2 |
|
|
660 |
Paraformaldehit |
Paraformaldehyde |
30525-89-4 |
(CH2O)n |
|
|
661 |
3,3-Dietoxypropen |
3,3 -Diethoxypropene |
3054-95-3 |
C7H14O2 |
|
|
662 |
1,3,5-triamino-2,4,6-trinitrobenzen |
1,3,5-triamino-2,4,6-trinitrobenzene |
3058-38-6 |
C6H6 N6O6 |
50000 |
|
663 |
Tetrapropyl orthotitanat |
Tetrapropylorthotitanate |
3087-37-4 |
C12H28O4Ti |
|
|
664 |
Aldrin |
Aldrin (1,2,3,4,10,10- Hexachloro-1,4,4a,5,8,8a-hexahydro,endo,exo-1,4:5.8-dimethanonaphthalene) |
309-00-2 |
C12H8 Cl6 |
|
|
665 |
Tri butyl (lauroyloxy) stannan |
Tributyltin laurate |
3090-36-6 |
C24H50 O2Sn |
|
|
666 |
Paraoxon (dietyl 4-nitrophenylphosphate) |
Paraoxon (diethyl 4-nitrophenylphosphate) |
311-45-5 |
C10H14NO6P |
100 |
|
667 |
Epibrom hydrin |
Epibromohydrin |
3132-64-7 |
C3H5BrO |
|
|
668 |
Cyclohexyl isocyanat |
Cyclohexyl isocyanate |
3173-53-3 |
C7H11NO |
|
|
669 |
Clo metyl etyl ete |
Chloromethyl ethyl ether |
3188-13-4 |
C3H7CIO |
|
|
670 |
Alpha-hexaclo cyclohexan |
Alpha-hexachlorocyclohexane |
319-84-6 |
C6H6Cl6 |
|
|
671 |
Beta-hexaclo cyclohexan |
Beta-hexachlorocyclohexane |
319-85-7 |
C6H6 CI6 |
|
|
672 |
4-Thiapentanal |
4-Thiapentanal |
3268-49-3 |
C4H8OS |
|
|
673 |
Trimety clo lacetyl |
Trimethylacetyl chloride |
3282-30-2 |
C5H9CIO |
|
|
674 |
oo-dietyl s-propylthiometyl photphorodithioat |
oo-diethyl s-propylthiomethyl phosphorodithioate |
3309-68-0 |
C8H19O2PS3 |
100 |
|
675 |
Diazinon |
Diazinon |
333-41-5 |
C12H21N2O3PS |
|
|
676 |
Diazometan |
Diazomethane |
334-88-3 |
CH2N2 |
|
|
677 |
Polychlo dibenzofurans và polychlo dibenzodioxins |
Polychlorodibenzo-furans and polychlorodibenzo-dioxins |
33857-26-0 |
C12H6C12O2 |
0 |
|
678 |
Di-isobutyryl peroxit (>50%) |
Di-isobutyryl peroxide (>50%) |
3437-84-1 |
C8H14 O4 |
5000 |
|
679 |
Floroanilin |
Fluoroaniline |
348-54-9 |
C6H6FN |
|
|
680 |
Phenylphotpho thio diclo |
Phenylphosphorus Thiodichloride |
3497-00-5 |
C6H5Cl2PS |
|
|
681 |
Dietyl sulfua |
Diethyl sulfide |
352-93-2 |
C4H10 S |
|
|
682 |
Hỗn hợp Bo triflo và metyl ete (1:1) |
Boron trifluoride compound with methyl ether (1:1) (Boron, trifluoro (oxybis (metane))-, T-4- |
353-42-4 |
C2H6BF3O |
6810 |
|
683 |
Cacbonyl florua |
Carbonyl fluoride |
353-50-4 |
CF2O |
|
|
684 |
Clo diflo brom metan |
Bromochlorodifluoromethane |
353-59-3 |
CBrCl F2 |
|
|
685 |
Triflo clo acetyl |
Trifluoroacetyl chloride |
354-32-5 |
C2ClF3O |
|
|
686 |
Hexa- Các Polybrominated biphenyls (PBBs) |
Hexa- Polybrominated biphenyls (PBBs) |
36355-01-8 |
C12H4 Br6 |
|
|
687 |
Stibi lactat |
Antimony lactate |
3643-76-3 |
Sb(C2H4O2)3 |
|
|
688 |
4-Metylmorpholin |
4-Methylmorpholine |
3651-67-0 |
C5H12NOCl |
|
|
689 |
Tri chì diarsenat |
Lead diarsenate |
3687-31-8 |
Pb3(AsO4)2 |
|
|
690 |
Sulfotepp |
Sulfoteppe |
3689-24-5 |
C8H20O5P2S2 |
100 |
|
691 |
4,4’-Diaminodiphenyl metan |
4,4’-Diaminodiphenyl methane |
83712-44-1 |
C13H14N2 |
|
|
692 |
Metyl isobutyl keton peroxit (nồng độ > 60%) |
Methyl isobutyl ketone peroxide (> 60%) |
37206-20-5 |
C12H26O4 |
50000 |
|
693 |
Xyanthoat |
Cyanthoate |
3734-95-0 |
C10H19N2O4PS |
100 |
|
694 |
(O,O-Dimethyl-O-(4-methylthio-m-tolyl) photphorothioat) |
(O,O-Dimethyl-O-(4-methylthio-m-tolyl) phosphorothioate) |
3761-42-0 |
C10H15O5PS2 |
|
|
695 |
Axit 4-flo crotonic |
4-Fluorocrotonic acid |
37759-72-1 |
|
1 |
|
696 |
PFIB: 1,1,3,3,3-Pentaflo-2-(triflo metyl)-1-propen |
1-Propene,1,1,3,3,3-pentafluoro-2-(trifluoromethyl)- |
382-21-8 |
C4F8 |
|
|
697 |
Dicyclohexyl nitrat |
Dicyclohexylammonium nitrate |
3882-06-2 |
C12H24N2O3 |
|
|
698 |
Axit Alkylsulphuric |
Alkylsulphuric acid |
3925-44-3 |
|
|
|
699 |
Natri clo axetat |
Sodium chloroacetate |
3926-62-3 |
C2H3ClO2Na |
|
|
700 |
Thiophotphoryl clorua |
Thiophosphoryl chloride |
3982-91-0 |
PSCl3 |
|
|
701 |
Isopropyl 2-clo propionat |
Isopropyl 2-chloropropionate |
40058-87-5 |
C6H11ClO2 |
|
|
702 |
1,2-Epoxy-3-ethoxypropan |
1,2-Epoxy-3-ethoxypropane |
4016-11-9 |
C5H10O2 |
|
|
703 |
4-Nitrobenzo triflo |
4-Nitrobenzotrifluoride |
402-54-0 |
C7H4F3NO2 |
|
|
704 |
Kẽm |
Zirconium |
40-67-7 |
Zn |
|
|
705 |
Isophoron diisoxyanat |
Isophorone diisocyanate |
4098-71-9 |
C12H18N2O2 |
|
|
706 |
Phosacetim |
Phosacetim |
4104-14-7 |
C14H13Cl2N2O2PS |
100 |
|
707 |
Diclo silan |
Dichlorosilane (Silane, dichloro-) |
4109-96-0 |
Cl2H2Si |
4540 |
|
708 |
Butenal 2 |
Crotonaldehyde (2-Butenal) |
4170-30-3 |
C4H6O |
9080 |
|
709 |
Xianamit |
Cyanamide |
420-04-2 |
CH2N2 |
|
|
710 |
Fluenetil |
Fluenetile |
4301-50-2 |
C16H15FO2 |
100 |
|
711 |
Butanedion (diacetyl) |
2,3-Butanedione (Diacetyl) |
431-03-8 |
C4H6O2 |
|
|
712 |
N,N-Butylimidazol |
N,n-Butyl imidazole |
4316-42-1 |
C7H12N2 |
|
|
713 |
2-Triflo metylanilin |
2-Trifluoromethylaniline |
445-02-3 |
C7H5BrF3N |
|
|
714 |
Dodecyl triclo silan |
Dodecyltrichlorosilane |
4484-72-4 |
C12H25Cl3Si |
|
|
715 |
Pentametylheptan (isododecan) |
Pentametylheptane (Isododecane) |
30586-18-6 |
C12H26 |
|
|
716 |
Đi xyanua |
Cyanogen (Ethanedinitrile) |
460-19-5 |
C2N2 |
4540 |
|
717 |
Flo benzen |
Fluorobenzene |
462-06-6 |
C6H5F |
|
|
718 |
Axit 4-flo butyric |
4-fluorobutyric acid |
462-23-7 |
C4H7FO2 |
1 |
|
719 |
Dietoxymetan |
Diethoxymethane |
462-95-3 |
C5H12O2 |
|
|
720 |
Propadien |
Propadiene (1,2-Propadiene) |
463-49-0 |
C3H4 |
4540 |
|
721 |
Cacbon oxy sulfua |
Carbon oxysulfide (Carbon oxide sulfide (COS)) |
463-58-1 |
CSO |
4540 |
|
722 |
Thiophosgene |
Thiophosgene |
463-71-8 |
CCl2S |
|
|
723 |
2,2-Dimetylpropan |
2,2-Dimethylpropane (Propane, 2,2-dimethyl-) |
463-82-1 |
C5H12 |
4540 |
|
724 |
Pinacolyl alcohol: 3,3-Dimetylbutan-2-ol |
Pinacolyl alcohol: 3,3-Dimetylbutan-2-ol |
464-07-3 |
C6H14O |
|
|
725 |
Isodrin |
Isodrine |
465-73-6 |
C12H8Cl6 |
100 |
|
726 |
Clo fenvinphos |
Chlorfenvinphos |
470-90-6 |
C12H14Cl3O4P |
100 |
|
727 |
2,4,6-trinitrophenetol |
2,4,6-trinitrophenetole |
4732-14-3 |
C8H7N3O7 |
50000 |
|
728 |
n-metyl-n,2,4,6-tetranitroanilin |
n-methyl-n,2,4,6-tetranitroaniline |
479-45-8 |
C7H5N5O8 |
50000 |
|
729 |
Tetrahydrofurfurylamin |
Furfurylamine,tetrahydro- |
4795-29-3 |
C5H11NO |
|
|
730 |
juglone (5-hydroxynaphthalen-1,4-dion) |
Juglone (5-hydroxynaphthalene-1,4-dione) |
481-39-0 |
C10H6O3 |
100 |
|
731 |
1,5,9-Cyclododecatrien |
1,5,9-Cyclododecatriene |
4904-61-4 |
C12H18 |
|
|
732 |
Anabasine |
Anabasine, (Pyridine,3-(2S)-2-piperidinyl-) |
494-52-0 |
C10H14N2 |
100 |
|
733 |
Soda (Natri cabonat) |
Soda (Sodium carbonate) |
497-19-8 |
Na2CO3 |
|
|
734 |
Foocmaldehit (Nồng độ ≥ 90%) |
Formaldehyde (Conc. > 90%) |
50-00-0 |
CH2O |
50000 |
|
735 |
Benzyl clo format |
Benzyl chloroformate |
501-53-1 |
C8H7ClO2 |
|
|
736 |
Isooctan |
Isooctene |
5026-76-6 |
C8H16 |
|
|
737 |
DDT |
DDT (Dichlorodiphenyltrichloroethane) |
50-29-3 |
C14H9Cl5 |
|
|
738 |
Crotonylen (2-Butyn) |
Dimethylacetylene |
503-17-3 |
C4H6 |
|
|
739 |
Thalidomit |
Thalidomide |
50-35-1 |
C13H10N2O4 |
|
|
740 |
Aminopyridin |
2-Aminopyridine, |
504-29-0, 462-08-8, 504-24-5 |
C5H6N2 |
|
|
741 |
1,3-Pentadien |
1,3-Pentadiene |
504-60-9 |
C5H8 |
4540 |
|
742 |
Bis(2-clo etyl sulfua) |
Bis(2-chloroethyl) sulphide |
505-60-2 |
C4H8Cl2S |
1 |
|
743 |
Bạc kali xyanua |
Silver potassium cyanide |
506-61-6 |
AgK(CN)2 |
|
|
744 |
Bạc xyanua |
Silver cyanide |
506-64-9 |
AgCN |
|
|
745 |
Vàng xyanua |
Gold cyanide |
506-65-0 |
AuCN |
|
|
746 |
Brom Xyanua |
Xyanogen bromide |
506-68-3 |
BrCN |
|
|
747 |
Clo Xyanua |
Cyanogen chloride |
506-77-4 |
ClCN |
4540 |
|
748 |
Iốt xyanua |
Iodocyanide |
506-78-5 |
ICN |
|
|
749 |
Guanidine nitrat |
Guanidine nitrate |
506-93-4 |
CH6N4O3 |
|
|
750 |
Brom Acetyl |
Acetyl bromide |
506-96-7 |
C2H3BrO |
|
|
751 |
Iot Acetyl |
Acetyl iodide |
507-02-8 |
C2H3IO |
|
|
752 |
Axit thioacetic |
Thioacetic acid |
507-09-5 |
C2H4OS |
|
|
753 |
Tetranitrometan |
Tetranitromethane (Methane, tetranitro-) |
509-14-8 |
CN4O8 |
4540 |
|
754 |
Trietylenemelamin |
Triethylenemelamine |
51-18-3 |
C9H12N6 |
10 |
|
755 |
2,4-Dinitrophenol và các muối |
2,4-dinitrophenol, salts |
51-28-5 |
C6H4N2O5 |
50000 |
|
756 |
2-Iot butan |
Butane, 2-iodo- |
513-48-4 |
C4H9I |
|
|
757 |
Isopenten |
Isopentene |
513-35-9 |
C5H10 |
|
|
758 |
Iot metylpropan |
Iodomethylpropane |
513-38-2 |
C4H9I |
|
|
759 |
Methallyl alcohol |
Methallyl alcohol |
513-42-8 |
C4H8O |
|
|
760 |
Acetyl metyl carbinol |
Acetylmethyl carbinol (3-Hydroxybutanone) |
513-86-0 |
C4H8O2 |
|
|
761 |
Ethyl carbany |
Ethyl carbamate |
51-79-6 |
C3H7NO2 |
|
|
762 |
2-Brom-2-nitro-1,3-propanediol |
2-Brom-2-nitro-1,3-propanediol (b-Bromo-b-nitrotrimethyleneglycol) |
52-51-7 |
C3H6BrNO4 |
|
|
763 |
Dimetylcyclohexylamin |
Dimethylcyclohexylamine |
526-75-0 |
C8H10O |
|
|
764 |
Dinitrobenzen |
1,2-Dinitrobenzene |
528-29-0, |
C6H4N2O4 |
|
|
765 |
Octyl triclo silan |
Octyltrichlorosilane |
5283-66-9 |
C8H17Cl3Si |
|
|
766 |
Nonyl triclo silan |
Nonyltrichlorosilane |
5283-67-0 |
C9H19Cl3Si |
|
|
767 |
Clo acetophenon |
Phenacyl chloride |
532-27-4 |
C8H7ClO |
|
|
768 |
Axit sulphamic |
Sulfamic acid |
5329-14-6 |
H3NO3S |
|
|
769 |
1,3-Diclo aceton |
1,3-Dichloroacetone |
534-07-6 |
C3H4Cl2O |
|
|
770 |
1,1-Dimetoxyetan |
1,1-Dimethoxyethane |
534-15-6 |
C4H10O2 |
|
|
771 |
2-Metylfuran |
2-Methylfuran |
534-22-5 |
C5H6O |
|
|
772 |
Dinitro-o-cresol |
Dinitro-o-cresol |
534-52-1 |
C7H6N2O5 |
|
|
773 |
Etyl 2-clo propionat |
Ethyl 2-chloropropionate |
535-13-7 |
C5H9ClO2 |
|
|
774 |
Crimidin |
Crimidine |
535-89-7 |
C7H10ClN3 |
100 |
|
775 |
Dibenz(a,h)anthracen |
Dibenz(a,h)anthracene |
53-70-3 |
C22H14 |
|
|
776 |
Indomethacin |
Indomethacine |
53-86-1 |
C19H16CNIO4 |
|
|
777 |
Isobutyl propionat |
Isobutyl propionate |
540-42-1 |
C7H14O2 |
|
|
778 |
1-Clo propan (propyl clorua) |
n-Propyl chloride |
540-54-5 |
C3H7Cl |
|
|
779 |
1,2-Diclo etylen |
1,2-Dicloetylen |
540-59-0 |
C2H2Cl2 |
|
|
780 |
1,2-Dimetylhydrazin |
1,2-Dimetylhydrazine |
540-73-8 |
C2H8N2 |
|
|
781 |
Axit 2-nitrophenyl Arsonic |
2-Nitrophenylarsonic acid |
5410-29-7 |
C6H6AsNO5 |
|
|
782 |
Nicotin |
Nicotine (3-(1-Methyl-2-pyrrolidinyl)pyridine) |
54-11-5 |
C10H14N2 |
|
|
783 |
Ethyl Clo format |
Ethyl chloroformate |
541-41-3 |
C3H5ClO2 |
|
|
784 |
Etyl amyl ceton |
Ethyl amyl ketone |
541-85-5 |
C8H16O |
|
|
785 |
Triisopropyl borat |
Triisopropyl borate |
5419-55-6 |
C9H21BO3 |
|
|
786 |
Isobutyl format |
Isobutyl formate |
542-55-2 |
C5H10O2 |
|
|
787 |
Barium xyanua |
Barium cyanide |
542-62-1 |
Ba(CN)2 |
|
|
788 |
Diclo propen |
1,3-Dichloropropene |
542-75-6 |
C3H4Cl2 |
|
|
789 |
Cadimi xyanua |
Cadmium Cyanide |
542-83-6 |
(Cd(CN)2 |
|
|
790 |
Coban xyanua |
Cobalt Cyanide |
542-84-7 |
Co(CN)2 |
|
|
791 |
Bis(clo metyl) ete |
Bis(chloromethyl) ether |
542-88-1 |
C2H4Cl2O |
1 |
|
792 |
Amyl clo |
n-Amyl chloride |
543-59-9 |
C5H11Cl |
|
|
793 |
Butyl nitrit |
Butyl nitrite |
544-16-1 |
C4H9NO2 |
|
|
794 |
Cycloheptatrien |
Cycloheptatriene |
544-25-2 |
C7H8 |
|
|
795 |
Muối đồng-kẽm xyanua |
Copper Cyanide, Zinc cyanide |
544-92-3, |
(Cu(CN), |
|
|
796 |
Dimetyl kẽm |
Dimethylzinc |
544-97-8 |
C2H6Zn |
|
|
797 |
Tris-(1-aziridinyl) phosphin oxit |
Tris-(1-aziridinyl) phosphine oxide |
545-55-1 |
C6H12N3OP |
|
|
798 |
Hydroxylamin hydroclorua |
Hydroxylamine hydrochloride |
5470-11-1 |
H3NOHCl |
|
|
799 |
Fenthion |
Fenthion |
55-38-9 |
C10H15O3PS2 |
|
|
800 |
2,4-Diclo anilin |
2,4-Dichloroaniline |
554-00-7 |
C6H5Cl2N |
|
|
801 |
Metyl propionat |
Methyl propionate |
554-12-1 |
C4H8O2 |
|
|
802 |
Magiê diphenyl |
Magnesium diphenyl |
555-54-4 |
C12H10Mg |
|
|
803 |
Metyl isovalerat |
Methyl isovalerate |
556-24-1 |
C6H12O2 |
|
|
804 |
Nitroglyxerin |
Nitroglycerine |
55-63-0 |
C3H5N3O9 |
10000 |
|
805 |
2,3-Epoxy-1-propanol |
2,3-Epoxy-1-propanol (Glycidol) |
556-52-5 |
C3H6O2 |
|
|
806 |
Allyl iot |
Allyl iodide |
556-56-9 |
C3H5I |
. |
|
807 |
Metyl isothiocyanat |
Methyl isothiocyanate |
556-61-6 |
C2H3NS |
|
|
808 |
Metyl thioxyanat |
Methyl thiocyanate (Thiocyanic acid, methyl ester) |
556-64-9 |
C2H3NS |
9080 |
|
809 |
Thủy ngân phenyl nitat |
Phenylmercuric nitate |
55-68-5 |
C6H5HgNO3 |
|
|
810 |
Metyl propyl ete |
Methyl propyl ether (Methoxypropane) |
557-17-5 |
C4H10O |
|
|
811 |
Nickel (II) xyanua |
Nickel (II) xyanide |
557-19-7 |
C2N2Ni |
|
|
812 |
Dietyl kẽm |
Diethylzinc |
557-20-0 |
C4H10Zn |
|
|
813 |
Kẽm xyanua |
Zinc Cyanide |
557-21-1 |
C2N2Zn |
|
|
814 |
Allyl etyl ete |
Allyl ethyl ether |
557-31-3 |
C5H10O |
|
|
815 |
Diallyl ete |
Diallylether |
557-40-4 |
C6H10O |
|
|
816 |
2-Clo propylen (1-Propene, 2-chloro-) |
2-Chloropropylene (1-Propene, 2-chloro-) |
557-98-2 |
C3H5CI |
4540 |
|
817 |
Cacbon tetrabrom |
Carbon tetrabromide (Tetrabromomethane) |
558-13-4 |
CBr4 |
|
|
818 |
3,3-iminodipropylamin |
3,3’-Iminodipropylamine |
56-18-8 |
C6H17N3 |
|
|
819 |
Carbon tetraclo |
Carbon tetrachloride |
56-23-5 |
CCl4 |
|
|
820 |
Ethion |
Ethione |
563-12-2 |
C9H22O4P2S4 |
100 |
|
821 |
3-Metyl buten 1 |
3-Methyl-1-butene |
563-45-1 |
C5H10 |
4540 |
|
822 |
2-Metyl buten 1 |
2-Methyl-1-butene |
563-46-2 |
C5H10 |
4540 |
|
823 |
Metylallyl clo |
Methyl allyl chloride |
563-47-3 |
C4H7CI |
|
|
824 |
Tri butylstannyl axetat |
Tributylstannyl acetate |
56-36-0 |
C14H30O2Sn |
|
|
825 |
Metyl isopropenyl keton |
Methyl isopropenyl ketone |
563-80-4 |
C5H10O |
|
|
826 |
Parathion |
Parathion |
56-38-2 |
C10H14NO5PS |
100 |
|
827 |
Ben(a) chất hóa học thu được từ than đá |
Benz(a) anthracene (1,2-Benzoanthracene) |
56-55-3 |
C18H12 |
|
|
828 |
Allyl isothiocynat |
Allyl isothiocyanate |
57-06-7 |
C4H5NS |
|
|
829 |
1,1-Dimetyl hydrazine |
1,1-Dimethylhydrazine |
57-14-7 |
C2H8N2 |
|
|
830 |
Strychnin |
Strychnine |
57-24-9 |
C21H22H2O2 |
|
|
831 |
Tri ethyltin sulphat |
Tri ethyltin sulphate |
57-52-3 |
C12H30O4SSn |
|
|
832 |
Hexaetyl tetraphosphat |
Hexaethyl tetraphosphate |
757-58-4 |
C12H30O13P4 |
|
|
833 |
Xylenol (dimetylphenol) |
2,6-Xylenol |
576-26-1 |
C8H10O |
|
|
834 |
Nitro brom benzen |
o-Nitrobromobenzene |
577-19-5 |
C6H4BrNO2 |
|
|
835 |
Clordran |
Clordrane |
57-74-9 |
C10H6Cl8 |
|
|
836 |
2-Etylanilin |
2-EthyIaniline |
578-54-1 |
C8H11N |
|
|
837 |
Di phenylamin Clo arsin |
Di phenylamin Chloroarsine |
578-94-9 |
C12H9AsCIN |
|
|
838 |
Brom benzyl cyanua |
Bromobenzyl cyanide |
5798-79-8 |
C8H6BrN |
|
|
839 |
Thủy ngân benzoat |
Mercury benzoate |
583-15-3 |
Hg(C7H6O2)2 |
|
|
840 |
1,2-Benzoquinon |
1,2-Benzoquinone |
583-63-1 |
C6H4O2 |
|
|
841 |
Promurit (1-(3,4-dichlorophenyl)-3-triazenethiocarboxamide) |
Promurit (1-(3,4-dichlorophenyl)-3-triazenethiocarboxamide) |
5836-73-7 |
C7H6CI2N4S |
100 |
|
842 |
Toluen diisoxyanat |
Toluene di-isocyanate |
584-84-9 |
C9H6N2O2 |
10000 |
|
843 |
Terpinolen |
Terpinolene |
586-62-9 |
C10H16 |
|
|
844 |
Lindan |
Lindane (gamma-1,2,3,4,5,6-Hexachlorocyclohexane) |
58-89-9 |
C6H6Cl6 |
|
|
845 |
2,3,4,6-Tetraclo phenol |
2,3,4,6-Tetrachlorophenol |
58-90-2 |
C6H2Cl4O |
|
|
846 |
Hexadecyltriclo silan |
Hexadecyltrichlorosilane |
5894-60-0 |
C16H33Cl3Si |
|
|
847 |
Butyl propionat |
Butyl propionate |
590-01-2 |
C7H14O2 |
|
|
848 |
cis-Buten-2 |
2-Butene-cis |
590-18-1 |
C4H8 |
4540 |
|
849 |
1-Clo propylen |
1-Chloropropylene (1-Propene, 1-chloro-) |
590-21-6 |
C3H5CI |
4540 |
|
850 |
2-Metylpentan-2-ol |
2-Methyl-2-pentanol |
590-36-3 |
C6H14O |
|
|
851 |
Axít Arsonic, phenyl - |
Phenylarsonic acid |
98-05-5 |
C6H7AsO3 |
|
|
852 |
2-Hexanon |
2-Hexanone (Methyl n-butyl ketone (MnBK, MBK)) |
591-78-6 |
C6H12O |
|
|
853 |
Allyl axetat |
Allyl acetate |
591-87-7 |
C5H8O2 |
|
|
854 |
Thủy ngân xyanua kali |
Mercuric potassium cyanide |
591-89-9 |
K2Hg(CN)4 |
|
|
855 |
Canxi xyanua |
Calcium cyanide |
592-01-8 |
Ca(CN)2 |
|
|
856 |
Thủy ngân xyanua |
Mercuric cyanide |
592-04-1 |
Hg(CN)2 |
|
|
857 |
Chì dixyanua |
Lead Dicyanide |
592-05-2 |
Pb(CN)2 |
|
|
858 |
N-Butyl clo format |
N-Butyl chloroformate |
592-34-7 |
C5H9ClO2 |
|
|
859 |
1 –Hexen |
1-Hexene |
592-41-6 |
C6H12 |
|
|
860 |
Hexadien |
1,4-Hexadiene, |
592-45-0, |
C6H10 |
|
|
861 |
1-bromo-2-ethoxy-Etan |
Ethane, 1 -bromo-2-ethoxy- |
592-55-2 |
C4H9BrO |
|
|
862 |
n-Butyl format |
N-Butyl formate |
592-84-7 |
C5H10O2 |
|
|
863 |
Thủy ngân thiocyanat |
Mercury(II) thiocyanate |
592-85-8 |
Hg(SCN)2 |
|
|
864 |
Vinyl brom |
Vinyl bromide |
593-60-2 |
C2H3Br |
|
|
865 |
Perclo metyl mercaptan |
Perchloromethylmercaptan (Methanesulfenyl chloride, trichloro-) |
594-42-3 |
CCl4S |
4540 |
|
866 |
1,1-Diclo-1-nitroetan |
1,1 -Dichloro-1-nitroethane |
594-72-9 |
C2H3Cl2NO2 |
|
|
867 |
Thủy ngân salicylat |
Mercury salicylate |
5970-32-1 |
C7H4HgO3 |
|
|
868 |
Tetra etyltin |
Tetraethyltin |
597-64-8 |
C8H20Sn |
|
|
869 |
Di clo etyl Arsonous |
Arsonous di cloride , etyl - |
598-14-1 |
C2H5AsCl2 |
|
|
870 |
Brom acetyl bromua |
Bromoacetyl bromide |
598-21-0 |
C2H2Br2O |
|
|
871 |
Brom aceton |
Bromoacetone |
598-31-2 |
C3H5BrO |
|
|
872 |
Brom triflo etylen |
Bromotrifluorethylene (Ethene, bromotrifluoro-) |
598-73-2 |
C2BrF3 |
4540 |
|
873 |
Axit 2-Clo propionic |
2-Chloropropionic acid |
598-78-7 |
C3H5ClO2 |
|
|
874 |
Metyl triclo axetat |
Methyl trichloroacetate |
598-99-2 |
C3H3Cl3O2 |
|
|
875 |
Muối sắt (III) asenat |
Ferric arsenate |
10102-49-5 |
FeAsO4 |
|
|
876 |
2,3-Dinitrotoluen |
2,3-Dinitrotoluene |
602-01-7 |
C7H6N2O4 |
|
|
877 |
Thioglycol |
Thiomonoglyco |
60-24-2 |
C2H6OS |
|
|
878 |
Etyl ete |
Ethyl ether (Ethane, 1,1'-oxybis-) |
60-29-7 |
C4H10O |
4540 |
|
879 |
Metyl hydrazin |
Methyl hydrazine (Hydrazine, methyl-) |
60-34-4 |
CH6N2 |
6810 |
|
880 |
Strychnin sulfat |
Strychnine sulfate |
60-41-3 |
C21H22N2O2SO4 |
|
|
881 |
Dieldrin |
Dieldrin (1,2,3,4,10,10-Hexachloro-6,7-epoxy-1,4,4a,5,6,7,8,8a-octahydro,endo,exo-1,4:5,8-dimethanonaphthalene) |
60-57-1 |
C12H8Cl6O |
|
|
882 |
2,6-Dinitrotoluen |
2,6-Dinitrotoluene |
606-20-2 |
C7H6N2O4 |
|
|
883 |
2,4,6-trinitroanisol |
2,4,6-trinitroanisole |
606-35-9 |
C7H5N3O7 |
50000 |
|
884 |
Chì acetate trihydrat |
Leadacetate trihydrate |
6080-56-4 |
Pb(OAc)2.3H2O |
|
|
885 |
Clo cresol |
2-Chloro-m-cresoI, |
608-26-4, |
C7H7CIO |
|
|
886 |
Diclo anilin |
2,3-DichIoroaniline, |
608-27-5, |
C6H5C!2N |
|
|
887 |
2,6-Diclo anilin |
2,6-Dichloroaniline |
608-31-1 |
C6H5Cl2N |
|
|
888 |
Hexaclo cyclohexan (hỗn hợp đồng phân) |
Hexachlorocyclohexane (mixed isomers) |
608-73-1 |
C6H6Cl6 |
|
|
889 |
Tali hexaflo phosphat |
Thallium hexafluorophosphate |
60969-19-9 |
TIF6P |
|
|
890 |
3,4-Dinitrotoluen |
3,4-Dinitrotoluene |
610-39-9 |
C7H6N2O4 |
|
|
891 |
o-Tolidin dihydro clo |
o-Tolidine dihydrochloride |
612-82-8 |
C14H18C!2N2 |
|
|
892 |
Dimetyl cacbon |
Dimethyl carbonate |
616-38-6 |
C3H6O3 |
|
|
893 |
Isopropyl isobutyrat |
Isopropyl isobutyrate |
617-50-5 |
C7H14O2 |
|
|
894 |
Poly Clorinated Terphenyls (PCTs) |
Polychlorinatede terphenyls (PCTs) |
61788-33-8 |
C18H14-nCln |
|
|
895 |
Furfurylamin |
Furfurylamine |
617-89-0 |
C5H7NO |
|
|
896 |
Coban naphthenat |
obalt(Il) naphthenate |
61789-51-3 |
|
|
|
897 |
Chì naptenat |
Lead naphthenates |
61790-14-5 |
C22H14O4Pb |
|
|
898 |
Benzyl iot |
Benzyl iodide |
620-05-3 |
C7H7I |
|
|
899 |
N-phenyl-Phenyl cacbon amin clo |
Carbonimidicdichloride, N-phenyl- |
622-44-6 |
C7H5Cl2N |
|
|
900 |
Cyclohexyl axetat |
Cyclohexylacetate |
622-45-7 |
C8H14O2 |
|
|
901 |
4-(Dimetylamino) axit azobenzene -4'-arsonic |
Arsonic acid,As-[4-[2-[4-(dimethylamino)phenyl]diazenyl] phenyl]- |
622-68-4 |
C14H16AsN3 O3 |
|
|
902 |
Metyl butyrat |
Methyln-butyrate |
623-42-7 |
C5H10O2 |
|
|
903 |
Ethyl trans-crotonat |
Ethyl trans-crotonate |
623-70-1 |
C6H10O2 |
|
|
904 |
Thủy ngân phenyl axetat |
Phenylmercury acetate |
62-38-4 |
C8H8HgO2 |
|
|
905 |
1,4-Benzenediamin dihydroclorit |
1,4-Benzenediamine dihydrochloride (1,4-Phenylenediamine dihydrochloride) |
624-18-0 |
C6H10Cl2N2 |
|
|
906 |
trans-Buten-2 |
2-Butene-trans (2-Butene, (E)) |
624-64-6 |
C4H8 |
4540 |
|
907 |
Metyl isoxyanat |
Methyl isocyanate |
624-83-9 |
C2H3NO |
150 |
|
908 |
Dimetyl disulfua |
Dimethyl disulfide |
624-92-0 |
C2H6S2 |
|
|
909 |
Anilin |
Aniline (Benzeneamine) |
62-53-3 |
C6H7N |
|
|
910 |
Etyl nitrate |
Ethyl nitrate |
625-58-1 |
C2H5NO3 |
50000 |
|
911 |
Thiourea |
Thiourea |
62-56-6 |
CH4N2S |
|
|
912 |
1-Metylpiperidin |
1-MethyIpiperidine |
626-67-5 |
C6H13N |
|
|
913 |
Pentene 2, (Z)- |
2-Pentene, (Z)- |
627-20-3 |
C5H10 |
4540 |
|
914 |
Natri flo acetat |
Sodium fluoroacetate |
62-74-8 |
C2H3FO2.Na |
|
|
915 |
Dimetylnitrosamin |
Dimethylnitrosamine |
62-75-9 |
C2H6N2O |
1 |
|
916 |
Fumaryl clorua |
Fumaryl chloride |
627-63-4 |
C4H2Cl2O2 |
|
|
917 |
Butyl metyl ete |
Butyl methyl ether |
628-28-4 |
C5H12O |
|
|
918 |
Etyl propyl ete |
Ethyl propyl ether |
628-32-0 |
C5H12O |
|
|
919 |
Amyl axetat |
Amyl acetate |
628-63-7 |
C7H14O2 |
|
|
920 |
Etyl butyl ete |
Ethyl butyl ether |
628-81-9 |
C6H14O |
|
|
921 |
Thủy ngân fulminat |
Mercury fulminate |
628-86-4 |
C2HgN2O2 |
10000 |
|
922 |
Cyclohepten |
Cycloheptene |
628-92-2 |
C7H12 |
|
|
923 |
Etylen glycol dinitrate |
Ethylene glycol dinitrate |
628-96-6 |
C2H4N2O6 |
10000 |
|
924 |
Cyclooctatetraen |
Cyclooctatetraene (1,3,5,7-cyclooctatetraene) |
629-20-9 |
C8H8 |
|
|
925 |
Cacbon monoxit |
Carbon monoxide |
630-08-0 |
CO |
|
|
926 |
1,1,1,2-Tetracloetan |
1,1,1,2-Tetrachloroethane |
630-20-6 |
C2H2Cl4 |
|
|
927 |
Octadien |
Octadiene |
63597-41-1 |
C8H14 |
|
|
928 |
Isopropyl propionat |
Isopropyl propionate |
637-78-5 |
C6H12O2 |
|
|
929 |
Isopropyl butyrat |
Isopropyl butyrate |
638-11-9 |
C7H14O2 |
|
|
930 |
Valeryl clo |
Valeryl chloride |
638-29-9 |
C5H9CIO |
|
|
931 |
Amyl format |
Amyl formate |
638-49-3 |
C7H5Cl3 |
|
|
932 |
Nitrid ammonium kẽm |
Zinc ammonium nitrite |
63885-01-8 |
H3N.3(HNO2).Zn |
|
|
933 |
Axit dimetyl photpho amidoxyanidic |
Dimethyl phosphoramidocyanidic acid (C3H7N2P) |
63917-41-9 |
C3H7N2P |
1000 |
|
934 |
Chì 2,4,6-trinitroresorcinoxit |
Lead 2,4,6-trinitroresorcinoxide lead styphnate) |
63918-97-8 |
C6H3N3O8.Pb |
50000 |
|
935 |
Thủy ngân gluconat |
Mercury gluconate |
63937-14-4 |
C6H11HgO7 |
|
|
936 |
Sắt (III)-o-arsenit, pentahydrat |
Iron (Ill)-o-arsenite, pentahydrate |
63989-69-5 |
As2Fe2O6*Fe2 O3*5H2O |
|
|
937 |
Thiometon |
Thiometon (S-2-Ethylthioethyl O,O-dimethyl phosphorodithioate) |
640-15-3 |
C6H15O2PS3 |
|
|
938 |
Axit formic |
Formic acid |
64-18-6 |
CH2O2 |
|
|
939 |
Axit acetic |
Acetic acid |
64-19-7 |
C2H4O2 |
|
|
940 |
Methoxymetyl isoxyanua |
Methoxymethyl isocyanate |
6427-21-0 |
C3H5NO2 |
|
|
941 |
Phenylphotpho diclo |
Phenylphosphorus Dichloride |
644-97-3 |
C6H5Cl2P |
|
|
942 |
Penten 2, (E-) |
2-Pentene, (E)- |
646-04-8 |
C5H10 |
4540 |
|
943 |
Dioxolan |
Dioxolane |
646-06-0 |
C3H6O2 |
|
|
944 |
Dietyl sulfat |
Dietyl sulfate |
64-67-5 |
C4H10O4 S |
|
|
945 |
Amoni nitrat (trên 98%) |
Ammonium nitrate |
6484-52-2 |
NH4NO3 |
50 |
|
946 |
Nicotin sulfat |
Nicotine sulfate (1-1-Methyl-2-(3-pyridyl)-pynolidine sulfate) |
65-30-5 |
C20H26N4*SO4 |
|
|
947 |
Nicotin tartrat |
Nicotine tartrate |
65-31-6 |
C10H14N2 2(C4H6O6) |
|
|
948 |
Tali cacbonat |
Thallium carbonate |
6533-73-9 |
Tl2CO3 |
|
|
949 |
BZ:3-Quinuclidinyl benzilat (*) |
Benzilicacid, 3-quinuclidinyl ester |
6581-06-2 |
C21H23NO3 |
|
|
950 |
Hexaldehit |
Hexanal |
66-25-1 |
C6H12O |
|
|
951 |
Xycloheximit |
Cycloheximide |
66-81-9 |
C15H23NO4 |
100 |
|
952 |
Diketen (3-Butenoic Axit) |
Diketene |
674-82-8 |
C4H4O2 |
|
|
953 |
Metanol |
Methanol |
67-56-1 |
CH4O |
500000 |
|
954 |
Isopropanol |
Isopropyl alcohol |
67-63-0 |
C3H8O |
|
|
955 |
Aceton |
Acetone |
67-64-1 |
C3H6O |
|
|
956 |
Cloroform |
Chloroform (Methane, trichloro-) |
67-66-3 |
CHCI3 |
9080 |
|
957 |
Các hóa chất, trừ các độc chất đã được liệt kê tại Bảng 1, chứa 1 nguyên tử photpho liên kết với một nhóm metyl, etyl hoặc propyl (mạch thẳng hoặc nhánh) nhưng không liên kết thêm với các nguyên tử cacbon khác. Ví dụ: Meylphotphonyl diclorit, Dimetyl metyl |
|
676-97-1 756-79-6 |
CH3Cl2OP; |
|
|
958 |
Hexametylphotphoroamit |
Hexamethylphosphoroamide |
680-31-9 |
C6H18N3OP |
1 |
|
959 |
Axit thioglycolic |
Thioglycolic acid |
68-11-1 |
C2H4O2S |
|
|
960 |
n,n-Dimetyl formamit |
n,n-Dimethylformamide |
68-12-2 |
C3H7NO |
|
|
961 |
Tetra kali vàng (+1)pentaxyanua |
Tetra Potassium Gold (+1) pentaxyanide |
68133-87-9 |
C5AuK4N5 |
|
|
962 |
Nitrocresol |
Nitrocresol |
68137-08-6 |
C7H7NO3 |
|
|
963 |
Metyl orthosilicat (Tetramethoxysilan) |
Methyl orthosilicate |
681-84-5 |
C4H12O4Si |
|
|
964 |
Dinatri trioxosilicat |
Disodium trioxosilicate |
6834-92-0 |
Na2SiO3 |
|
|
965 |
Hexaflo aceton hydrat |
Hexafluoroacetone |
684-16-2 |
C3F6O |
|
|
966 |
Propylen tetrame (Tetrapropylen) |
Propylene tetramer |
6842- 15-5 |
C12H24 |
|
|
967 |
Etyl clo axetat |
Ethyl chloracetate |
105-39-5 |
C4H7ClO2 |
|
|
968 |
Propylen clo hydrin |
Propylene chlorohydrine |
68584-59-8 |
|
|
|
969 |
Etyl lactat |
Ethyl lactate |
687-47-8 |
C5H10O3 |
|
|
970 |
Liti silicon |
Lithium silicon |
68848-64-6 |
Li-Si |
|
|
971 |
Terpen hydrocacbon |
Terpene hydrocarbon |
68956-56-9 |
C10H16 |
|
|
972 |
Coban resinat |
Cobalt resinate |
68956-82-1 |
Co(C44H62O4)2 |
|
|
973 |
Isohepten |
Isoheptene |
68975-47-3 |
|
|
|
974 |
Vinyl axetylen |
Vinyl acetylene (1-Buten-3-yne) |
689-97-4 |
C4H4 |
4540 |
|
975 |
Isohexen |
Isohexene |
691-37-2 |
C6H12 |
|
|
976 |
Monocrotopho |
Monocrotophos (Dimethyl (E)-1-methyl-2-(methylcarbamoyl) vinyl phosphate) |
6923-22-4 |
C7H14NO5P |
|
|
977 |
Dietylen glycol dinitrat |
Diethyiene glycol dinitrate |
693-21-0 |
C4H8N2O7 |
10000 |
|
978 |
Naphthylurea |
Naphthylurea, (1-Naphthylurea) |
6950-84-1 |
C11H10N2O |
|
|
979 |
Phenylarsin di clo |
Phenylarsin di chloride |
696-28-6 |
C6H5AsCI2 |
|
|
980 |
Tert-Butylcyclohexyl clo format |
Tert-Butylcyclohexylchloroformate |
70042-58-9 |
C11HI1ClO2 |
|
|
981 |
Phenacyl brom |
Phenacyl bromide |
70-11-1 |
C8H7BrO |
|
|
982 |
Hexaclophen |
Hexachlorophene |
70-30-4 |
C13H6Cl6O2 |
|
|
983 |
Liti sắt silicon |
Lithium ferrosilicon |
64082-35-5 |
FeSi.Li |
|
|
984 |
n-Propanol |
Propan-1-ol |
71-23-8 |
C3H8O |
|
|
985 |
Clo diphenylarsin |
Chlorodiphenylarsine |
712-48-1 |
C12H10AsCl |
|
|
986 |
Butanol |
n-Butanol, |
71-36-3, |
C4H10O |
|
|
987 |
Pentanol |
1-Pentanol |
71-41-0 6032-29-7 |
C5H12O |
|
|
988 |
Benzen |
Benzene |
71-43-2 |
C6H6 |
|
|
989 |
1,1,1-Triclo etan |
1,1,1-Trichloroethane |
71-55-6 |
C2H3Cl3 |
|
|
990 |
Endrin |
Endrine |
72-20-8 |
C12H8Cl6O |
|
|
991 |
Cyclobutan |
Cyclobutane |
7236-82-0 |
C4H8 |
|
|
992 |
Bột nhôm |
Aluminium |
7429-90-5 |
Al |
|
|
993 |
Krypton |
Krypton |
7439-90-9 |
Kr |
|
|
994 |
Liti |
Lithium |
7439-93-2 |
Li |
|
|
995 |
Magiê |
Magnesium |
7439-95-4 |
Mg |
|
|
996 |
Thủy ngân |
Mercury |
7439-97-6 |
Hg |
|
|
997 |
Neon |
Neon |
7440-01-9 |
Ne |
|
|
998 |
Niken và các hợp chất chứa Ni dạng bột có thể phát tán rong trong không khí (các loại oxit, cacbonat, sulfua) |
Nickel compounds in inhalable powder form (oxides, sulphides, carbonate) |
7440-02-0 |
Ni |
1000 |
|
999 |
Kali |
Potassium |
7440-09-7 |
K |
|
|
1000 |
Rubidi |
Rubidium |
7440-17-7 |
Rb |
|
|
1001 |
Silic |
Silicon |
7440-21-3 |
Si |
|
|
1002 |
Natri |
Sodium |
7440-23-5 |
Na |
|
|
1003 |
Tali |
Thallium |
7440-28-0 |
Tl |
|
|
1004 |
Titan |
Titanium |
7440-32-6 |
Ti |
|
|
1005 |
Stibi |
Antimony |
7440-36-0 |
Sb |
|
|
1006 |
Argon |
Argon |
7440-37-1 |
Ar |
|
|
1007 |
Asen |
Arsenic (Grey arsenic) Asen |
7440-38-2 |
As |
|
|
1008 |
Bari |
Barium |
7440-39-3 |
Ba |
|
|
1009 |
Bery (dạng bột và các hợp chất) |
Beryllium (powders, compounds) |
7440-41-7 |
Be |
10 |
|
1010 |
Hợp chất cadimi |
Cadmium |
7440-43-9 |
Cd |
|
|
1011 |
Xeri |
Cerium |
7440-45-1 |
Ce |
|
|
1012 |
Cesium |
Caesium |
7440-46-2 |
Cs |
|
|
1013 |
Kim loại coban và các hợp chất oxit, cacbonnat, sulfua dạng bột |
Cobalt metal, oxides, carbonates, sulphides, as powders |
7440-48-4 |
Co |
1000 |
|
1014 |
Gali |
Gallium |
7440-55-3 |
Ga |
|
|
1015 |
Hafnium |
Hafnium |
7440-58-6 |
Hf |
|
|
1016 |
Heli |
Helium |
7440-59-7 |
He |
|
|
1017 |
Tro kẽm (Zinc ashe) |
Zinc |
7440-66-6 |
Zn |
|
|
1018 |
Canxi |
Calcium |
7440-70-2 |
Ca |
|
|
1019 |
Selen dioxit |
Selenium dioxide |
7446-08-4 |
SeO2 |
|
|
1020 |
Lưu huỳnh dioxit |
Sulfur dioxide |
7446-09-5 |
SO2 |
20000 |
|
1021 |
Lưu huỳnh trioxit |
Sulfur trioxide |
7446-11-9 |
SO3 |
15000 |
|
1022 |
Chì sulphat |
Lead(II) sulfate |
7446-14-2 |
PbSO4 |
|
|
1023 |
Tali sulfat |
Thallium sulfate |
7446-18-6 |
Tl2(SO4) |
|
|
1024 |
Nhôm clorua |
Aluminium chloride |
7446-70-0 |
AICI3 |
|
|
1025 |
Metan |
Methane |
74-82-8 |
CH4 |
4540 |
|
1026 |
Metyl brom |
Bromomethane (methyl bromide) |
74-83-9 |
CH3Br |
200000 |
|
1027 |
Etan |
Ethane |
74-84-0 |
C2H6 |
4540 |
|
1028 |
Etylen |
Ethylene |
74-85-1 |
C2H4 |
|
|
1029 |
Axetylen |
Acetylene |
74-86-2 |
C2H2 |
5000 |
|
1030 |
Metyl clo |
Methyl chloride (Methane, chloro-) |
74-87-3 |
CH3CI |
4540 |
|
1031 |
Thủy ngân clorua |
Mercuric chloride |
7487-94-7 |
HgCl2 |
|
|
1032 |
Metan lot |
Iodomethane |
74-88-4 |
CH3I |
|
|
1033 |
Selen disulfua |
Selenium disulfide |
7488-56-4 |
SeS2 |
|
|
1034 |
Metylamin |
Methylamine (Methanamine) |
74-89-5 |
CH5N |
4540 |
|
1035 |
Axit Hydroxyanic |
Hydrocyanic acid |
74-90-8 |
HCN |
1135 |
|
1036 |
Metyl mercaptan |
Methyl mercaptan (Methanelhiol) |
74-93-1 |
CH4S |
4540 |
|
1037 |
Dibrom metan |
Dibromomethane |
74-95-3 |
CH2Br2 |
|
|
1038 |
Etyl bromua |
Bromoethane |
74-96-4 |
C2H5Br |
|
|
1039 |
Brom clo metan |
Bromochloromethane |
74-97-5 |
CH2BrCl |
|
|
1040 |
Propan |
Propane |
74-98-6 |
C3H8 |
4540 |
|
1041 |
Propin |
Propyne (1-Propyne) |
74-99-7 |
C3H4 |
4540 |
|
1042 |
Etyl clorua |
Ethyl chloride (Ethane, chloro-) |
75-00-3 |
C2H5CI |
4540 |
|
1043 |
Vinyl clorua |
Vinyl chloride (Ethene, chloro-) |
75-01-4 |
C2H3CI |
4540 |
|
1044 |
Vinyl florua |
Vinyl fluoride (Ethene, fluoro-) |
75-02-5 |
C2H3F |
4540 |
|
1045 |
Etyl amin |
Ethylamine (Ethanamine) |
75-04-7 |
|
4540 |
|
1046 |
Acetonitril |
Acetonitrile (Methyl cyanide) |
75-05-8 |
C2H3N |
|
|
1047 |
Axetaldehit |
Acetaldehyde |
75-07-0 |
C2H4O |
4540 |
|
1048 |
Etyl mercaptan |
Ethyl mercaptan (Ethanethiol) |
75-08-1 |
C2H6S |
4540 |
|
1049 |
Di clo metan |
Dichloromethane |
75-09-2 |
CH2Cl2 |
|
|
1050 |
Diflo metan |
Difluoromethane |
75-10-5 |
CH2F2 |
|
|
1051 |
Isoxyanua |
Isocyanate |
75-13-8 |
HNCO |
|
|
1052 |
Cacbon disulfua |
Carbon disulfide |
75-15-0 |
CS2 |
9080 |
|
1053 |
Dimetyl sulfua |
Dimethyl sulfide |
75-18-3 |
C2H6S |
|
|
1054 |
Cyclopropan |
Cyclopropane |
75-19-4 |
C3H6 |
4540 |
|
1055 |
Canxi cacbon |
Calcium carbide |
75-20-7 |
CaC2 |
|
|
1056 |
Etylen oxit |
Ethylene oxide |
75-21-8 |
C2H4O |
5000 |
|
1057 |
Butyl triclo silan |
N-Butyltrichlorosilane |
7521-80-4 |
C4H9C!3Si |
|
|
1058 |
Bromoform |
Bromoform |
75-25-2 |
CHBr3 |
|
|
1059 |
Isobutan |
Isobutane (Propane, 2-methyl) |
75-28-5 |
C4H10 |
4540 |
|
1060 |
Isopropyl clorua |
Isopropyl chloride (Propane, 2-chloro-) |
75-29-6 |
C3H7CI |
4540 |
|
1061 |
Isopropylamin |
Isopropylamine (2-Propanamine) |
75-31-0 |
C3H9N |
4540 |
|
1062 |
1,1-Diclo etan (etyliden clorua) |
1,1-Dichloroethane (ethylidene dichloride) |
75-34-3 |
C2H4C12 |
|
|
1063 |
Vinylidene clorua |
Vinylidene chloride (Ethene, 1,1-dichloro-) |
75-35-4 |
C2H2 C12 |
4540 |
|
1064 |
Acetyl clorua |
Acetyl chloride |
75-36-5 |
C2H3CIO |
|
|
1065 |
Diflo etan |
Difluoroethane (Ethane, 1,1-difluoro-) |
75-37-6 |
C2H4F2 |
4540 |
|
1066 |
Vinylidene florua |
Vinylidene fluoride (Ethene, 1,1-difluoro-) |
75-38-7 |
C2H2 F2 |
4540 |
|
1067 |
Acetaldehit amonia |
Acetaldehyde ammonia |
75-39-8 |
C2H7NO |
|
|
1068 |
Cacbon diclorua (phosgene) |
Carbonic dichloride (phosgene) |
75-44-5 |
CCl2O |
300 |
|
1069 |
Clo diflo metan (R-22) |
Chlorodifluoromethane (R-22) |
75-45-6 |
CHClF2 |
|
|
1070 |
Triflo metan |
Trifluoromethane (Fluoroform) |
75-46-7 |
CHF3 |
|
|
1071 |
Trimetylamin |
Trimethylamine (Methanamine, N, N-dimethyl-) |
75-50-3 |
C3H9N |
4540 |
|
1072 |
Titan tetraclorua |
Titanium tetrachloride (Titanium chloride (TiCI4) (T-4)-) |
7550-45-0 |
TiCl4 |
1135 |
|
1073 |
lốt |
Iodine |
7553-56-2 |
l2 |
|
|
1074 |
Metyl diclo silan |
Methyldichlorosilane |
75-54-7 |
CH4Cl2Si |
|
|
1075 |
Propyleneimin |
Propyleneimine (Aziridine, 2-methyl-) |
75-55-8 |
C3H7N |
4540 |
|
1076 |
Propylen oxit |
Propylene oxide |
75-56-9 |
C3H6O |
5000 |
|
1077 |
Tetrametyl amonni hydroxit |
Tetramethyiammonium hydroxide |
75-59-2 |
C4H13NO |
|
|
1078 |
Asenic axit, dimethyl - |
Dimethyl-Arsennic acid |
75-60-5 |
C2H7AsO2 |
|
|
1079 |
Dibrom diflo metan |
Dibromodifluoromethane |
75-61-6 |
CBr2F2 |
|
|
1080 |
Tetraflo metan |
Tetrafluoromethane |
75-73-0 |
CF4 |
|
|
1081 |
Chì tetramethyl (TML) |
Tetramethyl lead |
75-74-1 |
C4H12 Pb |
|
|
1082 |
Tetrametylsilan |
Tetramethylsilane (Silane, tetramethyl-) |
75-76-3 |
C4H12Si |
4540 |
|
1083 |
Trimetyl clo silan |
Trimethylchlorosilane (Silane, chlorotrimethyl-) |
75-77-4 |
C3H9ClSi |
4540 |
|
1084 |
Axit bo triflo acetic |
Boron trifluoride acetic acid |
7578-36-1 |
C2H4BF3O2 |
|
|
1085 |
Dimetyl diclo silan |
Dimethyldichlorosilane (Silane, dichlorodimethyl-) |
75-78-5 |
C2H6Cl2Si |
2270 |
|
1086 |
Metyl triclo silan |
Methyltrichlorosilane (Silane, trichloromethyl-) |
75-79-6 |
CH3Cl3Si |
2270 |
|
1087 |
Liti hydrit |
Lithium hydride |
7580-67-8 |
LiH |
|
|
1088 |
2-xyanopropan-2-ol |
2-cyanopropan-2-ol (acetone cyanohydrin) |
75-86-5 |
C4H7NO |
200000 |
|
1089 |
1-Clo-2,2,2-trifloetan |
1 -ChIoro-2,2,2-trifluoroethane |
75-88-7 |
C2H2ClF3 |
|
|
1090 |
Vinyltriclo silan |
Vinyltrichlorosilane |
75-94-5 |
C2H3Cl3Si |
|
|
1091 |
Pentaclo etan |
Pentachloroethane |
76-01-7 |
C2HCl5 |
|
|
1092 |
Natri perclorat |
Sodium perchlorate |
7601-89-0 |
NaClO4 |
|
|
1093 |
Axit percloric |
Perchloric acid |
7601-90-3 |
HCIO4 |
|
|
1094 |
Triclo acetyl clorua |
Trichloroacetyl chloride |
76-02-8 |
C2CI4O |
|
|
1095 |
Axit triclo acetic |
Trichloroacetic acid |
76-03-9 |
C2HCl3O2 |
|
|
1096 |
Axit triflo acetic |
Trifluoroacetic acid |
76-05-1 |
C2HF3O2 |
|
|
1097 |
Chloropicrin: Triclo nitrometan |
Chloropicrin: Trichloronitrometan |
76-06-2 |
CCl3NO2 |
|
|
1098 |
Flo Percloryl |
Perchloryl fluoride |
7616-94-6 |
FClO3 |
|
|
1099 |
Dietyl phosphit |
Diethyl Phosphite |
762-04-9 |
C4H11O3P |
|
|
1100 |
Axit Asenic, muối natri |
Arsenic acid |
7631-89-2 |
Na3AsO4 |
|
|
1101 |
Natri nitrit |
Sodium nitrite |
7632-00-0 |
NaNO2 |
. |
|
1102 |
2-Metyl-2-heptanethiol |
2-Methyl-2-heptanethiol |
763-20-2 |
C8H18S |
|
|
1103 |
Natri perborat |
Sodium perborate |
7632-04-4 |
NaBO3 |
|
|
1104 |
Vanadi tetraclo |
Vanadium tetrachloride |
7632-51-1 |
VCl4 |
|
|
1105 |
Bo trifluorua |
Boron trifluoride |
7637-07-2 |
BF3 |
|
|
1106 |
Heptaclorua |
Heptachlorane |
76-44-8 |
C10H5Cl7 |
|
|
1107 |
Tin(IV) clorua |
Stannic tetrachloride |
7646-78-8 |
SnCl4 |
|
|
1108 |
Kẽm clorua |
Zinc chloride |
7646-85-7 |
ZnCl2 |
|
|
1109 |
Kali hydro sulphat |
Potassium bisulfate |
7646-93-7 |
KHSO4 |
|
|
1110 |
Hydro clorua (khí lỏng) |
Hydrogen chloride (liquefied gas) |
7647-01-0 |
HCl |
25000 |
|
1111 |
Stibi pentaclorua |
Antimony pentachloride |
7647-18-9 |
SbCl5 |
|
|
1112 |
Axit Isopropyl phosphat |
Isopropyl acid phosphate |
76483-21-1 |
C3H9O4P |
|
|
1113 |
Glycidaldehit |
Glycidaldehyde |
765-34-4 |
C3H4O2 |
|
|
1114 |
1-Etylpiperidin |
1-Ethylpiperidine |
766-09-6 |
C7H15N |
|
|
1115 |
Axit photphoric |
Phosphoric acid |
7664-38-2 |
H3PO4 |
|
|
1116 |
Hydro florua |
Hydrogen fluoride |
7664-39-3 |
HF |
50000 |
|
1117 |
Amoniac |
Ammonia (anhydrous) |
7664-41-7 |
NH3 |
4540 |
|
1118 |
Axit sulphuric |
Sulphuric acid |
7664-93-9 |
H2SO4 |
|
|
1119 |
Natri florua |
Sodium fluoride |
7681-49-4 |
NaF |
|
|
1120 |
Tri phenyltin hydroxit |
Tri phenyltine hydroxyde |
76-87-9 |
C18H16OSn |
I |
|
1121 |
2,2-Diphenyl-2-hydroxyacetic Axit |
2,2-Diphenyl-2-hydroxyacetic acid |
76-93-7 |
C14H12O3 |
|
|
1122 |
Axit Nitric |
Nitric acid (conc 80% or greater) |
7697-37-2 |
HNO3 |
6810 |
|
1123 |
Lưu huỳnh |
Sulfur |
7704-34-9 |
S |
|
|
1124 |
Titan hydrit |
Titanium hydride |
7704-98-5 |
TiH2 |
|
|
1125 |
Kẽm hydrit |
Zirconium(II) hydride |
7704-99-6 |
ZrH2 |
|
|
1126 |
Sắt (III) clorua |
Iron(IIl) chloride |
7705-08-0 |
FeCl3 |
|
|
1127 |
Vanadi triclorua |
Vanadium chloride |
7718-98-1 |
VCI3 |
|
|
1128 |
Thionyl clorua |
Thionyl chloride |
7719-09-7 |
SOCI2 |
|
|
1129 |
Photpho triclorua |
Phosphorus trichloride |
7719-12-2 |
PCI3 |
6810 |
|
1130 |
Kali permanganat |
Potassium permanganate |
7722-64-7 |
KMnO4 |
|
|
1131 |
Hydro peroxit |
Hydrogen peroxide |
7722-84-1 |
H2O2 |
|
|
1132 |
Phot pho |
Phosphorus (White, yellow) |
7723-14-0 |
P |
500 |
|
1133 |
Brôm |
Bromine |
7726-95-6 |
Br2 |
20000 |
|
1134 |
Nhôm bromua |
Aluminium bromide |
7727-15-3 |
AlBr3 |
|
|
1135 |
Vanadi oxytriclorua |
Vanadium oxytrichloride |
7727-18-6 |
VOCI3 |
|
|
1136 |
Kali persulphat |
Potassium persulfate |
7727-21-1 |
K2S2O8 |
|
|
1137 |
Nitơ |
Nitrogen |
7727-37-9 |
N2 |
|
|
1138 |
Amoni persulphat |
Ammonium persulfate |
7727-54-0 |
H8N2O8S2 |
|
|
1139 |
Axit cromic |
Chromic acid |
7738-94-5 |
H2Cr2O4 |
|
|
1140 |
Hexaclo cyclopentadien |
Hexachlorocyclopentadiene |
77-47-4 |
C5Cl6 |
|
|
1141 |
Amiăng(tremolit) |
Asbestos (tremolite) |
77536-68-6 |
|
|
|
1142 |
Triisobutylen |
Triisobutylene |
7756-94-7 |
C4H9 |
|
|
1143 |
Kali nitrat |
Potassium nitrate (dạng tinh thể) |
7757-79-1 |
KNO3 |
1250 |
|
1144 |
Kali bromat |
Potassium bromate |
7758-01-2 |
KBrO3 |
|
|
1145 |
Kali nitrit |
Potassium nitrite |
7758-09-0 |
KNO2 |
|
|
1146 |
Natri clorit |
Sodium chlorite |
7758-19-2 |
NaClO2 |
|
|
1147 |
Đồng clorua |
Copper(I) chloride (cuprous chloride); Copper(II) chloride (Copper dichloride) |
7758-89-6; 7447-39-4 |
CuCl; CuCl2 |
|
|
1148 |
Chì cromat |
Lead chromate |
7758-97-6 |
PbCrO4 |
|
|
1149 |
Bạc nitrat |
Silver nitrate |
7761-88-8 |
AgNO3 |
|
|
1150 |
Diphenylmetyl brom |
Diphenylmethyl bromide |
776-74-9 |
C13H11Br |
|
|
1151 |
Dicyclopentadien |
Dicyclopentadiene |
77-73-6 |
C10H12 |
|
|
1152 |
Thủy ngân iotdua |
Mercury iodide |
7774-29-0 |
C10H12 |
|
|
1153 |
Axit Arsenic |
Arsenic acid |
7774-41-6 |
H3AsO4.1/2H2O |
|
|
1154 |
Natri clorat |
Sodium chlorate |
7775-09-9 |
NaClO3 |
25000 |
|
1155 |
Natri thiosunphuric |
Sodium dithionite |
7775-14-6 |
Na2S2O4 |
|
|
1156 |
Natri persulphat |
Sodium persulfate |
7775-27-1 |
Na2S2O8 |
|
|
1157 |
Dimetyl sulphat |
Dimethyl sulfate |
77-78-1 |
C2H6O4S |
|
|
1158 |
Axit arsenic |
Arsenic (V) acid |
7778-39-4 |
H3AsO4 |
100 |
|
1159 |
Muối đồng asenat |
Tricopper arsenate |
7778-41-8 |
Cu3AsO4 |
|
|
1160 |
Natri arsenat dibasic |
Sodiumarsenate dibasic |
7778-43-0 |
Na2HAsO4 |
|
|
1161 |
Canxi arsenat |
Calcium arsenate |
7778-44-1 |
Ca3(AsO4)2 |
|
|
1162 |
Kali dicromat |
Potassium Dichromate |
7778-50-9 |
K2(Cr2O7) |
|
|
1163 |
Canxi hypoclorua |
Calcium hypochlorite |
7778-54-3 |
Ca(ClO)2 |
|
|
1164 |
Kẽm dithionit |
Zinc dithionite |
7779-86-4 |
ZnS2O4 |
|
|
1165 |
Kẽm nitrat |
Zinc nitrate |
7779-88-6 |
Zn(NO3)2 |
|
|
1166 |
Flo |
Fluorine |
7782-41-4 |
F2 |
10000 |
|
1167 |
Oxy |
Oxygen |
7782-44-7 |
O2 |
200000 |
|
1168 |
Selen (dạng bột) |
Selenium (powder) |
7782-49-2 |
Se |
|
|
1169 |
Clo |
Chlorine |
7782-50-5 |
CI2 |
10000 |
|
1170 |
Axit nitrosylsulphuric |
Nitrosylsulfuric acid |
7782-78-7 |
NOHSO4 |
|
|
1171 |
Axit sulphurơ |
Sulfurous acid |
7782-99-2 |
H2SO3 |
|
|
1172 |
Axit selenơ |
Selenious acid |
7783-00-8 |
H2SeO3 |
|
|
1173 |
Hydro sulfua |
Hydrogen sulfide |
7783-06-4 |
H2S |
4540 |
|
1174 |
Hydro selenua |
Hydrogen selenide |
7783-07-5 |
H2Se |
1000 |
|
1175 |
Axit selenic |
Selenic acid |
7783-08-6 |
H2SeO4 |
|
|
1176 |
Thủy ngân iodua kali |
Mercury potassium iodide |
7783-33-7 |
K2Hgl4 |
|
|
1177 |
Thủy ngân sulphat |
Mercuric sulfate |
7783-35-9 |
HgSO4 |
|
|
1178 |
Oxy diflorua |
Oxygen difluoride |
7783-41-7 |
F2O |
1000 |
|
1179 |
Chì fluorua |
Lead Fluoride |
7783-46-2 |
PbF2 |
|
|
1180 |
Nitrotriflorua |
Nitrogen trifluoride |
7783-54-2 |
NF3 |
|
|
1181 |
Tetrafluoro -plumban, |
Tetrafluoroplumbane |
7783-59-7 |
PbF4 |
|
|
1182 |
Lưu huỳnh tetrafloma |
Sulfur tetrafluoride (Sulfur fluoride) |
7783-60-0 |
SF4 |
1135 |
|
1183 |
Silicon tetrafluorua |
Silicon tetrafluoride |
7783-61-1 |
SiF4 |
|
|
1184 |
Iod pentaflorua |
Iodine pentafluoride |
7783-66-6 |
IF5 |
|
|
1185 |
Stibi pentaflorua |
Antimony pentafluoride |
7783-70-2 |
SbF5 |
|
|
1186 |
Selen hexaflorua |
Selenium hexafluoride |
7783-79-1 |
SeF6 |
1000 |
|
1187 |
Tellu hexaflorua |
Tellurium hexafluorite |
7783-80-4 |
TeF6 |
1000 |
|
1188 |
Vonfram hexafluorua |
Tungsten hexafluoride |
7783-82-6 |
WF6 |
|
|
1189 |
Bạc arsenit |
Silver arsenite |
7784-08-9 |
Ag3AsO3 |
|
|
1190 |
Asen tribromua |
Arsenous tribromide |
7784-33-0 |
AsBr3 |
|
|
1191 |
Asen triclorua |
Arsenous trichloride |
7784-34-1 |
AsCl3 |
6810 |
|
1192 |
Asen trifluorua |
Arsenous trifluoride |
7784-35-2 |
AsF3 |
|
|
1193 |
Thủy ngân arsenat |
Mercuric arsenate |
7784-37-4 |
Hg2AsO4 |
|
|
1194 |
Chì arsenat |
Lead arsenates |
7784-40-9 |
PbHAsO4 |
|
|
1195 |
Monokali hydo arsenat |
Monopotassium hydrogen arsenate |
7784-41-0 |
KH2AsO4 |
|
|
1196 |
Arsen trihydrit (arsine) |
Arsenic trihydride (arsine) |
7784-42-1 |
AsH3 |
200 |
|
1197 |
Diammoni hydrogen arsenat |
Diammonium hydrogen arsenate (Ammonium arsenate) |
7784-44-3 |
(NH4)2HAsO4 |
|
|
1198 |
Arsen triiodua |
Arseniciodide |
7784-45-4 |
Asl3 |
|
|
1199 |
Mevinphos |
Mevinphos |
7786-34-7 |
C7H13O6P |
100 |
|
1200 |
Bari permanganat |
Barium permanganate |
7787-36-2 |
Ba(MnO4)2 |
|
|
1201 |
Crom florua |
Chromic fluoride |
7788-97-8 |
CrF3 |
|
|
1202 |
Stronti chromat |
Strontium chromate |
7789-06-2 |
SrCrO4 |
|
|
1203 |
Amoni dicromat |
Ammonium dichromate |
7789-09-5 |
(NH4)2Cr2O7 |
|
|
1204 |
Cesi nitrat |
Caesium nitrate |
7789-18-6 |
Cs(NO3)2 |
|
|
1205 |
Axit flo sulphonic |
Fluorosulfunic acid |
7789-21-1 |
HSO3F |
|
|
1206 |
Kali florua |
Potassium fluoride |
7789-23-3 |
KF |
|
|
1207 |
Kali hydro diflorua |
Potassium bifluoride |
7789-29-9 |
KHF2 |
|
|
1208 |
Brom pentaflorua |
Bromine pentafluoride |
7789-30-2 |
BrF5 |
|
|
1209 |
Natri bromat |
Sodium bromate |
7789-38-0 |
NaBrO3 |
|
|
1210 |
Photpho oxybromua |
Phosphorus oxybromide |
7789-59-5 |
PBr3O |
|
|
1211 |
Photpho tribromua |
Phosphorus tribromide |
7789-60-8 |
PBr3 |
|
|
1212 |
Photpho pentabromua |
Phosphorus pentabromide |
7789-69-7 |
PBr5 |
|
|
1213 |
Liti nitrat |
Lithium nitrate |
7790-69-4 |
LiNO3 |
|
|
1214 |
Cadimi florua |
Cadmiumfluoride |
7790-79-6 |
CdF2 |
|
|
1215 |
Clo triflorua |
Chlorine trifluoride |
7790-91-2 |
CIF3 |
|
|
1216 |
Axit cloric |
Chloric acid |
7790-93-4 |
HClO3 |
|
|
1217 |
Axit clo sulfunic |
Chlorosulfuric acid |
7790-94-5 |
CIHSO3 |
|
|
1218 |
Amoni perclorat |
Ammonium perchlorate |
7790-98-9 |
NH4ClO4 |
|
|
1219 |
lod monoclorua |
Iodine monochloride |
7790-99-0 |
ClI |
|
|
1220 |
Stronti clorat |
Strontium nitrate |
7791-10-8 |
Sr(CIO3)2 |
|
|
1221 |
Clo monoxit |
Chlorine monoxide (Chlorine oxide) |
7791-21-1 |
Cl2O |
4540 |
|
1222 |
Selen oxyclorit |
Selenium oxychloride |
7791-23-3 |
SeCl2O |
|
|
1223 |
Sulphuryl clorua |
Sulfuryl chloride |
7791-25-5 |
SO2Cl2 |
|
|
1224 |
Pyrosulphuryl clorua |
Pyrosulfuryl chloride |
7791-27-7 |
CI2O5S2 |
|
|
1225 |
Chì tetramethyl (TEL) |
Tetraethyl lead |
78-00-2 |
C8H20Pb |
|
|
1226 |
Hydroxylamin |
Hydroxylamine |
7803-49-8 |
H3NO |
|
|
1227 |
Photpho trihydrit (phosphine) |
Phosphorus trihydride (phosphine) |
7803-51-2 |
PH3 |
200 |
|
1228 |
Stibin (Stibin hydrua) |
Stibine (antimony hydril) |
7803-52-3 |
H3Sb |
1000 |
|
1229 |
Magie diamit |
Magnesium diamide |
7803-54-5 |
Mg(NH2)2 |
|
|
1230 |
Silan |
Silane |
7803-62-5 |
H4Si |
4540 |
|
1231 |
Amoni hydro sulphat |
Ammonium bisulfate |
7803-63-6 |
(NH4)HSO4 |
|
|
1232 |
Tetraetyl silicat |
Tetraethyl silicate |
78-10-4 |
C8H20O4Si |
|
|
1233 |
Pentaerythritol tetranitrat |
Pentaerythritol tetranitrate |
78-11-5 |
C5H8N4O12 |
50000 |
|
1234 |
Tri-o-cresyl phosphat |
Tri-o-cresyl phosphate (TOCP) |
78-30-8 |
C21H21O4P |
|
|
1235 |
Dioxathion (hỗn hợp đồng phân) |
Dioxathion (isomer mixture) |
78-34-2 |
C12H26O6P2S4 |
|
|
1236 |
oo-dietyl s-isopropylthiometyl photphorodithioat |
oo-diethyl s-isopropylthiomethyl phosphorodithioate |
78-52-4 |
C8H19O2PS3 |
100 |
|
1237 |
Nerver agent |
Amiton |
78-53-5 |
C10H24NO3P S |
1 |
|
1238 |
Cacbonphenothion |
Carbonphenothion |
786-19-6 |
C11H16ClO2PS3 |
100 |
|
1239 |
DimetyldietoxysiIan |
Dimethyldiethoxysilane |
78-62-6 |
C6H16 O2Si |
|
|
1240 |
2-Brom butan |
2-Bromobutane |
78-76-2 |
C4H9Br |
|
|
1241 |
Bromometylpropan |
1 -Bromo-2-methylpropane, |
78-77-3 |
C4H9Br |
|
|
1242 |
Isopentan |
Isopentane (Butane, 2-methyl-) |
78-78-4 |
C5H12 |
4540 |
|
1243 |
Isopren |
Isoprene (1,3-Butadinene, 2-methyl-) |
78-79-5 |
C5H8 |
4540 |
|
1244 |
Isobutylamin |
Isobutylamine |
78-81-9 |
C4H11N |
|
|
1245 |
Isobutyronitril |
Isobutyronitrile (Propanenitrile, 2-methyl-) |
78-82-0 |
C4H7N |
9080 |
|
1246 |
Isobutanol |
Isobutanol |
78-83-1 |
C4H10O |
|
|
1247 |
Isobutyraldehit |
Isobutyraldehyde |
78-84-2 |
C4H8O |
|
|
1248 |
Metacrylaldehit |
Methacrylaldehyde |
78-85-3 |
C4H6O |
|
|
1249 |
1,2-Diclo propan |
1,2-Dichloropropane |
78-87-5 |
C3H6Cl2 |
|
|
1250 |
1,2-Propylendiamin |
1,2-Propylenediamine |
78-90-0 |
C3H10N2 |
|
|
1251 |
Etyl metyl keton |
Butanone |
78-93-3 |
C4H8O |
|
|
1252 |
Metyl vinyl keton |
Methyl vinyl ketone |
78-94-4 |
C4H6O |
|
|
1253 |
Clo aceton |
Chloroacetone |
78-95-5 |
C3H5ClO |
|
|
1254 |
Etene, tri clo - |
Trichloroeten |
79-01-6 |
C2HCl3 |
|
|
1255 |
Propionyl clorua |
Propionyl chloride |
79-03-8 |
C3H5ClO |
|
|
1256 |
Cloacetyl clorua |
Chloroacetyl chloride |
79-04-9 |
C2H2CI2O |
|
|
1257 |
Acrylamit |
Acrylamide |
79-06-1 |
C3H5NO |
|
|
1258 |
Axit brom acetic |
Bromoacetic acid |
79-08-3 |
C2H3BrO2 |
|
|
1259 |
Axit propionic |
Propanoic acid |
79-09-4 |
C3H6O2 |
|
|
1260 |
Axit acrylic |
Acrylic acid |
79-10-7 |
C3H4O2 |
|
|
1261 |
Axit Clo acetic |
Chloroacetic acid |
79-11-8 |
C2H3ClO2 |
|
|
1262 |
Thiosemicacbazid |
Thiosemicarbazide |
79-19-6 |
CH5N3S |
|
|
1263 |
Metyl axetat |
Methyl acetate |
79-20-9 |
C3H6O2 |
|
|
1264 |
Axit Peracetic (>60%) |
Peracetic acid (>60%) |
79-21-0 |
C2H4O3 |
5000 |
|
1265 |
Metyl clo formate |
Methyl chloroformate (Carbonochloridic acid, methylester) |
79-22-1 |
C2H3ClO2 |
2270 |
|
1266 |
Nitroetan |
Nitroethane |
79-24-3 |
C2H5NO2 |
|
|
1267 |
Tetrabrom etan |
Tetrabromoethane |
79-27-6 |
C2H2Br4 |
|
|
1268 |
2,3-Dimetylbutan |
2,3-Dimethylbutane |
79-29-8 |
C6H14 |
|
|
1269 |
Isobutyryl clorua |
Isobutyryl chloride |
79-30-1 |
C4H7ClO |
|
|
1270 |
Axit isobutyric |
Isobutyric acid |
79-31-2 |
C4H8O2 |
|
|
1271 |
1,1,2,2-Tetraclo etan |
1,1,2,2-Tetrachloroethane (Acetylene tetrachloride) |
79-34-5 |
C2H2Cl4 |
|
|
1272 |
Diclo acetyl clorua |
Dichloroacetyl chloride |
79-36-7 |
C2HCl3O |
|
|
1273 |
Triflo clo etylen |
Trifluorochloroethylene (Ethene, chlorotrifluoro-) |
79-38-9 |
C2ClF3 |
4540 |
|
1274 |
Axit metacrylic |
Methacrylic acid |
79-41-4 |
C4H6O2 |
|
|
1275 |
Axit thiolactic |
Thiolactic acid |
79-42-5 |
C3H6O2S |
|
|
1276 |
Axit diclo acetic |
Dichloroacetic acid |
79-43-6 |
C2H2CI2O2 |
|
|
1277 |
Dimetylcacbonyl clorua |
Dimethylcarbamoyl chloride |
79-44-7 |
C3H6ClNO |
1 |
|
1278 |
2-Nitropropan |
2-Nitropropane |
79-46-9 |
C3H7NO2 |
|
|
1279 |
Campheclo |
Camphechlor (Chlorinated camphene) |
8001-35-2 |
C10H10Cl8 |
|
|
1280 |
Sản phẩm xăng dầu |
Petroleum products (Kerosene) |
8008-20-6 |
|
2500000 |
|
1281 |
Diphenyldiclo silan |
Diphenyldichlorosilane |
80-10-4 |
C12H10Cl2Si |
|
|
1282 |
Tetrametylenedisulphotetramin |
Tetramethylenedisulphotetramine |
80-12-6 |
C4H8N4O4S2 |
1 |
|
1283 |
Oleum (hỗn hợp axit sulfuric với lưu huỳnh trioxit) |
Oleum (Fuming Sulfuric acid) (Sulfuric acid, mixture with sulfur trioxide) |
8014-95-7 |
H2SO4*SO3 |
4540 |
|
1284 |
Ceri sắt |
Ferrocerium |
69523-06-4 |
|
|
|
1285 |
Alpha-Pinen |
Alpha-Pinene |
80-56-8 |
C10H16 |
|
|
1286 |
Metyl metacrylat |
Methyl methacrylate |
80-62-6 |
C5H8O2 |
|
|
1287 |
Deraeton |
Demeton |
8065-48-3 |
C8H19O3PS2 |
100 |
|
1288 |
Cyclobutyl clo format |
Cyclobutyl chloroformate |
81228-87-7 |
C5H7CIO2 |
|
|
1289 |
2-PropenoyI clorua |
Acrylyl chloride (2-PropenoyI chloride) |
814-68-6 |
C3H3CIO |
2270 |
|
1290 |
Di butyltin oxit |
Dibutyltin oxide |
818-08-6 |
C8H8OSn |
|
|
1291 |
Warfarin |
Warfarin ((RS)-4-hydroxy- 3-(3- oxo- 1-phenylbutyl)- 2H- chromen- 2-one) |
81-81-2 |
C19H16O4 |
100 |
|
1292 |
Hexametylen diisocyanat |
Hexamethylene diisocyanate (1,6-HexamethyIene diisocyanate) |
822-06-0 |
C8H12N2O2 |
|
|
1293 |
CIo phenyl triclo silan |
Chlorophenyltrichiorosilane |
825-94-5 |
C6H4CI4Si |
|
|
1294 |
Diphacinon |
Diphacinone |
82-66-6 |
C23H16O3 |
100 |
|
1295 |
2,4,6-trinitroresorcinol |
2,4,6-trinitroresorcinol (styphnic acid) |
82-71-3 |
C6H3N3O8 |
50000 |
|
1296 |
Natri picramat |
Sodium picramate |
831-52-7 |
C6H4N3NaO5 |
50000 |
|
1297 |
Nitroxylen |
Nitroxylene |
83-41-0 |
C8H9NO2 |
|
|
1298 |
Selen Hexaflorua |
Selenium fluoride |
7783-79-1 |
SeF6 |
|
|
1299 |
Rotenon |
Rotenone |
83-79-4 |
C23H22O6 |
|
|
1300 |
Telu Hexaflorua (Tellurium hexafluoride: TeF6) |
Tellurium fluoride |
7783-80-4 |
TeF6 |
|
|
1301 |
Phenyl clo fomat |
Phenyl chloroformate |
85-14-9 |
C14H1CIN2O |
|
|
1302 |
Tetrahydrophthalic anhydrit |
Tetrahydrophthalic anhydride |
85-43-8 |
C8H8O3 |
|
|
1303 |
Phthalic anhydrit |
Phthalic anhydride |
85-44-9 |
C8H4O3 |
|
|
1304 |
Benzyl butyl phtalat |
Benzyl butyl phthalate |
85-68-7 |
C9H2O4 |
|
|
1305 |
Cloroformat |
Chloroformate |
85720-84-9 |
C19H2ClO3 |
|
|
1306 |
Azinphos-metyl |
Azinphos-methyl |
86-50-0 |
C10H12N3O3PS2 |
100 |
|
1307 |
Nitronaphthalen |
1-Nitronaphthalene, |
86-57-7 |
C10H7NO2 |
|
|
1308 |
Demeton-o-metyl |
Demeton-o-methyl |
867-27-6 |
C6H15O3PS2 |
|
|
1309 |
Alpha-naphthylthiourea |
Alpha-naphthylthiourea |
86-88-4 |
C11H10N2S |
|
|
1310 |
Dimetyl phosphit |
Dimethyl phosphite |
868-85-9 |
C2H7O3P |
|
|
1311 |
Diazodinitrophenol |
Diazodinitrophenol |
87-31-0 |
C6H2N4O5 |
10000 |
|
1312 |
Triclo benzen |
1,2,3-Trichlorbenzene |
87-61-6 |
C6H3Cl3 |
|
|
1313 |
2,6-Xylidine |
2,6-Xylidine |
87-62-7 |
C8H11N |
|
|
1314 |
Hexaclo butadien |
Hexachlorobutadiene |
87-68-3 |
C4Cl6 |
|
|
1315 |
Pentaclo phenol |
Pentachlorophenol |
87-86-5 |
C6HCl5O |
|
|
1316 |
Axit triclo isocyanuric |
Trichloroisocyanuric acid |
87-90-1 |
C3Cl3N3O3 |
|
|
1317 |
Clo benzotriflorua |
Chlorobenzotri fluoride |
88-16-4 |
C7H4CIF3 |
|
|
1318 |
o-Nitrotoluen |
o-Nitrotoluene |
88-72-2 |
C7H7NO2 |
|
|
1319 |
1-Clo-2-nitrobenzen |
1 -Chloro-2-nitrobenzene |
88-73-3 |
C6H4ClNO2 |
|
|
1320 |
2-Nitroanilin |
2-Nitroaniline |
88-74-4 |
C6H6NO2 |
|
|
1321 |
Dinoseb |
Dinoseb (2-sec-Butyl-4,6-dinitrophenoI) |
88-85-7 |
C10H12N2O5 |
|
|
1322 |
2,4,6-trinitrophenol |
2,4,6-trinitrophenol (picric acid) |
88-89-1 |
C6H3N3O7 |
50000 |
|
1323 |
Thymol |
Thymol |
89-83-8 |
C10H1O |
|
|
1324 |
o-Anisidin |
o-Anisidine |
90-04-0 |
C7H9NO |
|
|
1325 |
Nitroxenlulo (hàm lượng > 12,6% of nitrogen) |
Nitrocellulose (containing > 12,6% of nitrogen) |
9004-70-0 |
|
100000 |
|
1326 |
Canxi resinat |
Calcium resinate |
9007-13-0 |
C40H58CaO4 |
|
|
1327 |
Mangan resinat |
Manganese resinate |
9008-34-8 |
C40H58MgO4 |
|
|
1328 |
Kẽm resinat |
Zinc resinate |
9010-69-9 |
C40H58ZnO4 |
|
|
1329 |
Picolin |
α-picoline (2-Methylpyridine) |
52962-96-6 |
C6H7N |
|
|
1330 |
Toluen 2,6-diisoxyanat |
Toluene 2,6-diisocyanate (Benzene, 1,3-diisocyanato-2-methyl-)1 |
91-08-7 |
C9H6N2O2 |
4540 |
|
1331 |
Decahydronaphathalen |
Decahydronaphthalene |
91-17-8 |
C10H18 |
|
|
1332 |
Naphthalen |
Naphthalene |
91-20-3 |
C10H8 |
|
|
1333 |
Quinolin |
Quinoline |
91-22-5 |
C9H7N |
|
|
1334 |
2-naphtylamin |
2-naphthylamine |
91-59-8 |
C10H9N |
1 |
|
1335 |
N,N-Dietylanilin |
N,N-Diethylaniline |
91-66-7 |
C10H15N |
|
|
1336 |
Stronti asenet |
Strontium arsenete |
91724-16-2 |
SrAsO4 |
|
|
1337 |
3,3'-Diclo benzidin |
3,3'-Dichlorobenzidine |
91-94-1 |
C12H10Cl2N2 |
|
|
1338 |
Demeton-s-metyl |
Demeton-s-methyl (S-2-Ethylthioethyl O,O-dimethyl phosphorothioate) |
919-86-8 |
C6H15O3PS2 |
|
|
1339 |
N-Etyl-N-benzylanilin |
N-Ethyl-N-benzylaniline |
92-59-1 |
C15H17N |
|
|
1340 |
Metylpentadien |
Methylpentadiene |
926-56-7 |
C6H10 |
|
|
1341 |
2-Dimetylaminoac etonitril |
Acetonitrile,2-(dimethylamino)- |
926-64-7 |
C4H8N2 |
|
|
1342 |
4-Aminobiphenyl và/hoặc muối của nó Benzotriclorua, Benzidin và/hoặc các muối, Bis (clometyl) ete, Clometyl metyl ete, 1,2-Dibrometan, Dietyl sulfat, Dimetyl sulfat, Dimetylcacbamoyl clorit, 1,2-Dibrom-3-clo propan, 1,1-Dimetylhydrazin, Dimetylnitro am |
4-Aminobiphenyl and/or its salts Benzotrichloride, Benzidine and/or salts, Bis (chloromethyl) ether, Chloromethyl methyl ether, Bis(chloromethyl) ether, Diethyl sulphate, Dimethyl sulphate, Dimethylcarbamoyl chloride, 1,2-Dibrom-3-chlorpropan, 1,1-Dimety |
92-67-1 |
C12H11N; |
|
|
1343 |
Tert-butylperoxy pivalat (>77%) |
Tert-butylperoxy pivalate (>77%) |
927-07-2 |
|
5000 |
|
1344 |
Hexyltriclo silan |
Hexyltrichlorosilane |
928-65-4 |
C6H13Cl3Si |
|
|
1345 |
Benzidin |
Benzidine ((1,1’-Biphenyl)-4,4'-diamine) |
92-87-5 |
C12H12N2 |
|
|
1346 |
2-(2-Aminoethoxy) etanol |
2-(2-Aminoethoxy) ethanol |
929-06-6 |
C4H11NO2 |
|
|
1347 |
1,1'-biphenyl, 4- nitro- |
1,1'-biphenyl, 4- nitro - |
92-93-3 |
C12H9NO2 |
|
|
1348 |
Silvex |
Silvex |
93-72-1 |
C9H7Cl3O3 |
|
|
1349 |
Benzoyl peroxit |
Benzoyl peroxide |
94-36-0 |
C14H10O4 |
|
|
1350 |
Fonofos |
Fonofos (O-Ethyl S-phenylethylphosphonodithioate) |
944-22-9 |
C10HI5OPS2 |
|
|
1351 |
Clo anisidin |
Chloroanisidine |
95-03-4 |
C7H8ClNO |
|
|
1352 |
Dipenten |
1-methyl-4-prop-1-en-2-ylcyclohexene |
95327-98-3 |
C10H16 |
|
|
1353 |
o-Diclo benzen |
o-Dichlorobenzene |
95-50-1 |
C6H4Cl2 |
|
|
1354 |
2-Clo anilin |
2-Chloroaniline |
95-51-2 |
C6H6ClN |
|
|
1355 |
Florotoluen |
o-Fluorotoluene, |
95-52-3 |
C7H7F |
|
|
1356 |
Aminophenol |
2-Aminophenol, |
95-55-6, |
C6H7NO |
|
|
1357 |
N,N-Dimetylformamid |
N,N-dimethylmethanamide |
95-65-8 |
C8H10O |
|
|
1358 |
2,4-Xylidine |
2,4-Xylidine |
95-68-1 |
C8H11N |
|
|
1359 |
4-Clo-o-toluidin hydroclorua |
4-Chloro-o-toluidine |
95-69-2 |
C7H8ClN |
|
|
1360 |
3,4-Diclo anilin |
3,4-DichloroaniIine |
95-76-1 |
C6H5CI2N |
|
|
1361 |
2,4-Toluilendiamin |
2,4-Toluylenediamine |
95-80-7 |
C7H10N2 |
|
|
1362 |
2,5-Diclo anilin |
2,5-Dichloroaniline |
95-82-9 |
C6H5Cl2N |
|
|
1363 |
2-Amino-4-clo phenol |
2-Amino-4-chlorophenol |
95-85-2 |
C6H6ClNO |
|
|
1364 |
Dimethylcarbam oyl clorua |
Dimethylcarbamoyl chloride |
79-44-7 |
C3H6ClNO |
|
|
1365 |
Etyl oxalat |
Ethyl oxalate |
95-92-1 |
C6H10O4 |
|
|
1366 |
3-Clo-1,2-dibrom propan |
3-Chloro-1,2-dibromopropane |
96-12-8 |
C3H5Br2Cl |
|
|
1367 |
Dietyl keton |
3-Pentanone |
96-22-0 |
C5H10O |
|
|
1368 |
1,3-Diclo propanol-2 |
1,3-Dichloropropan-2-ol |
96-23-1 |
C3H6Cl2O |
|
|
1369 |
Glycerol alpha-monoclo hydrin |
Glycerol alpha-monochlorohydrin |
96-24-2 |
C3H7ClO2 |
|
|
1370 |
Metyl brom axetat |
Methyl bromoacetate |
96-32-2 |
C3H5BrO2 |
|
|
1371 |
Metyl acrylat |
Methyl acrylate |
96-33-3 |
C4H6O2 |
|
|
1372 |
Metyl clo axetat |
Methyl chloroacetate |
96-34-4 |
C3H5ClO2 |
|
|
1373 |
Mctylcyclopentan |
Methylcyclopentane |
96-37-7 |
C6H12 |
|
|
1374 |
Cyclopentanol |
Cyclopentanol |
96-41-3 |
C5H10O |
|
|
1375 |
2-Mercaptoimidazolin |
2-Mercaptoimidazoline |
96-45-7 |
C3H6N2S |
|
|
1376 |
Metyltetrahydrofuran |
2-Methyltetrahydrofiiran |
96-47-9 |
C5H10O |
|
|
1377 |
Clo dinitrobenzen |
2,4-Dinitrochlorobenzene |
97-00-7 |
C6H3ClN2O4 |
|
|
1378 |
2,4-DinitroaniIin |
2,4-Dinitroaniline |
97-02-9 |
C6H5N3O4 |
|
|
1379 |
Etyl isobutyrat |
Ethyl isobutyrate |
97-62-1 |
C6H12O2 |
|
|
1380 |
Etyl metacrylat |
Ethyl methacrylate |
97-63-2 |
C6H10O2 |
|
|
1381 |
Isobutyric anhydrit |
Isobutyric anhydride |
97-72-3 |
C8H14O3 |
|
|
1382 |
Isobutyl isobutyrat |
Isobutyl isobutyrate |
97-85-8 |
C8H16O2 |
|
|
1383 |
Isobutyl metacrylat |
Isobutyl methacrylate |
97-86-9 |
C8H14O2 |
|
|
1384 |
N-Butyl metacrylat |
N-Butyl methacrylate |
97-88-1 |
C8H14O2 |
|
|
1385 |
2-Ethylbutyl alcohol |
2-Ethylbutyraldehite |
97-96-1 |
C6H12O |
|
|
1386 |
Butyltoluen |
Butyltoluene (p-tert-Butyltoluene) |
98-51-1 |
C11H16 |
|
|
1387 |
Furfuryl alcohol |
Furfuryl alcohol |
98-00-0 |
C5H6O2 |
|
|
1388 |
Fufural |
Furfural |
98-01-1 |
C5H4O2 |
|
|
1389 |
Axit benzen arsonic |
Benzene arsonic acid (Phenylarsonic acid) |
98-05-5 |
C6H7AsO3 |
|
|
1390 |
Benzotriclorua |
Benzotrichloride |
98-07-7 |
C7H5CI3 |
|
|
1391 |
Benzotriflorua |
Benzotrifluoride (Trifluorotoluene) |
98-08-8 |
C7H5F3 |
|
|
1392 |
Benzensulphonyl clorua |
Benzenesulfonyl chloride |
98-09-9 |
C6H5ClO2S |
|
|
1393 |
Cyclohexyltriclo silan |
Cyclohexyltrichlorosilane |
98-12-4 |
C6H11Cl3Si |
|
|
1394 |
Phenyltriclo silan |
Phenyltrichlorosilane |
98-13-5 |
C6H5Cl3Si |
|
|
1395 |
3-Triflorometylanilin |
Trifluoromethyl)aniline |
98-16-8 |
C7H6F3N |
|
|
1396 |
Axit 2-acetyloxybenzoic |
2-acetyloxybenzoic acid |
98201-60-6 |
C9H8O4 |
|
|
1397 |
Axit 4-Aminophenylarsonic |
Arsonic acid, As-(4-aminophenyl)- |
98-50-0 |
C6H8AsNO3 |
|
|
1398 |
Axit 4-nitrophenyl Arsonic |
Arsonic acid, As-(4-nitrophenyl)- |
98-72-6 |
C6H6AsNO5 |
|
|
1399 |
Isopropylbenzen (Cumen) |
Cumene |
98-82-8 |
C9H12 |
|
|
1400 |
Isopropenylbenzen |
Isopropenylbenzene |
98-83-9 |
C9H10 |
|
|
1401 |
Benzal clorua |
Benzal chloride |
98-87-3 |
C7H6Cl2 |
|
|
1402 |
Benzoyl clorua |
Benzoyl chloride |
98-88-4 |
C7H5ClO |
|
|
1403 |
Nitrobenzen |
Nitrobenzene |
98-95-3 |
C6H5NO2 |
|
|
1404 |
3-Nitroanilin |
3-Nitroaniline |
99-09-2 |
C6H6N2O2 |
|
|
1405 |
Trinitrobenzen |
Trinitrobenzene |
99-35-4 |
C6H3N3O6 |
50000 |
|
1406 |
Cymen (Metyl isopropyl benzen) |
Cymenel-methyl-4-(1-methylethyl) benzene |
99-87-6 |
C10H14 |
|
|
1407 |
n,n-Dimetyl-p-toluidin |
n,n-Dimethyl-p-toluidine |
99-97-8 |
C9H13N |
|
|
1408 |
p-Nitrotoluen |
p-Nitrotoluene |
99-99-0 |
C7H7NO2 |
|
|
1409 |
Cyclooctadin |
Cyclooctadiene |
29965-97-7 |
C8H16 |
|
|
1410 |
Anthophillit |
Anthophyllite |
|
(Mg,Fe)7Si8O22(OH)2 |
|
|
1411 |
Natri flo silicat |
Sodium fluorosilicate |
16893-85-9 |
Na2SiF6 |
|
|
1412 |
Metavanadat |
Metavanadates |
|
|
|
|
1413 |
Amit của axit 4-florobutyric |
4-fluorobutyric acid, amides |
|
|
1 |
|
1414 |
Este của axit 4-florobutyric |
4-fluorobutyric acid, esters |
|
|
1 |
|
1415 |
Muối của axit 4-florobutyric |
4-fluorobutyric acid, salts |
|
|
1 |
|
1416 |
Amit của axit 4-florocrotonic |
4-fluorocrotonic acid, amides |
|
|
1 |
|
1417 |
Este của axit 4-florocrotonic |
4-fluorocrotonic acid, esters |
|
|
1 |
|
1418 |
Muối của axit 4-florocrotonic |
4-fluorocrotonic acid, salts |
|
|
1 |
|
1419 |
Amit của axit floroaxetic |
Fluoroacetic acid, amides |
|
|
1 |
|
1420 |
Este của axit floroaxetic, |
Fluoroacetic acid, esters |
|
|
1 |
|
1421 |
Muối của axit floroaxetic |
Fluoroacetic acid, salts |
|
|
1 |
|
1422 |
AlkyI chì |
Lead alkyls |
|
|
5000 |
|
1423 |
Các khí hóa lỏng đặc biệt dễ cháy (bao gồm cả LPG và khí thiên nhiên hóa lỏng hoặc không hóa lỏng) |
Liquefied extremely flammable gases (including LPG) and natural gas |
|
|
50000 |
|
1424 |
(a) Xăng và xăng naphta |
(A) Gasoline and gasoline naphtha |
|
|
|
|
1425 |
(b) Dầu kerosen (bao gồm cả nhiên liệu lỏng động cơ) |
(B) Oil and kerosene (including liquid fuel engine) |
|
|
|
|
1426 |
(c) Dầu đốt (bao gồm cả diesel nhiên liệu dầu đốt lò và các Hỗn hợp dầu nhiên liệu) |
(C) fuel oil (diesel fuel including furnace oil and fuel oil mixture) |
|
|
|
|
1427 |
Các chất có khả năng gây ung thư có nồng độ trên 5% về khối lượng: |
The potent carcinogen concentrations above 5% in volume: |
|
|
500 |
|
1428 |
Các hợp chất N,N-Dialkyl (Me, Et, n-Pr hoặc i-Pr) photphoramidic dihalit |
|
|
|
|
|
1429 |
Các hợp chất Dialkyl (Me, Et, n-Pr hoặc i-Pr) N,N-dialkyl (Me, Et, n-Pr hoặc i-Pr)-photphoramidat |
|
|
|
|
|
1430 |
Các hợp chất N,N-Dialkyl (Me, Et, n-Pr hoặc i-Pr) aminoetyl-2-clorit và các muối proton hóa tương ứng |
|
|
|
|
|
1431 |
Các hợp chất N,N-Dialkyl (Me, Et, n-Pr hoặc i-Pr) aminoetan-2-ol và các muối proton hóa tương ứng ngoại trừ: |
|
|
|
|
|
1432 |
Các hợp chất N,N-Dialkyl (Me, Et, n-Pr hoặc i-Pr) aminoetan-2-thiol và các muối proton hóa tương ứng |
|
|
|
|
|
1433 |
Nhóm các vật liệu nổ công nghiệp |
|
|
|
|
|
1434 |
Stibium asen |
Stibium Arsenic |
|
|
|
|
1435 |
Xeri xyanua |
Xerium Cyanide |
|
|
|
|
1436 |
Anthraquinon -1-axit arsonic |
|
|
|
|
|
1437 |
Phenylarsine di iodid |
Phenylalanine di iodide |
|
|
|
|
1438 |
Axit 3-Aminophenylarsonic |
|
|
|
|
|
1439 |
Các hợp chất thủy ngân |
|
|
|
|
|
1440 |
Các hợp chất amiang |
|
|
|
|
|
1441 |
Keton |
Ketone |
|
|
|
|
1442 |
Hợp chất mercaptan |
|
|
|
|
|
1443 |
Amid kim loại kiềm |
Amide metal amides |
|
|
|
|
1444 |
Hỗn hống (Amalgam) kim loại kiềm thổ |
|
|
|
|
|
1445 |
Alkaloid |
Alkaloid |
|
|
|
|
1446 |
Hợp chất Beri |
|
|
|
|
|
1447 |
Deuterium |
Deuterium |
|
|
|
|
1448 |
Axit cromosulphuric |
Acid crom sulphuric |
|
|
|
|
1449 |
Tetrahydropyridin |
1,2,3,6-Tetrahydropyridine |
|
|
|
|
1450 |
Alkylphenol |
Alkylphenol |
|
|
|
|
1451 |
Liti alkyl |
Lithium alkyl |
|
|
|
|
1452 |
Diclo diisopropyl ete |
Dichlorodisopropyl ether |
|
|
|
|
1453 |
Axit Alkylsulphonic và arylsulphonic |
Sulfonic acid |
|
|
|
|
1454 |
Axit floroacetic |
Acid floroacetice |
|
|
|
|
1455 |
Bisulfua |
Bisulfite |
|
|
|
|
1456 |
Polysulphid |
Polysulphide |
|
|
|
|
1457 |
Canxi mangan silicon |
Calcium manganese silicon |
|
|
|
|
1458 |
Polyvanadat |
Polyvanadate |
|
|
|
|
1459 |
Clo phenolat |
Chlorophenolate |
|
|
|
|
1460 |
Phenolat |
|
|
|
|
|
1461 |
Nhôm alkyl |
Aluminium alkyl |
|
|
|
|
1462 |
Magiê alkyl |
Magnesium alkyl |
|
|
|
|
1463 |
Nhôm alkyl hydrid |
Aluminium alkyl hydride |
|
|
|
|
1464 |
Alkaloid |
Alkaloid |
|
|
|
|
1465 |
Alkylphenol |
Alkylphenol |
|
|
|
|
1466 |
Organometallic |
Organometallic |
|
|
|
|
1467 |
Xanthat |
Xanthate |
|
|
|
Ghi chú:
Khối lượng giới hạn (đơn vị tính là kg) được hiểu là khối lượng hóa chất lớn nhất được lưu trữ trong thiết bị chứa tại một thời điểm tại cơ sở hoạt động hóa chất.
Bạn chưa Đăng nhập thành viên.
Đây là tiện ích dành cho tài khoản thành viên. Vui lòng Đăng nhập để xem chi tiết. Nếu chưa có tài khoản, vui lòng Đăng ký tại đây!
Bạn chưa Đăng nhập thành viên.
Đây là tiện ích dành cho tài khoản thành viên. Vui lòng Đăng nhập để xem chi tiết. Nếu chưa có tài khoản, vui lòng Đăng ký tại đây!